Compare commits

..

17 Commits

Author SHA1 Message Date
Gud Boi 69a52d6fb1 Better doc-strings n styling in `piker.cli` eps
Add comprehensive docstrings to the top-level CLI endpoints and helpers,
explaining the purpose and structure of each (sub)command.

Deats,
- add detailed docstring to `pikerd()` explaining its role as the
  root service-actor/daemon supervisor.
- add docstring to `cli()` noting it's the root endpoint generally
  requiring a sub-cmd input.
- add extensive docstring to `services()` explaining the daemon naming
  conventions and listing a few current/common service actors.
- add docstring to `_load_clis()` explaining dynamic CLI loading.

Stylin,
- add multiline style to `and not maddrs` conditional in
  `load_trans_eps()`.
- drop commented-out `--tsdb` and `--es` click options from
  `pikerd()`, they're more or less obsolete given `nativedb`.
- add type annots where obviously handy.
- add TODO comment about UDS support in `services()`.

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi 095d712443 Adjust sampler's "IPC-dropped" log msg styling
Refmt the "connection-dropped" error-log in `Sampler`'s broadcast loop
to show error type first, then the IPC context details; mks it all
easier to grok/less-noisy on console imo.

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi cb2974f405 Wrap `open_autorecon_ws()` body for comms failures
Add outer `try/except` around the nursery block in
`open_autorecon_ws()` to catch any `NoBsWs.recon_errors` that
escape the inner reconnect loop, logging a warning instead of
propagating.

Also,
- correct `NoBsWs.recon_errors` typing to `tuple[Type[Exception]]`.

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi 5e7dac2b90 Add timeout + shielding to `NoBsWs` reconnect logic
Add timeout param to `.reset()` and `.send_msg()` to prevent
indefinite blocking on reconnect attempts. Shield reconnect
sleeps from cancellation to ensure we avoid any "finally footgun" type
scenarios where `trio.Cancelled` masks an underlying exc per,
- https://github.com/goodboy/tractor/pull/387
- https://github.com/goodboy/tractor/pull/391

Deats,
- add `timeout` param to `.reset()`, return `bool` for success
- add `timeout=3` default to `.send_msg()` for reconnect wait
- shield `.reset()` call in `.send_msg()` error handler
- log warning when reconnect timeout exceeded
- shield throttled sleeps in `_reconnect_forever()` error paths

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi 9e877e0666 Handle `tractor.TransportClosed` as "stream-closed"
In both the ems and sampler since on new `tractor` this is the
"wrapping" exception raised when the transport layer terminates early
but in a psuedo-"graceful" way, expected when a peer actors disconnect.
Previously we were crashing in this case since old `tractor` just raised
the underlying `trio`-source-exceptions verbatim.

Also,
- use `Aid.reprol()` in log msgs vs old `.chan.uid` refs

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi 8aaaeb19ed .data.feed: move `Flume` import to avoid cycle
Move `Flume` to `TYPE_CHECKING` and add runtime imports in
`allocate_persistent_feed()` + `open_feed()` to avoid cycle
with `.flows` mod.

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi c5125e7955 .fsp._engine: enable console logging in `cascade()`
Add console log setup with module name + multiline style for
desync warning msg.

Also,
- fix import: `Flume` from `.data.flows` vs `.data.feed`
- move `Feed` to `TYPE_CHECKING` block
- add TODO comment about `tractor._state` dict issue

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi 7bb80e85b0 Add order-cancel debugging and multiline kbd logs
Add verbose logging + error handling for order cancellation
hotkey path and multiline style for view-mode kb msgs.

Deats,
- add `Cursor.is_hovered()` to check hover state
- log warnings when no orders cancelled via <c> hotkey
- add try-except around `.cancel_orders_under_cursor()`
- log `cur._hovered` state in `.ui._lines` hover handlers
- change `Dialog.cancel_orders()` to return `list[Dialog]`
- fix import: `Flume` from `.data.flows` vs `.data.feed`
- comment-out multi-status msgs in order submit/cancel

Also,
- convert all multiline kbd `if` conditionals to use `and`
  on separate lines for consistency
- move `import tractor` to top of `._interaction`
- change `print()` to `log.debug()` in `LevelLine`
- fix type annotation spacing: `Callable|None` vs `Callable | None`

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi 46004b2fc3 .ui._app: enable console logging in `_async_main()`
Now we're actualy emitting colored-logs (again?), not sure how this got
borked but maybe it's due to `tractor.log`'s new changes?

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:50:42 -05:00
Gud Boi 0b63a73954 Move `GodWidget` to new `._widget` mod
Extract root-most widget to resolve (various) `.ui` import cycles
when the type is declared on `Struct`s..

Deats,
- flip to `from ._widget import GodWidget`.
- move `Feed` + `Flume` imports to TYPE_CHECKING in `._chart`
- drop unused `trio` import from `._chart`
- fix docstring typo: "datums```" -> "`datums``"
- change `print()` to `log.warning()` for global step msg

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:08:07 -05:00
Gud Boi 8fb47f761a Point `.types.Struct` to `tractor.msg.pretty_struct`
Drop the local (and original) `Struct` impl from `piker.types` in favour
of `tractor`'s version now that it's been upstreamed.

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:07:53 -05:00
Gud Boi ad37ebabb2 Cleanups and doc tweaks to `.ui._fsp`
Expand read-race warning log for clarity, add TODO for reading
`tractor` transport config from `conf.toml`, and reflow docstring
in `open_vlm_displays()`.

Also,
- whitespace cleanup: `Type | None` -> `Type|None`
- clarify "Volume" -> "Vlm (volume)" in docstr

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:06:54 -05:00
Gud Boi 5020266bd5 Add `get_godw()` singleton getter for `GodWidget`
Expose `get_godw()` helper to retrieve the central `GodWidget`
instance from anywhere in the UI code. Set the singleton in
`_async_main()` on startup.

Also,
- add docstring to `run_qtractor()` explaining trio guest mode
- type annotate `instance: GodWidget` in `run_qtractor()`
- import reorg in `._app` for cleaner grouping
- whitespace cleanup: `Type | None` -> `Type|None` throughout
- fix bitwise-or alignment: `Flag | Other` -> `Flag|Other`

(this commit-msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code
2026-02-22 16:06:28 -05:00
Gud Boi d6a56d87bf Rm unused import in `.ui._curve` 2026-02-22 16:05:52 -05:00
Gud Boi e8152b8534 Add a couple cooler "cooler"/"muted" red and greens 2026-02-22 16:04:00 -05:00
Gud Boi bb81c74353 .ui.order_mode: multiline import styling 2026-02-22 16:03:42 -05:00
Gud Boi 7eaf28479c Fix `Qt6` types for new sub-namespaces 2026-02-22 16:03:19 -05:00
22 changed files with 1856 additions and 4610 deletions

View File

@ -250,9 +250,7 @@ async def vnc_click_hack(
'connection': 'r' 'connection': 'r'
}[reset_type] }[reset_type]
with tractor.devx.open_crash_handler( with tractor.devx.open_crash_handler():
ignore={TimeoutError,},
):
client = await AsyncVNCClient.connect( client = await AsyncVNCClient.connect(
VNCConfig( VNCConfig(
host=host, host=host,
@ -333,14 +331,7 @@ def i3ipc_xdotool_manual_click_hack() -> None:
''' '''
focussed, matches = i3ipc_fin_wins_titled() focussed, matches = i3ipc_fin_wins_titled()
try: orig_win_id = focussed.window
orig_win_id = focussed.window
except AttributeError:
# XXX if .window cucks we prolly aren't intending to
# use this and/or just woke up from suspend..
log.exception('xdotool invalid usage ya ??\n')
return
try: try:
for name, con in matches: for name, con in matches:
print(f'Resetting data feed for {name}') print(f'Resetting data feed for {name}')

View File

@ -1187,7 +1187,7 @@ async def load_aio_clients(
# the API TCP in `ib_insync` connection can be flaky af so instead # the API TCP in `ib_insync` connection can be flaky af so instead
# retry a few times to get the client going.. # retry a few times to get the client going..
connect_retries: int = 3, connect_retries: int = 3,
connect_timeout: float = 30, # in case a remote-host connect_timeout: float = 10,
disconnect_on_exit: bool = True, disconnect_on_exit: bool = True,
) -> dict[str, Client]: ) -> dict[str, Client]:

View File

@ -178,8 +178,8 @@ async def open_history_client(
async def get_hist( async def get_hist(
timeframe: float, timeframe: float,
end_dt: datetime|None = None, end_dt: datetime | None = None,
start_dt: datetime|None = None, start_dt: datetime | None = None,
) -> tuple[np.ndarray, str]: ) -> tuple[np.ndarray, str]:
@ -262,38 +262,7 @@ async def open_history_client(
vlm = bars_array['volume'] vlm = bars_array['volume']
vlm[vlm < 0] = 0 vlm[vlm < 0] = 0
# XXX, if a start-limit was passed ensure we only return bars_array, first_dt, last_dt
# return history that far back!
if (
start_dt
and
first_dt < start_dt
):
trimmed_bars = bars_array[
bars_array['time'] >= start_dt.timestamp()
]
if (
trimmed_first_dt := from_timestamp(trimmed_bars['time'][0])
!=
start_dt
):
# TODO! rm this once we're more confident it never hits!
breakpoint()
raise RuntimeError(
f'OHLC-bars array start is gt `start_dt` limit !!\n'
f'start_dt: {start_dt}\n'
f'first_dt: {first_dt}\n'
f'trimmed_first_dt: {trimmed_first_dt}\n'
)
# XXX, overwrite with start_dt-limited frame
bars_array = trimmed_bars
return (
bars_array,
first_dt,
last_dt,
)
# TODO: it seems like we can do async queries for ohlc # TODO: it seems like we can do async queries for ohlc
# but getting the order right still isn't working and I'm not # but getting the order right still isn't working and I'm not
@ -428,7 +397,7 @@ async def get_bars(
# blank to start which tells ib to look up the latest datum # blank to start which tells ib to look up the latest datum
end_dt: str = '', end_dt: str = '',
start_dt: str|None = '', start_dt: str | None = '',
# TODO: make this more dynamic based on measured frame rx latency? # TODO: make this more dynamic based on measured frame rx latency?
# how long before we trigger a feed reset (seconds) # how long before we trigger a feed reset (seconds)
@ -482,8 +451,6 @@ async def get_bars(
dt_duration, dt_duration,
) = await proxy.bars( ) = await proxy.bars(
fqme=fqme, fqme=fqme,
# XXX TODO! lol we're not using this..
# start_dt=start_dt,
end_dt=end_dt, end_dt=end_dt,
sample_period_s=timeframe, sample_period_s=timeframe,
@ -1115,7 +1082,6 @@ async def stream_quotes(
con: Contract = details.contract con: Contract = details.contract
first_ticker: Ticker|None = None first_ticker: Ticker|None = None
first_quote: dict[str, Any] = {}
timeout: float = 1.6 timeout: float = 1.6
with trio.move_on_after(timeout) as quote_cs: with trio.move_on_after(timeout) as quote_cs:
@ -1168,14 +1134,15 @@ async def stream_quotes(
first_quote, first_quote,
)) ))
# it's not really live but this will unblock
# the brokerd feed task to tell the ui to update?
feed_is_live.set()
# block and let data history backfill code run. # block and let data history backfill code run.
# XXX obvi given the venue is closed, we never expect feed # XXX obvi given the venue is closed, we never expect feed
# to come up; a taskc should be the only way to # to come up; a taskc should be the only way to
# terminate this task. # terminate this task.
await trio.sleep_forever() await trio.sleep_forever()
#
# ^^XXX^^TODO! INSTEAD impl a `trio.sleep()` for the
# duration until the venue opens!!
# ?TODO, we could instead spawn a task that waits on a feed # ?TODO, we could instead spawn a task that waits on a feed
# to start and let it wait indefinitely..instead of this # to start and let it wait indefinitely..instead of this
@ -1199,9 +1166,6 @@ async def stream_quotes(
'Rxed init quote:\n' 'Rxed init quote:\n'
f'{pformat(first_quote)}' f'{pformat(first_quote)}'
) )
# signal `.data.feed` layer that mkt quotes are LIVE
feed_is_live.set()
cs: trio.CancelScope|None = None cs: trio.CancelScope|None = None
startup: bool = True startup: bool = True
iter_quotes: trio.abc.Channel iter_quotes: trio.abc.Channel
@ -1249,12 +1213,55 @@ async def stream_quotes(
tn.start_soon(reset_on_feed) tn.start_soon(reset_on_feed)
async with aclosing(iter_quotes): async with aclosing(iter_quotes):
# if syminfo.get('no_vlm', False):
if not init_msg.shm_write_opts['has_vlm']:
# generally speaking these feeds don't
# include vlm data.
atype: str = mkt.dst.atype
log.info(
f'No-vlm {mkt.fqme}@{atype}, skipping quote poll'
)
else:
# wait for real volume on feed (trading might be
# closed)
while True:
ticker = await iter_quotes.receive()
# for a real volume contract we rait for
# the first "real" trade to take place
if (
# not calc_price
# and not ticker.rtTime
False
# not ticker.rtTime
):
# spin consuming tickers until we
# get a real market datum
log.debug(f"New unsent ticker: {ticker}")
continue
else:
log.debug("Received first volume tick")
# ugh, clear ticks since we've
# consumed them (ahem, ib_insync is
# truly stateful trash)
# ticker.ticks = []
# XXX: this works because we don't use
# ``aclosing()`` above?
break
quote = normalize(ticker)
log.debug(f"First ticker received {quote}")
# tell data-layer spawner-caller that live # tell data-layer spawner-caller that live
# quotes are now active desptie not having # quotes are now active desptie not having
# necessarily received a first vlm/clearing # necessarily received a first vlm/clearing
# tick. # tick.
ticker = await iter_quotes.receive() ticker = await iter_quotes.receive()
quote = normalize(ticker) feed_is_live.set()
fqme: str = quote['fqme'] fqme: str = quote['fqme']
await send_chan.send({fqme: quote}) await send_chan.send({fqme: quote})

View File

@ -61,7 +61,8 @@ def load_trans_eps(
if ( if (
network network
and not maddrs and
not maddrs
): ):
# load network section and (attempt to) connect all endpoints # load network section and (attempt to) connect all endpoints
# which are reachable B) # which are reachable B)
@ -112,26 +113,19 @@ def load_trans_eps(
default=None, default=None,
help='Multiaddrs to bind or contact', help='Multiaddrs to bind or contact',
) )
# @click.option(
# '--tsdb',
# is_flag=True,
# help='Enable local ``marketstore`` instance'
# )
# @click.option(
# '--es',
# is_flag=True,
# help='Enable local ``elasticsearch`` instance'
# )
def pikerd( def pikerd(
maddr: list[str] | None, maddr: list[str] | None,
loglevel: str, loglevel: str,
tl: bool, tl: bool,
pdb: bool, pdb: bool,
# tsdb: bool,
# es: bool,
): ):
''' '''
Spawn the piker broker-daemon. Start the "root service actor", `pikerd`, run it until
cancellation.
This "root daemon" operates as the top most service-mngr and
subsys-as-subactor supervisor, think of it as the "init proc" of
any of any `piker` application or daemon-process tree.
''' '''
# from tractor.devx import maybe_open_crash_handler # from tractor.devx import maybe_open_crash_handler
@ -237,6 +231,14 @@ def cli(
regaddr: str, regaddr: str,
) -> None: ) -> None:
'''
The "root" `piker`-cmd CLI endpoint.
NOTE, this def generally relies on and requires a sub-cmd to be
provided by the user, OW only a `--help` msg (listing said
subcmds) will be dumped to console.
'''
if configdir is not None: if configdir is not None:
assert os.path.isdir(configdir), f"`{configdir}` is not a valid path" assert os.path.isdir(configdir), f"`{configdir}` is not a valid path"
config._override_config_dir(configdir) config._override_config_dir(configdir)
@ -295,17 +297,50 @@ def cli(
@click.option('--tl', is_flag=True, help='Enable tractor logging') @click.option('--tl', is_flag=True, help='Enable tractor logging')
@click.argument('ports', nargs=-1, required=False) @click.argument('ports', nargs=-1, required=False)
@click.pass_obj @click.pass_obj
def services(config, tl, ports): def services(
config,
tl: bool,
ports: list[int],
):
'''
List all `piker` "service deamons" to the console in
a `json`-table which maps each actor's UID in the form,
from ..service import ( `{service_name}.{subservice_name}.{UUID}`
to its (primary) IPC server address.
(^TODO, should be its multiaddr form once we support it)
Note that by convention actors which operate as "headless"
processes (those without GUIs/graphics, and which generally
parent some noteworthy subsystem) are normally suffixed by
a "d" such as,
- pikerd: the root runtime supervisor
- brokerd: a broker-backend order ctl daemon
- emsd: the internal dark-clearing and order routing daemon
- datad: a data-provider-backend data feed daemon
- samplerd: the real-time data sampling and clock-syncing daemon
"Headed units" are normally just given an obvious app-like name
with subactors indexed by `.` such as,
- chart: the primary modal charting iface, a Qt app
- chart.fsp_0: a financial-sig-proc cascade instance which
delivers graphics to a parent `chart` app.
- polars_boi: some (presumably) `polars` using console app.
'''
from piker.service import (
open_piker_runtime, open_piker_runtime,
_default_registry_port, _default_registry_port,
_default_registry_host, _default_registry_host,
) )
host = _default_registry_host # !TODO, mk this to work with UDS!
host: str = _default_registry_host
if not ports: if not ports:
ports = [_default_registry_port] ports: list[int] = [_default_registry_port]
addr = tractor._addr.wrap_address( addr = tractor._addr.wrap_address(
addr=(host, ports[0]) addr=(host, ports[0])
@ -336,7 +371,15 @@ def services(config, tl, ports):
def _load_clis() -> None: def _load_clis() -> None:
# from ..service import elastic # noqa '''
Dynamically load and register all subsys CLI endpoints (at call
time).
NOTE, obviously this is normally expected to be called at
`import` time and implicitly relies on our use of various
`click`/`typer` decorator APIs.
'''
from ..brokers import cli # noqa from ..brokers import cli # noqa
from ..ui import cli # noqa from ..ui import cli # noqa
from ..watchlists import cli # noqa from ..watchlists import cli # noqa
@ -346,5 +389,5 @@ def _load_clis() -> None:
from ..accounting import cli # noqa from ..accounting import cli # noqa
# load downstream cli modules # load all subsytem cli eps
_load_clis() _load_clis()

View File

@ -80,20 +80,20 @@ class Sampler:
This non-instantiated type is meant to be a singleton within This non-instantiated type is meant to be a singleton within
a `samplerd` actor-service spawned once by the user wishing to a `samplerd` actor-service spawned once by the user wishing to
time-step-sample (real-time) quote feeds, see time-step-sample (real-time) quote feeds, see
`.service.maybe_open_samplerd()` and the below ``.service.maybe_open_samplerd()`` and the below
`register_with_sampler()`. ``register_with_sampler()``.
''' '''
service_nursery: None|trio.Nursery = None service_nursery: None | trio.Nursery = None
# TODO: we could stick these in a composed type to avoid angering # TODO: we could stick these in a composed type to avoid
# the "i hate module scoped variables crowd" (yawn). # angering the "i hate module scoped variables crowd" (yawn).
ohlcv_shms: dict[float, list[ShmArray]] = {} ohlcv_shms: dict[float, list[ShmArray]] = {}
# holds one-task-per-sample-period tasks which are spawned as-needed by # holds one-task-per-sample-period tasks which are spawned as-needed by
# data feed requests with a given detected time step usually from # data feed requests with a given detected time step usually from
# history loading. # history loading.
incr_task_cs: trio.CancelScope|None = None incr_task_cs: trio.CancelScope | None = None
bcast_errors: tuple[Exception] = ( bcast_errors: tuple[Exception] = (
trio.BrokenResourceError, trio.BrokenResourceError,
@ -249,8 +249,8 @@ class Sampler:
async def broadcast( async def broadcast(
self, self,
period_s: float, period_s: float,
time_stamp: float|None = None, time_stamp: float | None = None,
info: dict|None = None, info: dict | None = None,
) -> None: ) -> None:
''' '''
@ -292,9 +292,10 @@ class Sampler:
except self.bcast_errors as err: except self.bcast_errors as err:
log.error( log.error(
f'Connection dropped for IPC ctx\n' f'Connection dropped for IPC ctx due to,\n'
f'{stream._ctx}\n\n' f'{type(err)!r}\n'
f'Due to {type(err)}' f'\n'
f'{stream._ctx}'
) )
borked.add(stream) borked.add(stream)
else: else:
@ -314,7 +315,7 @@ class Sampler:
@classmethod @classmethod
async def broadcast_all( async def broadcast_all(
self, self,
info: dict|None = None, info: dict | None = None,
) -> None: ) -> None:
# NOTE: take a copy of subs since removals can happen # NOTE: take a copy of subs since removals can happen
@ -331,12 +332,12 @@ class Sampler:
async def register_with_sampler( async def register_with_sampler(
ctx: Context, ctx: Context,
period_s: float, period_s: float,
shms_by_period: dict[float, dict]|None = None, shms_by_period: dict[float, dict] | None = None,
open_index_stream: bool = True, # open a 2way stream for sample step msgs? open_index_stream: bool = True, # open a 2way stream for sample step msgs?
sub_for_broadcasts: bool = True, # sampler side to send step updates? sub_for_broadcasts: bool = True, # sampler side to send step updates?
) -> set[int]: ) -> None:
get_console_log(tractor.current_actor().loglevel) get_console_log(tractor.current_actor().loglevel)
incr_was_started: bool = False incr_was_started: bool = False
@ -363,12 +364,7 @@ async def register_with_sampler(
# insert the base 1s period (for OHLC style sampling) into # insert the base 1s period (for OHLC style sampling) into
# the increment buffer set to update and shift every second. # the increment buffer set to update and shift every second.
if ( if shms_by_period is not None:
shms_by_period is not None
# and
# feed_is_live.is_set()
# ^TODO? pass it in instead?
):
from ._sharedmem import ( from ._sharedmem import (
attach_shm_array, attach_shm_array,
_Token, _Token,
@ -382,17 +378,12 @@ async def register_with_sampler(
readonly=False, readonly=False,
) )
shms_by_period[period] = shm shms_by_period[period] = shm
Sampler.ohlcv_shms.setdefault( Sampler.ohlcv_shms.setdefault(period, []).append(shm)
period,
[],
).append(shm)
assert Sampler.ohlcv_shms assert Sampler.ohlcv_shms
# unblock caller # unblock caller
await ctx.started( await ctx.started(set(Sampler.ohlcv_shms.keys()))
set(Sampler.ohlcv_shms.keys())
)
if open_index_stream: if open_index_stream:
try: try:
@ -438,7 +429,7 @@ async def register_with_sampler(
async def spawn_samplerd( async def spawn_samplerd(
loglevel: str|None = None, loglevel: str | None = None,
**extra_tractor_kwargs **extra_tractor_kwargs
) -> bool: ) -> bool:
@ -484,7 +475,7 @@ async def spawn_samplerd(
@acm @acm
async def maybe_open_samplerd( async def maybe_open_samplerd(
loglevel: str|None = None, loglevel: str | None = None,
**pikerd_kwargs, **pikerd_kwargs,
) -> tractor.Portal: # noqa ) -> tractor.Portal: # noqa
@ -509,11 +500,11 @@ async def maybe_open_samplerd(
@acm @acm
async def open_sample_stream( async def open_sample_stream(
period_s: float, period_s: float,
shms_by_period: dict[float, dict]|None = None, shms_by_period: dict[float, dict] | None = None,
open_index_stream: bool = True, open_index_stream: bool = True,
sub_for_broadcasts: bool = True, sub_for_broadcasts: bool = True,
cache_key: str|None = None, cache_key: str | None = None,
allow_new_sampler: bool = True, allow_new_sampler: bool = True,
ensure_is_active: bool = False, ensure_is_active: bool = False,
@ -544,8 +535,6 @@ async def open_sample_stream(
# yield bistream # yield bistream
# else: # else:
ctx: tractor.Context
shm_periods: set[int] # in `int`-seconds
async with ( async with (
# XXX: this should be singleton on a host, # XXX: this should be singleton on a host,
# a lone broker-daemon per provider should be # a lone broker-daemon per provider should be
@ -560,10 +549,10 @@ async def open_sample_stream(
'open_index_stream': open_index_stream, 'open_index_stream': open_index_stream,
'sub_for_broadcasts': sub_for_broadcasts, 'sub_for_broadcasts': sub_for_broadcasts,
}, },
) as (ctx, shm_periods) ) as (ctx, first)
): ):
if ensure_is_active: if ensure_is_active:
assert len(shm_periods) > 1 assert len(first) > 1
async with ( async with (
ctx.open_stream( ctx.open_stream(

View File

@ -520,12 +520,9 @@ def open_shm_array(
# "unlink" created shm on process teardown by # "unlink" created shm on process teardown by
# pushing teardown calls onto actor context stack # pushing teardown calls onto actor context stack
stack = tractor.current_actor( stack = tractor.current_actor().lifetime_stack
err_on_no_runtime=False, stack.callback(shmarr.close)
).lifetime_stack stack.callback(shmarr.destroy)
if stack:
stack.callback(shmarr.close)
stack.callback(shmarr.destroy)
return shmarr return shmarr
@ -610,10 +607,7 @@ def attach_shm_array(
_known_tokens[key] = token _known_tokens[key] = token
# "close" attached shm on actor teardown # "close" attached shm on actor teardown
if (actor := tractor.current_actor( tractor.current_actor().lifetime_stack.callback(sha.close)
err_on_no_runtime=False,
)):
actor.lifetime_stack.callback(sha.close)
return sha return sha

View File

@ -31,6 +31,7 @@ from typing import (
AsyncContextManager, AsyncContextManager,
AsyncGenerator, AsyncGenerator,
Iterable, Iterable,
Type,
) )
import json import json
@ -67,7 +68,7 @@ class NoBsWs:
''' '''
# apparently we can QoS for all sorts of reasons..so catch em. # apparently we can QoS for all sorts of reasons..so catch em.
recon_errors = ( recon_errors: tuple[Type[Exception]] = (
ConnectionClosed, ConnectionClosed,
DisconnectionTimeout, DisconnectionTimeout,
ConnectionRejected, ConnectionRejected,
@ -370,32 +371,39 @@ async def open_autorecon_ws(
rcv: trio.MemoryReceiveChannel rcv: trio.MemoryReceiveChannel
snd, rcv = trio.open_memory_channel(616) snd, rcv = trio.open_memory_channel(616)
async with ( try:
tractor.trionics.collapse_eg(), async with (
trio.open_nursery() as tn tractor.trionics.collapse_eg(),
): trio.open_nursery() as tn
nobsws = NoBsWs( ):
url, nobsws = NoBsWs(
rcv,
msg_recv_timeout=msg_recv_timeout,
)
await tn.start(
partial(
_reconnect_forever,
url, url,
snd, rcv,
nobsws, msg_recv_timeout=msg_recv_timeout,
fixture=fixture,
reset_after=reset_after,
) )
await tn.start(
partial(
_reconnect_forever,
url,
snd,
nobsws,
fixture=fixture,
reset_after=reset_after,
)
)
await nobsws._connected.wait()
assert nobsws._cs
assert nobsws.connected()
try:
yield nobsws
finally:
tn.cancel_scope.cancel()
except NoBsWs.recon_errors as con_err:
log.warning(
f'Entire ws-channel disconnect due to,\n'
f'con_err: {con_err!r}\n'
) )
await nobsws._connected.wait()
assert nobsws._cs
assert nobsws.connected()
try:
yield nobsws
finally:
tn.cancel_scope.cancel()
''' '''

View File

@ -43,6 +43,7 @@ from typing import (
import numpy as np import numpy as np
from .. import config from .. import config
from ..service import ( from ..service import (
check_for_service, check_for_service,
@ -151,10 +152,7 @@ class StorageConnectionError(ConnectionError):
''' '''
def get_storagemod( def get_storagemod(name: str) -> ModuleType:
name: str,
) -> ModuleType:
mod: ModuleType = import_module( mod: ModuleType = import_module(
'.' + name, '.' + name,
'piker.storage', 'piker.storage',
@ -167,12 +165,9 @@ def get_storagemod(
@acm @acm
async def open_storage_client( async def open_storage_client(
backend: str|None = None, backend: str | None = None,
) -> tuple[ ) -> tuple[ModuleType, StorageClient]:
ModuleType,
StorageClient,
]:
''' '''
Load the ``StorageClient`` for named backend. Load the ``StorageClient`` for named backend.
@ -272,10 +267,7 @@ async def open_tsdb_client(
from ..data.feed import maybe_open_feed from ..data.feed import maybe_open_feed
async with ( async with (
open_storage_client() as ( open_storage_client() as (_, storage),
_,
storage,
),
maybe_open_feed( maybe_open_feed(
[fqme], [fqme],
@ -283,7 +275,7 @@ async def open_tsdb_client(
) as feed, ) as feed,
): ):
profiler(f'opened feed for {fqme!r}') profiler(f'opened feed for {fqme}')
# to_append = feed.hist_shm.array # to_append = feed.hist_shm.array
# to_prepend = None # to_prepend = None

View File

@ -19,10 +19,16 @@ Storage middle-ware CLIs.
""" """
from __future__ import annotations from __future__ import annotations
# from datetime import datetime
# from contextlib import (
# AsyncExitStack,
# )
from pathlib import Path from pathlib import Path
from math import copysign
import time import time
from types import ModuleType from types import ModuleType
from typing import ( from typing import (
Any,
TYPE_CHECKING, TYPE_CHECKING,
) )
@ -41,6 +47,7 @@ from piker.data import (
ShmArray, ShmArray,
) )
from piker import tsp from piker import tsp
from piker.data._formatters import BGM
from . import log from . import log
from . import ( from . import (
__tsdbs__, __tsdbs__,
@ -235,12 +242,122 @@ def anal(
trio.run(main) trio.run(main)
async def markup_gaps(
fqme: str,
timeframe: float,
actl: AnnotCtl,
wdts: pl.DataFrame,
gaps: pl.DataFrame,
) -> dict[int, dict]:
'''
Remote annotate time-gaps in a dt-fielded ts (normally OHLC)
with rectangles.
'''
aids: dict[int] = {}
for i in range(gaps.height):
row: pl.DataFrame = gaps[i]
# the gap's RIGHT-most bar's OPEN value
# at that time (sample) step.
iend: int = row['index'][0]
# dt: datetime = row['dt'][0]
# dt_prev: datetime = row['dt_prev'][0]
# dt_end_t: float = dt.timestamp()
# TODO: can we eventually remove this
# once we figure out why the epoch cols
# don't match?
# TODO: FIX HOW/WHY these aren't matching
# and are instead off by 4hours (EST
# vs. UTC?!?!)
# end_t: float = row['time']
# assert (
# dt.timestamp()
# ==
# end_t
# )
# the gap's LEFT-most bar's CLOSE value
# at that time (sample) step.
prev_r: pl.DataFrame = wdts.filter(
pl.col('index') == iend - 1
)
# XXX: probably a gap in the (newly sorted or de-duplicated)
# dt-df, so we might need to re-index first..
if prev_r.is_empty():
await tractor.pause()
istart: int = prev_r['index'][0]
# dt_start_t: float = dt_prev.timestamp()
# start_t: float = prev_r['time']
# assert (
# dt_start_t
# ==
# start_t
# )
# TODO: implement px-col width measure
# and ensure at least as many px-cols
# shown per rect as configured by user.
# gap_w: float = abs((iend - istart))
# if gap_w < 6:
# margin: float = 6
# iend += margin
# istart -= margin
rect_gap: float = BGM*3/8
opn: float = row['open'][0]
ro: tuple[float, float] = (
# dt_end_t,
iend + rect_gap + 1,
opn,
)
cls: float = prev_r['close'][0]
lc: tuple[float, float] = (
# dt_start_t,
istart - rect_gap, # + 1 ,
cls,
)
color: str = 'dad_blue'
diff: float = cls - opn
sgn: float = copysign(1, diff)
color: str = {
-1: 'buy_green',
1: 'sell_red',
}[sgn]
rect_kwargs: dict[str, Any] = dict(
fqme=fqme,
timeframe=timeframe,
start_pos=lc,
end_pos=ro,
color=color,
)
aid: int = await actl.add_rect(**rect_kwargs)
assert aid
aids[aid] = rect_kwargs
# tell chart to redraw all its
# graphics view layers Bo
await actl.redraw(
fqme=fqme,
timeframe=timeframe,
)
return aids
@store.command() @store.command()
def ldshm( def ldshm(
fqme: str, fqme: str,
write_parquet: bool = True, write_parquet: bool = True,
reload_parquet_to_shm: bool = True, reload_parquet_to_shm: bool = True,
pdb: bool = False, # --pdb passed?
) -> None: ) -> None:
''' '''
@ -260,7 +377,7 @@ def ldshm(
open_piker_runtime( open_piker_runtime(
'polars_boi', 'polars_boi',
enable_modules=['piker.data._sharedmem'], enable_modules=['piker.data._sharedmem'],
debug_mode=pdb, debug_mode=True,
), ),
open_storage_client() as ( open_storage_client() as (
mod, mod,
@ -280,25 +397,18 @@ def ldshm(
times: np.ndarray = shm.array['time'] times: np.ndarray = shm.array['time']
d1: float = float(times[-1] - times[-2]) d1: float = float(times[-1] - times[-2])
d2: float = 0 d2: float = float(times[-2] - times[-3])
# XXX, take a median sample rate if sufficient data med: float = np.median(np.diff(times))
if times.size > 2: if (
d2: float = float(times[-2] - times[-3]) d1 < 1.
med: float = np.median(np.diff(times)) and d2 < 1.
if ( and med < 1.
d1 < 1. ):
and d2 < 1. raise ValueError(
and med < 1. f'Something is wrong with time period for {shm}:\n{times}'
): )
raise ValueError(
f'Something is wrong with time period for {shm}:\n{times}'
)
period_s: float = float(max(d1, d2, med)) period_s: float = float(max(d1, d2, med))
log.info(
f'Processing shm buffer:\n'
f' file: {shmfile.name}\n'
f' period: {period_s}s\n'
)
null_segs: tuple = tsp.get_null_segs( null_segs: tuple = tsp.get_null_segs(
frame=shm.array, frame=shm.array,
@ -307,9 +417,7 @@ def ldshm(
# TODO: call null-seg fixer somehow? # TODO: call null-seg fixer somehow?
if null_segs: if null_segs:
await tractor.pause()
if tractor._state.is_debug_mode():
await tractor.pause()
# async with ( # async with (
# trio.open_nursery() as tn, # trio.open_nursery() as tn,
# mod.open_history_client( # mod.open_history_client(
@ -333,37 +441,11 @@ def ldshm(
wdts, wdts,
deduped, deduped,
diff, diff,
valid_races, ) = tsp.dedupe(
dq_issues,
) = tsp.dedupe_ohlcv_smart(
shm_df, shm_df,
period=period_s,
) )
# Report duplicate analysis
if diff > 0:
log.info(
f'Removed {diff} duplicate timestamp(s)\n'
)
if valid_races is not None:
identical: int = (
valid_races
.filter(pl.col('identical_bars'))
.height
)
monotonic: int = valid_races.height - identical
log.info(
f'Valid race conditions: {valid_races.height}\n'
f' - Identical bars: {identical}\n'
f' - Volume monotonic: {monotonic}\n'
)
if dq_issues is not None:
log.warning(
f'DATA QUALITY ISSUES from provider: '
f'{dq_issues.height} timestamp(s)\n'
f'{dq_issues}\n'
)
# detect gaps from in expected (uniform OHLC) sample period # detect gaps from in expected (uniform OHLC) sample period
step_gaps: pl.DataFrame = tsp.detect_time_gaps( step_gaps: pl.DataFrame = tsp.detect_time_gaps(
deduped, deduped,
@ -378,8 +460,7 @@ def ldshm(
# TODO: actually pull the exact duration # TODO: actually pull the exact duration
# expected for each venue operational period? # expected for each venue operational period?
# gap_dt_unit='day', gap_dt_unit='days',
gap_dt_unit='day',
gap_thresh=1, gap_thresh=1,
) )
@ -390,11 +471,8 @@ def ldshm(
if ( if (
not venue_gaps.is_empty() not venue_gaps.is_empty()
or ( or (
not step_gaps.is_empty() period_s < 60
# XXX, i presume i put this bc i was guarding and not step_gaps.is_empty()
# for ib venue gaps?
# and
# period_s < 60
) )
): ):
# write repaired ts to parquet-file? # write repaired ts to parquet-file?
@ -443,7 +521,7 @@ def ldshm(
do_markup_gaps: bool = True do_markup_gaps: bool = True
if do_markup_gaps: if do_markup_gaps:
new_df: pl.DataFrame = tsp.np2pl(new) new_df: pl.DataFrame = tsp.np2pl(new)
aids: dict = await tsp._annotate.markup_gaps( aids: dict = await markup_gaps(
fqme, fqme,
period_s, period_s,
actl, actl,
@ -456,13 +534,8 @@ def ldshm(
tf2aids[period_s] = aids tf2aids[period_s] = aids
else: else:
# No significant gaps to handle, but may have had # allow interaction even when no ts problems.
# duplicates removed (valid race conditions are ok) assert not diff
if diff > 0 and dq_issues is not None:
log.warning(
'Found duplicates with data quality issues '
'but no significant time gaps!\n'
)
await tractor.pause() await tractor.pause()
log.info('Exiting TSP shm anal-izer!') log.info('Exiting TSP shm anal-izer!')

File diff suppressed because it is too large Load Diff

View File

@ -275,18 +275,6 @@ def get_null_segs(
# diff of abs index steps between each zeroed row # diff of abs index steps between each zeroed row
absi_zdiff: np.ndarray = np.diff(absi_zeros) absi_zdiff: np.ndarray = np.diff(absi_zeros)
if zero_t.size < 2:
try:
breakpoint()
except RuntimeError:
# XXX, if greenback not active from
# piker store ldshm cmd..
log.exception(
"Can't debug single-sample null!\n"
)
return None
# scan for all frame-indices where the # scan for all frame-indices where the
# zeroed-row-abs-index-step-diff is greater then the # zeroed-row-abs-index-step-diff is greater then the
# expected increment of 1. # expected increment of 1.
@ -446,8 +434,8 @@ def get_null_segs(
def iter_null_segs( def iter_null_segs(
timeframe: float, timeframe: float,
frame: Frame|None = None, frame: Frame | None = None,
null_segs: tuple|None = None, null_segs: tuple | None = None,
) -> Generator[ ) -> Generator[
tuple[ tuple[
@ -499,8 +487,7 @@ def iter_null_segs(
start_dt = None start_dt = None
if ( if (
absi_start is not None absi_start is not None
and and start_t != 0
start_t != 0
): ):
fi_start: int = absi_start - absi_first fi_start: int = absi_start - absi_first
start_row: Seq = frame[fi_start] start_row: Seq = frame[fi_start]
@ -514,8 +501,8 @@ def iter_null_segs(
yield ( yield (
absi_start, absi_end, # abs indices absi_start, absi_end, # abs indices
fi_start, fi_end, # relative "frame" indices fi_start, fi_end, # relative "frame" indices
start_t, end_t, # epoch times start_t, end_t,
start_dt, end_dt, # dts start_dt, end_dt,
) )
@ -591,22 +578,11 @@ def detect_time_gaps(
# NOTE: this flag is to indicate that on this (sampling) time # NOTE: this flag is to indicate that on this (sampling) time
# scale we expect to only be filtering against larger venue # scale we expect to only be filtering against larger venue
# closures-scale time gaps. # closures-scale time gaps.
#
# Map to total_ method since `dt_diff` is a duration type,
# not datetime - modern polars requires `total_*` methods
# for duration types (e.g. `total_days()` not `day()`)
# Ensure plural form for polars API (e.g. 'day' -> 'days')
unit_plural: str = (
gap_dt_unit
if gap_dt_unit.endswith('s')
else f'{gap_dt_unit}s'
)
duration_method: str = f'total_{unit_plural}'
return step_gaps.filter( return step_gaps.filter(
# Second by an arbitrary dt-unit step size # Second by an arbitrary dt-unit step size
getattr( getattr(
pl.col('dt_diff').dt, pl.col('dt_diff').dt,
duration_method, gap_dt_unit,
)().abs() > gap_thresh )().abs() > gap_thresh
) )

View File

@ -1,347 +0,0 @@
# piker: trading gear for hackers
# Copyright (C) 2018-present Tyler Goodlet (in stewardship of pikers)
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero General Public License as published by
# the Free Software Foundation, either version 3 of the License, or
# (at your option) any later version.
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# GNU Affero General Public License for more details.
# You should have received a copy of the GNU Affero General Public License
# along with this program. If not, see <https://www.gnu.org/licenses/>.
"""
Time-series (remote) annotation APIs.
"""
from __future__ import annotations
from math import copysign
from typing import (
Any,
TYPE_CHECKING,
)
import polars as pl
import tractor
from piker.data._formatters import BGM
from piker.storage import log
from piker.toolz.profile import (
Profiler,
pg_profile_enabled,
ms_slower_then,
)
from piker.ui._style import get_fonts
if TYPE_CHECKING:
from piker.ui._remote_ctl import AnnotCtl
def humanize_duration(
seconds: float,
) -> str:
'''
Convert duration in seconds to short human-readable form.
Uses smallest appropriate time unit:
- d: days
- h: hours
- m: minutes
- s: seconds
Examples:
- 86400 -> "1d"
- 28800 -> "8h"
- 180 -> "3m"
- 45 -> "45s"
'''
abs_secs: float = abs(seconds)
if abs_secs >= 86400:
days: float = abs_secs / 86400
if days >= 10 or days == int(days):
return f'{int(days)}d'
return f'{days:.1f}d'
elif abs_secs >= 3600:
hours: float = abs_secs / 3600
if hours >= 10 or hours == int(hours):
return f'{int(hours)}h'
return f'{hours:.1f}h'
elif abs_secs >= 60:
mins: float = abs_secs / 60
if mins >= 10 or mins == int(mins):
return f'{int(mins)}m'
return f'{mins:.1f}m'
else:
if abs_secs >= 10 or abs_secs == int(abs_secs):
return f'{int(abs_secs)}s'
return f'{abs_secs:.1f}s'
async def markup_gaps(
fqme: str,
timeframe: float,
actl: AnnotCtl,
wdts: pl.DataFrame,
gaps: pl.DataFrame,
# XXX, switch on to see txt showing a "humanized" label of each
# gap's duration.
show_txt: bool = False,
# A/B comparison: render individual arrows alongside batch
# for visual comparison
show_individual_arrows: bool = False,
) -> dict[int, dict]:
'''
Remote annotate time-gaps in a dt-fielded ts (normally OHLC)
with rectangles.
'''
profiler = Profiler(
msg=f'markup_gaps() for {gaps.height} gaps',
disabled=False,
ms_threshold=0.0,
)
# XXX: force chart redraw FIRST to ensure PlotItem coordinate
# system is properly initialized before we position annotations!
# Without this, annotations may be misaligned on first creation
# due to Qt/pyqtgraph initialization race conditions.
await actl.redraw(
fqme=fqme,
timeframe=timeframe,
)
profiler('first `.redraw()` before annot creation')
log.info(
f'markup_gaps() called:\n'
f' fqme: {fqme}\n'
f' timeframe: {timeframe}s\n'
f' gaps.height: {gaps.height}\n'
)
# collect all annotation specs for batch submission
rect_specs: list[dict] = []
arrow_specs: list[dict] = []
text_specs: list[dict] = []
aids: dict[int] = {}
for i in range(gaps.height):
row: pl.DataFrame = gaps[i]
# the gap's RIGHT-most bar's OPEN value
# at that time (sample) step.
iend: int = row['index'][0]
# dt: datetime = row['dt'][0]
# dt_prev: datetime = row['dt_prev'][0]
# dt_end_t: float = dt.timestamp()
# TODO: can we eventually remove this
# once we figure out why the epoch cols
# don't match?
# TODO: FIX HOW/WHY these aren't matching
# and are instead off by 4hours (EST
# vs. UTC?!?!)
# end_t: float = row['time']
# assert (
# dt.timestamp()
# ==
# end_t
# )
# the gap's LEFT-most bar's CLOSE value
# at that time (sample) step.
prev_r: pl.DataFrame = wdts.filter(
pl.col('index') == iend - 1
)
# XXX: probably a gap in the (newly sorted or de-duplicated)
# dt-df, so we might need to re-index first..
dt: pl.Series = row['dt']
dt_prev: pl.Series = row['dt_prev']
if prev_r.is_empty():
# XXX, filter out any special ignore cases,
# - UNIX-epoch stamped datums
# - first row
if (
dt_prev.dt.epoch()[0] == 0
or
dt.dt.epoch()[0] == 0
):
log.warning('Skipping row with UNIX epoch timestamp ??')
continue
if wdts[0]['index'][0] == iend: # first row
log.warning('Skipping first-row (has no previous obvi) !!')
continue
# XXX, if the previous-row by shm-index is missing,
# meaning there is a missing sample (set), get the prior
# row by df index and attempt to use it?
i_wdts: pl.DataFrame = wdts.with_row_index(name='i')
i_row: int = i_wdts.filter(pl.col('index') == iend)['i'][0]
prev_row_by_i = wdts[i_row]
prev_r: pl.DataFrame = prev_row_by_i
# debug any missing pre-row
if tractor._state.is_debug_mode():
await tractor.pause()
istart: int = prev_r['index'][0]
# TODO: implement px-col width measure
# and ensure at least as many px-cols
# shown per rect as configured by user.
# gap_w: float = abs((iend - istart))
# if gap_w < 6:
# margin: float = 6
# iend += margin
# istart -= margin
opn: float = row['open'][0]
cls: float = prev_r['close'][0]
# get gap duration for humanized label
gap_dur_s: float = row['s_diff'][0]
gap_label: str = humanize_duration(gap_dur_s)
# XXX: get timestamps for server-side index lookup
start_time: float = prev_r['time'][0]
end_time: float = row['time'][0]
# BGM=0.16 is the normal diff from overlap between bars, SO
# just go slightly "in" from that "between them".
from_idx: int = BGM - .06 # = .10
lc: tuple[float, float] = (
istart + 1 - from_idx,
cls,
)
ro: tuple[float, float] = (
iend + from_idx,
opn,
)
diff: float = cls - opn
sgn: float = copysign(1, diff)
up_gap: bool = sgn == -1
down_gap: bool = sgn == 1
flat: bool = sgn == 0
color: str = 'dad_blue'
# TODO? mks more sense to have up/down coloring?
# color: str = {
# -1: 'lilypad_green', # up-gap
# 1: 'wine', # down-gap
# }[sgn]
# collect rect spec (no fqme/timeframe, added by batch
# API)
rect_spec: dict[str, Any] = dict(
meth='set_view_pos',
start_pos=lc,
end_pos=ro,
color=color,
update_label=False,
start_time=start_time,
end_time=end_time,
)
rect_specs.append(rect_spec)
direction: str = (
'down' if down_gap
else 'up'
)
# collect arrow spec
gap_time: float = row['time'][0]
arrow_spec: dict[str, Any] = dict(
x=iend, # fallback if timestamp lookup fails
y=cls,
time=gap_time, # for server-side index lookup
color=color,
alpha=169,
pointing=direction,
headLen=10,
headWidth=2.222,
pxMode=True,
)
arrow_specs.append(arrow_spec)
# add duration label to RHS of arrow
if up_gap:
anchor = (0, 0)
# ^XXX? i dun get dese dims.. XD
elif down_gap:
anchor = (0, 1) # XXX y, x?
else: # no-gap?
assert flat
anchor = (0, 0) # up from bottom
# collect text spec if enabled
if show_txt:
font, small_font = get_fonts()
font_size: int = small_font.px_size - 1
text_spec: dict[str, Any] = dict(
text=gap_label,
x=iend + 1, # fallback if timestamp lookup fails
y=cls,
time=gap_time, # server-side index lookup
color=color,
anchor=anchor,
font_size=font_size,
)
text_specs.append(text_spec)
# submit all annotations in single batch IPC msg
log.info(
f'Submitting batch annotations:\n'
f' rects: {len(rect_specs)}\n'
f' arrows: {len(arrow_specs)}\n'
f' texts: {len(text_specs)}\n'
)
profiler('built all annotation specs')
result: dict[str, list[int]] = await actl.add_batch(
fqme=fqme,
timeframe=timeframe,
rects=rect_specs,
arrows=arrow_specs,
texts=text_specs,
show_individual_arrows=show_individual_arrows,
)
profiler('batch `.add_batch()` IPC call complete')
# build aids dict from batch results
for aid in result['rects']:
aids[aid] = {'type': 'rect'}
for aid in result['arrows']:
aids[aid] = {'type': 'arrow'}
for aid in result['texts']:
aids[aid] = {'type': 'text'}
log.info(
f'Batch submission complete: {len(aids)} annotation(s) '
f'created'
)
profiler('built aids result dict')
# tell chart to redraw all its graphics view layers
await actl.redraw(
fqme=fqme,
timeframe=timeframe,
)
profiler('final `.redraw()` after annot creation')
return aids

View File

@ -1,206 +0,0 @@
'''
Smart OHLCV deduplication with data quality validation.
Handles concurrent write conflicts by keeping the most complete bar
(highest volume) while detecting data quality anomalies.
'''
import polars as pl
from ._anal import with_dts
def dedupe_ohlcv_smart(
src_df: pl.DataFrame,
time_col: str = 'time',
volume_col: str = 'volume',
sort: bool = True,
) -> tuple[
pl.DataFrame, # with dts
pl.DataFrame, # deduped (keeping higher volume bars)
int, # count of dupes removed
pl.DataFrame|None, # valid race conditions
pl.DataFrame|None, # data quality violations
]:
'''
Smart OHLCV deduplication keeping most complete bars.
For duplicate timestamps, keeps bar with highest volume under
the assumption that higher volume indicates more complete/final
data from backfill vs partial live updates.
Returns
-------
Tuple of:
- wdts: original dataframe with datetime columns added
- deduped: deduplicated frame keeping highest-volume bars
- diff: number of duplicate rows removed
- valid_races: duplicates meeting expected race condition pattern
(volume monotonic, OHLC ranges valid)
- data_quality_issues: duplicates violating expected relationships
indicating provider data problems
'''
wdts: pl.DataFrame = with_dts(src_df)
# Find duplicate timestamps
dupes: pl.DataFrame = wdts.filter(
pl.col(time_col).is_duplicated()
)
if dupes.is_empty():
# No duplicates, return as-is
return (wdts, wdts, 0, None, None)
# Analyze duplicate groups for validation
dupe_analysis: pl.DataFrame = (
dupes
.sort([time_col, 'index'])
.group_by(time_col, maintain_order=True)
.agg([
pl.col('index').alias('indices'),
pl.col('volume').alias('volumes'),
pl.col('high').alias('highs'),
pl.col('low').alias('lows'),
pl.col('open').alias('opens'),
pl.col('close').alias('closes'),
pl.col('dt').first().alias('dt'),
pl.len().alias('count'),
])
)
# Validate OHLCV monotonicity for each duplicate group
def check_ohlcv_validity(row) -> dict[str, bool]:
'''
Check if duplicate bars follow expected race condition pattern.
For a valid live-update backfill race:
- volume should be monotonically increasing
- high should be monotonically non-decreasing
- low should be monotonically non-increasing
- open should be identical (fixed at bar start)
Returns dict of violation flags.
'''
vols: list = row['volumes']
highs: list = row['highs']
lows: list = row['lows']
opens: list = row['opens']
violations: dict[str, bool] = {
'volume_non_monotonic': False,
'high_decreased': False,
'low_increased': False,
'open_mismatch': False,
'identical_bars': False,
}
# Check if all bars are identical (pure duplicate)
if (
len(set(vols)) == 1
and len(set(highs)) == 1
and len(set(lows)) == 1
and len(set(opens)) == 1
):
violations['identical_bars'] = True
return violations
# Check volume monotonicity
for i in range(1, len(vols)):
if vols[i] < vols[i-1]:
violations['volume_non_monotonic'] = True
break
# Check high monotonicity (can only increase or stay same)
for i in range(1, len(highs)):
if highs[i] < highs[i-1]:
violations['high_decreased'] = True
break
# Check low monotonicity (can only decrease or stay same)
for i in range(1, len(lows)):
if lows[i] > lows[i-1]:
violations['low_increased'] = True
break
# Check open consistency (should be fixed)
if len(set(opens)) > 1:
violations['open_mismatch'] = True
return violations
# Apply validation
dupe_analysis = dupe_analysis.with_columns([
pl.struct(['volumes', 'highs', 'lows', 'opens'])
.map_elements(
check_ohlcv_validity,
return_dtype=pl.Struct([
pl.Field('volume_non_monotonic', pl.Boolean),
pl.Field('high_decreased', pl.Boolean),
pl.Field('low_increased', pl.Boolean),
pl.Field('open_mismatch', pl.Boolean),
pl.Field('identical_bars', pl.Boolean),
])
)
.alias('validity')
])
# Unnest validity struct
dupe_analysis = dupe_analysis.unnest('validity')
# Separate valid races from data quality issues
valid_races: pl.DataFrame|None = (
dupe_analysis
.filter(
# Valid if no violations OR just identical bars
~pl.col('volume_non_monotonic')
& ~pl.col('high_decreased')
& ~pl.col('low_increased')
& ~pl.col('open_mismatch')
)
)
if valid_races.is_empty():
valid_races = None
data_quality_issues: pl.DataFrame|None = (
dupe_analysis
.filter(
# Issues if any non-identical violation exists
(
pl.col('volume_non_monotonic')
| pl.col('high_decreased')
| pl.col('low_increased')
| pl.col('open_mismatch')
)
& ~pl.col('identical_bars')
)
)
if data_quality_issues.is_empty():
data_quality_issues = None
# Deduplicate: keep highest volume bar for each timestamp
deduped: pl.DataFrame = (
wdts
.sort([time_col, volume_col])
.unique(
subset=[time_col],
keep='last',
maintain_order=False,
)
)
# Re-sort by time or index
if sort:
deduped = deduped.sort(by=time_col)
diff: int = wdts.height - deduped.height
return (
wdts,
deduped,
diff,
valid_races,
data_quality_issues,
)

File diff suppressed because it is too large Load Diff

View File

@ -24,11 +24,8 @@ from pyqtgraph import (
Point, Point,
functions as fn, functions as fn,
Color, Color,
GraphicsObject,
) )
from pyqtgraph.Qt import internals
import numpy as np import numpy as np
import pyqtgraph as pg
from piker.ui.qt import ( from piker.ui.qt import (
QtCore, QtCore,
@ -38,10 +35,6 @@ from piker.ui.qt import (
QRectF, QRectF,
QGraphicsPathItem, QGraphicsPathItem,
) )
from piker.ui._style import hcolor
from piker.log import get_logger
log = get_logger(__name__)
def mk_marker_path( def mk_marker_path(
@ -111,7 +104,7 @@ def mk_marker_path(
class LevelMarker(QGraphicsPathItem): class LevelMarker(QGraphicsPathItem):
''' '''
An arrow marker path graphic which redraws itself An arrow marker path graphich which redraws itself
to the specified view coordinate level on each paint cycle. to the specified view coordinate level on each paint cycle.
''' '''
@ -258,9 +251,9 @@ def qgo_draw_markers(
) -> float: ) -> float:
''' '''
Paint markers in ``pg.GraphicsItem`` style by first removing the Paint markers in ``pg.GraphicsItem`` style by first
view transform for the painter, drawing the markers in scene removing the view transform for the painter, drawing the markers
coords, then restoring the view coords. in scene coords, then restoring the view coords.
''' '''
# paint markers in native coordinate system # paint markers in native coordinate system
@ -302,449 +295,3 @@ def qgo_draw_markers(
p.setTransform(orig_tr) p.setTransform(orig_tr)
return max(sizes) return max(sizes)
class GapAnnotations(GraphicsObject):
'''
Batch-rendered gap annotations using Qt's efficient drawing
APIs.
Instead of creating individual `QGraphicsItem` instances per
gap (which is very slow for 1000+ gaps), this class stores all
gap rectangles and arrows in numpy-backed arrays and renders
them in single batch paint calls.
Performance: ~1000x faster than individual items for large gap
counts.
Based on patterns from:
- `pyqtgraph.BarGraphItem` (batch rect rendering)
- `pyqtgraph.ScatterPlotItem` (fragment rendering)
- `piker.ui._curve.FlowGraphic` (single path pattern)
'''
def __init__(
self,
gap_specs: list[dict],
array: np.ndarray|None = None,
color: str = 'dad_blue',
alpha: int = 169,
arrow_size: float = 10.0,
fqme: str|None = None,
timeframe: float|None = None,
) -> None:
'''
gap_specs: list of dicts with keys:
- start_pos: (x, y) tuple for left corner of rect
- end_pos: (x, y) tuple for right corner of rect
- arrow_x: x position for arrow
- arrow_y: y position for arrow
- pointing: 'up' or 'down' for arrow direction
- start_time: (optional) timestamp for repositioning
- end_time: (optional) timestamp for repositioning
array: optional OHLC numpy array for repositioning on
backfill updates (when abs-index changes)
fqme: symbol name for these gaps (for logging/debugging)
timeframe: period in seconds that these gaps were
detected on (used to skip reposition when
called with wrong timeframe's array)
'''
super().__init__()
self._gap_specs = gap_specs
self._array = array
self._fqme = fqme
self._timeframe = timeframe
n_gaps = len(gap_specs)
# shared pen/brush matching original SelectRect/ArrowItem style
base_color = pg.mkColor(hcolor(color))
# rect pen: base color, fully opaque for outline
self._rect_pen = pg.mkPen(base_color, width=1)
# rect brush: base color with alpha=66 (SelectRect default)
rect_fill = pg.mkColor(hcolor(color))
rect_fill.setAlpha(66)
self._rect_brush = pg.functions.mkBrush(rect_fill)
# arrow pen: same as rects
self._arrow_pen = pg.mkPen(base_color, width=1)
# arrow brush: base color with user-specified alpha (default 169)
arrow_fill = pg.mkColor(hcolor(color))
arrow_fill.setAlpha(alpha)
self._arrow_brush = pg.functions.mkBrush(arrow_fill)
# allocate rect array using Qt's efficient storage
self._rectarray = internals.PrimitiveArray(
QtCore.QRectF,
4,
)
self._rectarray.resize(n_gaps)
rect_memory = self._rectarray.ndarray()
# fill rect array from gap specs
for (
i,
spec,
) in enumerate(gap_specs):
(
start_x,
start_y,
) = spec['start_pos']
(
end_x,
end_y,
) = spec['end_pos']
# QRectF expects (x, y, width, height)
rect_memory[i, 0] = start_x
rect_memory[i, 1] = min(start_y, end_y)
rect_memory[i, 2] = end_x - start_x
rect_memory[i, 3] = abs(end_y - start_y)
# build single QPainterPath for all arrows
self._arrow_path = QtGui.QPainterPath()
self._arrow_size = arrow_size
for spec in gap_specs:
arrow_x = spec['arrow_x']
arrow_y = spec['arrow_y']
pointing = spec['pointing']
# create arrow polygon
if pointing == 'down':
# arrow points downward
arrow_poly = QtGui.QPolygonF([
QPointF(arrow_x, arrow_y), # tip
QPointF(
arrow_x - arrow_size/2,
arrow_y - arrow_size,
), # left
QPointF(
arrow_x + arrow_size/2,
arrow_y - arrow_size,
), # right
])
else: # up
# arrow points upward
arrow_poly = QtGui.QPolygonF([
QPointF(arrow_x, arrow_y), # tip
QPointF(
arrow_x - arrow_size/2,
arrow_y + arrow_size,
), # left
QPointF(
arrow_x + arrow_size/2,
arrow_y + arrow_size,
), # right
])
self._arrow_path.addPolygon(arrow_poly)
self._arrow_path.closeSubpath()
# cache bounding rect
self._br: QRectF|None = None
def boundingRect(self) -> QRectF:
'''
Compute bounding rect from rect array and arrow path.
'''
if self._br is not None:
return self._br
# get rect bounds
rect_memory = self._rectarray.ndarray()
if len(rect_memory) == 0:
self._br = QRectF()
return self._br
x_min = rect_memory[:, 0].min()
y_min = rect_memory[:, 1].min()
x_max = (rect_memory[:, 0] + rect_memory[:, 2]).max()
y_max = (rect_memory[:, 1] + rect_memory[:, 3]).max()
# expand for arrow path
arrow_br = self._arrow_path.boundingRect()
x_min = min(x_min, arrow_br.left())
y_min = min(y_min, arrow_br.top())
x_max = max(x_max, arrow_br.right())
y_max = max(y_max, arrow_br.bottom())
self._br = QRectF(
x_min,
y_min,
x_max - x_min,
y_max - y_min,
)
return self._br
def paint(
self,
p: QtGui.QPainter,
opt: QtWidgets.QStyleOptionGraphicsItem,
w: QtWidgets.QWidget,
) -> None:
'''
Batch render all rects and arrows in minimal paint calls.
'''
# draw all rects in single batch call (data coordinates)
p.setPen(self._rect_pen)
p.setBrush(self._rect_brush)
drawargs = self._rectarray.drawargs()
p.drawRects(*drawargs)
# draw arrows in scene/pixel coordinates so they maintain
# size regardless of zoom level
orig_tr = p.transform()
p.resetTransform()
# rebuild arrow path in scene coordinates
arrow_path_scene = QtGui.QPainterPath()
# arrow geometry matching pg.ArrowItem defaults
# headLen=10, headWidth=2.222
# headWidth is the half-width (center to edge distance)
head_len = self._arrow_size
head_width = head_len * 0.2222 # 2.222 at size=10
for spec in self._gap_specs:
if 'arrow_x' not in spec:
continue
arrow_x = spec['arrow_x']
arrow_y = spec['arrow_y']
pointing = spec['pointing']
# transform data coords to scene coords
scene_pt = orig_tr.map(QPointF(arrow_x, arrow_y))
sx = scene_pt.x()
sy = scene_pt.y()
# create arrow polygon in scene/pixel coords
# matching pg.ArrowItem geometry but rotated for up/down
if pointing == 'down':
# tip points downward (negative y direction)
arrow_poly = QtGui.QPolygonF([
QPointF(sx, sy), # tip
QPointF(
sx - head_width,
sy - head_len,
), # left base
QPointF(
sx + head_width,
sy - head_len,
), # right base
])
else: # up
# tip points upward (positive y direction)
arrow_poly = QtGui.QPolygonF([
QPointF(sx, sy), # tip
QPointF(
sx - head_width,
sy + head_len,
), # left base
QPointF(
sx + head_width,
sy + head_len,
), # right base
])
arrow_path_scene.addPolygon(arrow_poly)
arrow_path_scene.closeSubpath()
p.setPen(self._arrow_pen)
p.setBrush(self._arrow_brush)
p.drawPath(arrow_path_scene)
# restore original transform
p.setTransform(orig_tr)
def reposition(
self,
array: np.ndarray|None = None,
fqme: str|None = None,
timeframe: float|None = None,
) -> None:
'''
Reposition all annotations based on timestamps.
Used when viz is updated (eg during backfill) and abs-index
range changes - we need to lookup new indices from timestamps.
'''
# skip reposition if timeframe doesn't match
# (e.g., 1s gaps being repositioned with 60s array)
if (
timeframe is not None
and
self._timeframe is not None
and
timeframe != self._timeframe
):
log.debug(
f'Skipping reposition for {self._fqme} gaps:\n'
f' gap timeframe: {self._timeframe}s\n'
f' array timeframe: {timeframe}s\n'
)
return
if array is None:
array = self._array
if array is None:
log.warning(
'GapAnnotations.reposition() called but no array '
'provided'
)
return
# collect all unique timestamps we need to lookup
timestamps: set[float] = set()
for spec in self._gap_specs:
if spec.get('start_time') is not None:
timestamps.add(spec['start_time'])
if spec.get('end_time') is not None:
timestamps.add(spec['end_time'])
if spec.get('time') is not None:
timestamps.add(spec['time'])
# vectorized timestamp -> row lookup using binary search
time_to_row: dict[float, dict] = {}
if timestamps:
import numpy as np
time_arr = array['time']
ts_array = np.array(list(timestamps))
search_indices = np.searchsorted(
time_arr,
ts_array,
)
# vectorized bounds check and exact match verification
valid_mask = (
(search_indices < len(array))
& (time_arr[search_indices] == ts_array)
)
valid_indices = search_indices[valid_mask]
valid_timestamps = ts_array[valid_mask]
matched_rows = array[valid_indices]
time_to_row = {
float(ts): {
'index': float(row['index']),
'open': float(row['open']),
'close': float(row['close']),
}
for ts, row in zip(
valid_timestamps,
matched_rows,
)
}
# rebuild rect array from gap specs with new indices
rect_memory = self._rectarray.ndarray()
for (
i,
spec,
) in enumerate(self._gap_specs):
start_time = spec.get('start_time')
end_time = spec.get('end_time')
if (
start_time is None
or end_time is None
):
continue
start_row = time_to_row.get(start_time)
end_row = time_to_row.get(end_time)
if (
start_row is None
or end_row is None
):
log.warning(
f'Timestamp lookup failed for gap[{i}] during '
f'reposition:\n'
f' fqme: {fqme}\n'
f' timeframe: {timeframe}s\n'
f' start_time: {start_time}\n'
f' end_time: {end_time}\n'
f' array time range: '
f'{array["time"][0]} -> {array["time"][-1]}\n'
)
continue
start_idx = start_row['index']
end_idx = end_row['index']
start_close = start_row['close']
end_open = end_row['open']
from_idx: float = 0.16 - 0.06
start_x = start_idx + 1 - from_idx
end_x = end_idx + from_idx
# update rect in array
rect_memory[i, 0] = start_x
rect_memory[i, 1] = min(start_close, end_open)
rect_memory[i, 2] = end_x - start_x
rect_memory[i, 3] = abs(end_open - start_close)
# rebuild arrow path with new indices
self._arrow_path.clear()
for spec in self._gap_specs:
time_val = spec.get('time')
if time_val is None:
continue
arrow_row = time_to_row.get(time_val)
if arrow_row is None:
continue
arrow_x = arrow_row['index']
arrow_y = arrow_row['close']
pointing = spec['pointing']
# create arrow polygon
if pointing == 'down':
arrow_poly = QtGui.QPolygonF([
QPointF(arrow_x, arrow_y),
QPointF(
arrow_x - self._arrow_size/2,
arrow_y - self._arrow_size,
),
QPointF(
arrow_x + self._arrow_size/2,
arrow_y - self._arrow_size,
),
])
else: # up
arrow_poly = QtGui.QPolygonF([
QPointF(arrow_x, arrow_y),
QPointF(
arrow_x - self._arrow_size/2,
arrow_y + self._arrow_size,
),
QPointF(
arrow_x + self._arrow_size/2,
arrow_y + self._arrow_size,
),
])
self._arrow_path.addPolygon(arrow_poly)
self._arrow_path.closeSubpath()
# invalidate bounding rect cache
self._br = None
self.prepareGeometryChange()
self.update()

View File

@ -21,7 +21,6 @@ Higher level annotation editors.
from __future__ import annotations from __future__ import annotations
from collections import defaultdict from collections import defaultdict
from typing import ( from typing import (
Literal,
Sequence, Sequence,
TYPE_CHECKING, TYPE_CHECKING,
) )
@ -72,18 +71,9 @@ log = get_logger(__name__)
class ArrowEditor(Struct): class ArrowEditor(Struct):
'''
Annotate a chart-view with arrows most often used for indicating,
- order txns/clears,
- positions directions,
- general points-of-interest like nooz events.
'''
godw: GodWidget = None # type: ignore # noqa godw: GodWidget = None # type: ignore # noqa
_arrows: dict[ _arrows: dict[str, list[pg.ArrowItem]] = {}
str,
list[pg.ArrowItem]
] = {}
def add( def add(
self, self,
@ -91,19 +81,8 @@ class ArrowEditor(Struct):
uid: str, uid: str,
x: float, x: float,
y: float, y: float,
color: str|None = None, color: str = 'default',
pointing: Literal[ pointing: str | None = None,
'up',
'down',
None,
] = None,
alpha: int = 255,
zval: float = 1e9,
headLen: float|None = None,
headWidth: float|None = None,
tailLen: float|None = None,
tailWidth: float|None = None,
pxMode: bool = True,
) -> pg.ArrowItem: ) -> pg.ArrowItem:
''' '''
@ -119,83 +98,29 @@ class ArrowEditor(Struct):
# scale arrow sizing to dpi-aware font # scale arrow sizing to dpi-aware font
size = _font.font.pixelSize() * 0.8 size = _font.font.pixelSize() * 0.8
# allow caller override of head dimensions
if headLen is None:
headLen = size
if headWidth is None:
headWidth = size/2
# tail params default to None (no tail)
if tailWidth is None:
tailWidth = 3
color = color or 'default'
color = QColor(hcolor(color))
color.setAlpha(alpha)
pen = fn.mkPen(color, width=1)
brush = fn.mkBrush(color)
arrow = pg.ArrowItem( arrow = pg.ArrowItem(
angle=angle, angle=angle,
baseAngle=0, baseAngle=0,
headLen=headLen, headLen=size,
headWidth=headWidth, headWidth=size/2,
tailLen=tailLen, tailLen=None,
tailWidth=tailWidth, pxMode=True,
pxMode=pxMode,
# coloring
pen=pen,
brush=brush,
)
arrow.setZValue(zval)
arrow.setPos(x, y)
plot.addItem(arrow) # render to view
# register for removal # coloring
arrow._uid = uid pen=pg.mkPen(hcolor('papas_special')),
self._arrows.setdefault( brush=pg.mkBrush(hcolor(color)),
uid, [] )
).append(arrow) arrow.setPos(x, y)
self._arrows.setdefault(uid, []).append(arrow)
# render to view
plot.addItem(arrow)
return arrow return arrow
def remove( def remove(self, arrow) -> bool:
self,
arrow: pg.ArrowItem,
) -> None:
'''
Remove a *single arrow* from all chart views to which it was
added.
'''
uid: str = arrow._uid
arrows: list[pg.ArrowItem] = self._arrows[uid]
log.debug(
f'Removing arrow from views\n'
f'uid: {uid!r}\n'
f'{arrow!r}\n'
)
for linked in self.godw.iter_linked(): for linked in self.godw.iter_linked():
if not (chart := linked.chart): linked.chart.plotItem.removeItem(arrow)
continue
chart.plotItem.removeItem(arrow)
try:
arrows.remove(arrow)
except ValueError:
log.warning(
f'Arrow was already removed?\n'
f'uid: {uid!r}\n'
f'{arrow!r}\n'
)
def remove_all(self) -> set[pg.ArrowItem]:
'''
Remove all arrows added by this editor from all
chart-views.
'''
for uid, arrows in self._arrows.items():
for arrow in arrows:
self.remove(arrow)
class LineEditor(Struct): class LineEditor(Struct):
@ -286,9 +211,7 @@ class LineEditor(Struct):
for line in lines: for line in lines:
line.show_labels() line.show_labels()
line.hide_markers() line.hide_markers()
log.debug( log.debug(f'Level active for level: {line.value()}')
f'Line active @ level: {line.value()!r}'
)
# TODO: other flashy things to indicate the order is active # TODO: other flashy things to indicate the order is active
return lines return lines
@ -331,11 +254,7 @@ class LineEditor(Struct):
if line in hovered: if line in hovered:
hovered.remove(line) hovered.remove(line)
log.debug( log.debug(f'deleting {line} with oid: {uuid}')
f'Deleting level-line\n'
f'line: {line!r}\n'
f'oid: {uuid!r}\n'
)
line.delete() line.delete()
# make sure the xhair doesn't get left off # make sure the xhair doesn't get left off
@ -343,17 +262,10 @@ class LineEditor(Struct):
cursor.show_xhair() cursor.show_xhair()
else: else:
log.warning( log.warning(f'Could not find line for {line}')
f'Could not find line for removal ??\n'
f'\n'
f'{line!r}\n'
)
return lines return lines
# compat with ArrowEditor
remove = remove_line
def as_point( def as_point(
pair: Sequence[float, float] | QPointF, pair: Sequence[float, float] | QPointF,
@ -386,7 +298,7 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
def __init__( def __init__(
self, self,
viewbox: ViewBox, viewbox: ViewBox,
color: str|None = None, color: str | None = None,
) -> None: ) -> None:
super().__init__(0, 0, 1, 1) super().__init__(0, 0, 1, 1)
@ -579,11 +491,11 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
if update_label: if update_label:
self.init_label(view_rect) self.init_label(view_rect)
log.debug( print(
f'SelectRect modify,\n' 'SelectRect modify:\n'
f'QRectF: {view_rect}\n' f'QRectF: {view_rect}\n'
f'start_pos: {start_pos!r}\n' f'start_pos: {start_pos}\n'
f'end_pos: {end_pos!r}\n' f'end_pos: {end_pos}\n'
) )
self.show() self.show()
@ -650,11 +562,8 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
dmn=dmn, dmn=dmn,
)) ))
# tracing # print(f'x2, y2: {(x2, y2)}')
# log.info( # print(f'xmn, ymn: {(xmn, ymx)}')
# f'x2, y2: {(x2, y2)}\n'
# f'xmn, ymn: {(xmn, ymx)}\n'
# )
label_anchor = Point( label_anchor = Point(
xmx + 2, xmx + 2,
@ -705,6 +614,3 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
): ):
scen.removeItem(self._label_proxy) scen.removeItem(self._label_proxy)
# compat with ArrowEditor
remove = delete

View File

@ -38,6 +38,7 @@ from piker.ui.qt import (
QtGui, QtGui,
QGraphicsPathItem, QGraphicsPathItem,
QStyleOptionGraphicsItem, QStyleOptionGraphicsItem,
QGraphicsItem,
QGraphicsScene, QGraphicsScene,
QWidget, QWidget,
QPointF, QPointF,

File diff suppressed because it is too large Load Diff

View File

@ -61,7 +61,7 @@ class DpiAwareFont:
) -> None: ) -> None:
self._font_size_calc_key: str = _font_size_key self._font_size_calc_key: str = _font_size_key
self._font_size: int|None = None self._font_size: int | None = None
# Read preferred font size from main config file if it exists # Read preferred font size from main config file if it exists
conf, path = config.load('conf', touch_if_dne=True) conf, path = config.load('conf', touch_if_dne=True)
@ -107,22 +107,7 @@ class DpiAwareFont:
@property @property
def px_size(self) -> int: def px_size(self) -> int:
size: int = self._qfont.pixelSize() return self._qfont.pixelSize()
# XXX, when no Qt app has been spawned this will always be
# invalid..
# SO, just return any conf.toml value.
if size == -1:
if (conf_size := self._font_size) is None:
raise ValueError(
f'No valid `{type(_font).__name__}.px_size` set?\n'
f'\n'
f'-> `ui.font_size` is NOT set in `conf.toml`\n'
f'-> no Qt app is active ??\n'
)
return conf_size
return size
def configure_to_dpi(self, screen: QtGui.QScreen | None = None): def configure_to_dpi(self, screen: QtGui.QScreen | None = None):
''' '''
@ -236,20 +221,6 @@ def _config_fonts_to_screen() -> None:
_font_small.configure_to_dpi() _font_small.configure_to_dpi()
def get_fonts() -> tuple[
DpiAwareFont,
DpiAwareFont,
]:
'''
Get the singleton font pair (of instances) from which all other
UI/UX should be "scaled around".
See `DpiAwareFont` for (internal) deats.
'''
return _font, _font_small
# TODO: re-compute font size when main widget switches screens? # TODO: re-compute font size when main widget switches screens?
# https://forum.qt.io/topic/54136/how-do-i-get-the-qscreen-my-widget-is-on-qapplication-desktop-screen-returns-a-qwidget-and-qobject_cast-qscreen-returns-null/3 # https://forum.qt.io/topic/54136/how-do-i-get-the-qscreen-my-widget-is-on-qapplication-desktop-screen-returns-a-qwidget-and-qobject_cast-qscreen-returns-null/3

View File

@ -116,6 +116,7 @@ uis = [
dev = [ dev = [
# https://docs.astral.sh/uv/concepts/projects/dependencies/#development-dependencies # https://docs.astral.sh/uv/concepts/projects/dependencies/#development-dependencies
"cython >=3.0.0, <4.0.0", "cython >=3.0.0, <4.0.0",
# nested deps-groups # nested deps-groups
# https://docs.astral.sh/uv/concepts/projects/dependencies/#nesting-groups # https://docs.astral.sh/uv/concepts/projects/dependencies/#nesting-groups
{include-group = 'uis'}, {include-group = 'uis'},
@ -133,10 +134,6 @@ repl = [
"prompt-toolkit ==3.0.40", "prompt-toolkit ==3.0.40",
"pyperclip>=1.9.0", "pyperclip>=1.9.0",
# for @claude's `snippets/claude_debug_helper.py` it uses to do
# "offline" debug/crash REPL-in alongside a dev.
"pexpect>=4.9.0",
# ?TODO, new stuff to consider.. # ?TODO, new stuff to consider..
# "visidata" # console numerics # "visidata" # console numerics
# "xxh" # for remote `xonsh`-ing # "xxh" # for remote `xonsh`-ing
@ -190,23 +187,14 @@ include = ["piker"]
[tool.uv.sources] [tool.uv.sources]
pyqtgraph = { git = "https://github.com/pikers/pyqtgraph.git" }
tomlkit = { git = "https://github.com/pikers/tomlkit.git", branch ="piker_pin" } tomlkit = { git = "https://github.com/pikers/tomlkit.git", branch ="piker_pin" }
pyvnc = { git = "https://github.com/regulad/pyvnc.git" } pyvnc = { git = "https://github.com/regulad/pyvnc.git" }
pyqtgraph = { git = "https://github.com/pyqtgraph/pyqtgraph.git", branch = 'master' }
# pyqtgraph = { path = '../pyqtgraph', editable = true }
# ?TODO, resync our fork?
# pyqtgraph = { git = "https://github.com/pikers/pyqtgraph.git" }
# to get fancy next-cmd/suggestion feats prior to 0.22.2 B)
# https://github.com/xonsh/xonsh/pull/6037
# https://github.com/xonsh/xonsh/pull/6048
xonsh = { git = 'https://github.com/xonsh/xonsh.git', branch = 'main' }
# XXX since, we're like, always hacking new shite all-the-time. Bp # XXX since, we're like, always hacking new shite all-the-time. Bp
# tractor = { git = "https://github.com/goodboy/tractor.git", branch ="piker_pin" } tractor = { git = "https://github.com/goodboy/tractor.git", branch ="piker_pin" }
# tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "piker_pin" } # tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "piker_pin" }
# tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "main" } # tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "main" }
# ------ goodboy ------ # ------ goodboy ------
# hackin dev-envs, usually there's something new he's hackin in.. # hackin dev-envs, usually there's something new he's hackin in..
tractor = { path = "../tractor", editable = true } # tractor = { path = "../tractor", editable = true }

View File

@ -1,256 +0,0 @@
#!/usr/bin/env python
'''
Programmatic debugging helper for `pdbp` REPL human-like
interaction but built to allow `claude` to interact with
crashes and `tractor.pause()` breakpoints along side a human dev.
Originally written by `clauded` during a backfiller inspection
session with @goodboy trying to resolve duplicate/gappy ohlcv ts
issues discovered while testing the new `nativedb` tsdb.
Allows `claude` to run `pdb` commands and capture output in an "offline"
manner but generating similar output as if it was iteracting with
the debug REPL.
The use of `pexpect` is heavily based on tractor's REPL UX test
suite(s), namely various `tests/devx/test_debugger.py` patterns.
'''
import sys
import os
import time
import pexpect
from pexpect.exceptions import (
TIMEOUT,
EOF,
)
PROMPT: str = r'\(Pdb\+\)'
def expect(
child: pexpect.spawn,
patt: str,
**kwargs,
) -> None:
'''
Expect wrapper that prints last console data before failing.
'''
try:
child.expect(
patt,
**kwargs,
)
except TIMEOUT:
before: str = (
str(child.before.decode())
if isinstance(child.before, bytes)
else str(child.before)
)
print(
f'TIMEOUT waiting for pattern: {patt}\n'
f'Last seen output:\n{before}'
)
raise
def run_pdb_commands(
commands: list[str],
initial_cmd: str = 'piker store ldshm xmrusdt.usdtm.perp.binance',
timeout: int = 30,
print_output: bool = True,
) -> dict[str, str]:
'''
Spawn piker process, wait for pdb prompt, execute commands.
Returns dict mapping command -> output.
'''
results: dict[str, str] = {}
# Disable colored output for easier parsing
os.environ['PYTHON_COLORS'] = '0'
# Spawn the process
if print_output:
print(f'Spawning: {initial_cmd}')
child: pexpect.spawn = pexpect.spawn(
initial_cmd,
timeout=timeout,
encoding='utf-8',
echo=False,
)
# Wait for pdb prompt
try:
expect(child, PROMPT, timeout=timeout)
if print_output:
print('Reached pdb prompt!')
# Execute each command
for cmd in commands:
if print_output:
print(f'\n>>> {cmd}')
child.sendline(cmd)
time.sleep(0.1)
# Wait for next prompt
expect(child, PROMPT, timeout=timeout)
# Capture output (everything before the prompt)
output: str = (
str(child.before.decode())
if isinstance(child.before, bytes)
else str(child.before)
)
results[cmd] = output
if print_output:
print(output)
# Quit debugger gracefully
child.sendline('quit')
try:
child.expect(EOF, timeout=5)
except (TIMEOUT, EOF):
pass
except TIMEOUT as e:
print(f'Timeout: {e}')
if child.before:
before: str = (
str(child.before.decode())
if isinstance(child.before, bytes)
else str(child.before)
)
print(f'Buffer:\n{before}')
results['_error'] = str(e)
finally:
if child.isalive():
child.close(force=True)
return results
class InteractivePdbSession:
'''
Interactive pdb session manager for incremental debugging.
'''
def __init__(
self,
cmd: str = 'piker store ldshm xmrusdt.usdtm.perp.binance',
timeout: int = 30,
):
self.cmd: str = cmd
self.timeout: int = timeout
self.child: pexpect.spawn|None = None
self.history: list[tuple[str, str]] = []
def start(self) -> None:
'''
Start the piker process and wait for first prompt.
'''
os.environ['PYTHON_COLORS'] = '0'
print(f'Starting: {self.cmd}')
self.child = pexpect.spawn(
self.cmd,
timeout=self.timeout,
encoding='utf-8',
echo=False,
)
# Wait for initial prompt
expect(self.child, PROMPT, timeout=self.timeout)
print('Ready at pdb prompt!')
def run(
self,
cmd: str,
print_output: bool = True,
) -> str:
'''
Execute a single pdb command and return output.
'''
if not self.child or not self.child.isalive():
raise RuntimeError('Session not started or dead')
if print_output:
print(f'\n>>> {cmd}')
self.child.sendline(cmd)
time.sleep(0.1)
# Wait for next prompt
expect(self.child, PROMPT, timeout=self.timeout)
output: str = (
str(self.child.before.decode())
if isinstance(self.child.before, bytes)
else str(self.child.before)
)
self.history.append((cmd, output))
if print_output:
print(output)
return output
def quit(self) -> None:
'''
Exit the debugger and cleanup.
'''
if self.child and self.child.isalive():
self.child.sendline('quit')
try:
self.child.expect(EOF, timeout=5)
except (TIMEOUT, EOF):
pass
self.child.close(force=True)
def __enter__(self):
self.start()
return self
def __exit__(self, *args):
self.quit()
if __name__ == '__main__':
# Example inspection commands
inspect_cmds: list[str] = [
'locals().keys()',
'type(deduped)',
'deduped.shape',
(
'step_gaps.shape '
'if "step_gaps" in locals() '
'else "N/A"'
),
(
'venue_gaps.shape '
'if "venue_gaps" in locals() '
'else "N/A"'
),
]
# Allow commands from CLI args
if len(sys.argv) > 1:
inspect_cmds = sys.argv[1:]
# Interactive session example
with InteractivePdbSession() as session:
for cmd in inspect_cmds:
session.run(cmd)
print('\n=== Session Complete ===')

400
uv.lock
View File

@ -104,15 +104,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/e0/44/827b2a91a5816512fcaf3cc4ebc465ccd5d598c45cefa6703fcf4a79018f/attrs-23.2.0-py3-none-any.whl", hash = "sha256:99b87a485a5820b23b879f04c2305b44b951b502fd64be915879d77a7e8fc6f1", size = 60752, upload-time = "2023-12-31T06:30:30.772Z" }, { url = "https://files.pythonhosted.org/packages/e0/44/827b2a91a5816512fcaf3cc4ebc465ccd5d598c45cefa6703fcf4a79018f/attrs-23.2.0-py3-none-any.whl", hash = "sha256:99b87a485a5820b23b879f04c2305b44b951b502fd64be915879d77a7e8fc6f1", size = 60752, upload-time = "2023-12-31T06:30:30.772Z" },
] ]
[[package]]
name = "base58"
version = "2.1.1"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/7f/45/8ae61209bb9015f516102fa559a2914178da1d5868428bd86a1b4421141d/base58-2.1.1.tar.gz", hash = "sha256:c5d0cb3f5b6e81e8e35da5754388ddcc6d0d14b6c6a132cb93d69ed580a7278c", size = 6528, upload-time = "2021-10-30T22:12:17.858Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/4a/45/ec96b29162a402fc4c1c5512d114d7b3787b9d1c2ec241d9568b4816ee23/base58-2.1.1-py3-none-any.whl", hash = "sha256:11a36f4d3ce51dfc1043f3218591ac4eb1ceb172919cebe05b52a5bcc8d245c2", size = 5621, upload-time = "2021-10-30T22:12:16.658Z" },
]
[[package]] [[package]]
name = "bidict" name = "bidict"
version = "0.23.1" version = "0.23.1"
@ -122,74 +113,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/99/37/e8730c3587a65eb5645d4aba2d27aae48e8003614d6aaf15dda67f702f1f/bidict-0.23.1-py3-none-any.whl", hash = "sha256:5dae8d4d79b552a71cbabc7deb25dfe8ce710b17ff41711e13010ead2abfc3e5", size = 32764, upload-time = "2024-02-18T19:09:04.156Z" }, { url = "https://files.pythonhosted.org/packages/99/37/e8730c3587a65eb5645d4aba2d27aae48e8003614d6aaf15dda67f702f1f/bidict-0.23.1-py3-none-any.whl", hash = "sha256:5dae8d4d79b552a71cbabc7deb25dfe8ce710b17ff41711e13010ead2abfc3e5", size = 32764, upload-time = "2024-02-18T19:09:04.156Z" },
] ]
[[package]]
name = "blake3"
version = "1.0.8"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/75/aa/abcd75e9600987a0bc6cfe9b6b2ff3f0e2cb08c170addc6e76035b5c4cb3/blake3-1.0.8.tar.gz", hash = "sha256:513cc7f0f5a7c035812604c2c852a0c1468311345573de647e310aca4ab165ba", size = 117308, upload-time = "2025-10-14T06:47:48.83Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/ed/a0/b7b6dff04012cfd6e665c09ee446f749bd8ea161b00f730fe1bdecd0f033/blake3-1.0.8-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:d8da4233984d51471bd4e4366feda1d90d781e712e0a504ea54b1f2b3577557b", size = 347983, upload-time = "2025-10-14T06:45:47.214Z" },
{ url = "https://files.pythonhosted.org/packages/5b/a2/264091cac31d7ae913f1f296abc20b8da578b958ffb86100a7ce80e8bf5c/blake3-1.0.8-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1257be19f2d381c868a34cc822fc7f12f817ddc49681b6d1a2790bfbda1a9865", size = 325415, upload-time = "2025-10-14T06:45:48.482Z" },
{ url = "https://files.pythonhosted.org/packages/ee/7d/85a4c0782f613de23d114a7a78fcce270f75b193b3ff3493a0de24ba104a/blake3-1.0.8-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:269f255b110840e52b6ce9db02217e39660ebad3e34ddd5bca8b8d378a77e4e1", size = 371296, upload-time = "2025-10-14T06:45:49.674Z" },
{ url = "https://files.pythonhosted.org/packages/e3/20/488475254976ed93fab57c67aa80d3b40df77f7d9db6528c9274bff53e08/blake3-1.0.8-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:66ca28a673025c40db3eba21a9cac52f559f83637efa675b3f6bd8683f0415f3", size = 374516, upload-time = "2025-10-14T06:45:51.23Z" },
{ url = "https://files.pythonhosted.org/packages/7b/21/2a1c47fedb77fb396512677ec6d46caf42ac6e9a897db77edd0a2a46f7bb/blake3-1.0.8-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:bcb04966537777af56c1f399b35525aa70a1225816e121ff95071c33c0f7abca", size = 447911, upload-time = "2025-10-14T06:45:52.637Z" },
{ url = "https://files.pythonhosted.org/packages/cb/7d/db0626df16029713e7e61b67314c4835e85c296d82bd907c21c6ea271da2/blake3-1.0.8-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:e5b5da177d62cc4b7edf0cea08fe4dec960c9ac27f916131efa890a01f747b93", size = 505420, upload-time = "2025-10-14T06:45:54.445Z" },
{ url = "https://files.pythonhosted.org/packages/5b/55/6e737850c2d58a6d9de8a76dad2ae0f75b852a23eb4ecb07a0b165e6e436/blake3-1.0.8-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:38209b10482c97e151681ea3e91cc7141f56adbbf4820a7d701a923124b41e6a", size = 394189, upload-time = "2025-10-14T06:45:55.719Z" },
{ url = "https://files.pythonhosted.org/packages/5b/94/eafaa5cdddadc0c9c603a6a6d8339433475e1a9f60c8bb9c2eed2d8736b6/blake3-1.0.8-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:504d1399b7fb91dfe5c25722d2807990493185faa1917456455480c36867adb5", size = 388001, upload-time = "2025-10-14T06:45:57.067Z" },
{ url = "https://files.pythonhosted.org/packages/17/81/735fa00d13de7f68b25e1b9cb36ff08c6f165e688d85d8ec2cbfcdedccc5/blake3-1.0.8-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:c84af132aa09abeadf9a0118c8fb26f4528f3f42c10ef8be0fcf31c478774ec4", size = 550302, upload-time = "2025-10-14T06:45:58.657Z" },
{ url = "https://files.pythonhosted.org/packages/0e/c6/d1fe8bdea4a6088bd54b5a58bc40aed89a4e784cd796af7722a06f74bae7/blake3-1.0.8-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:a25db3d36b55f5ed6a86470155cc749fc9c5b91c949b8d14f48658f9d960d9ec", size = 554211, upload-time = "2025-10-14T06:46:00.269Z" },
{ url = "https://files.pythonhosted.org/packages/55/d1/ca74aa450cbe10e396e061f26f7a043891ffa1485537d6b30d3757e20995/blake3-1.0.8-cp312-cp312-win32.whl", hash = "sha256:e0fee93d5adcd44378b008c147e84f181f23715307a64f7b3db432394bbfce8b", size = 228343, upload-time = "2025-10-14T06:46:01.533Z" },
{ url = "https://files.pythonhosted.org/packages/4d/42/bbd02647169e3fbed27558555653ac2578c6f17ccacf7d1956c58ef1d214/blake3-1.0.8-cp312-cp312-win_amd64.whl", hash = "sha256:6a6eafc29e4f478d365a87d2f25782a521870c8514bb43734ac85ae9be71caf7", size = 215704, upload-time = "2025-10-14T06:46:02.79Z" },
{ url = "https://files.pythonhosted.org/packages/55/b8/11de9528c257f7f1633f957ccaff253b706838d22c5d2908e4735798ec01/blake3-1.0.8-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:46dc20976bd6c235959ef0246ec73420d1063c3da2839a9c87ca395cf1fd7943", size = 347771, upload-time = "2025-10-14T06:46:04.248Z" },
{ url = "https://files.pythonhosted.org/packages/50/26/f7668be55c909678b001ecacff11ad7016cd9b4e9c7cc87b5971d638c5a9/blake3-1.0.8-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:d17eb6382634b3a5bc0c0e0454d5265b0becaeeadb6801ed25150b39a999d0cc", size = 325431, upload-time = "2025-10-14T06:46:06.136Z" },
{ url = "https://files.pythonhosted.org/packages/77/57/e8a85fa261894bf7ce7af928ff3408aab60287ab8d58b55d13a3f700b619/blake3-1.0.8-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:19fc6f2b7edab8acff6895fc6e38c19bd79f4c089e21153020c75dfc7397d52d", size = 370994, upload-time = "2025-10-14T06:46:07.398Z" },
{ url = "https://files.pythonhosted.org/packages/62/cd/765b76bb48b8b294fea94c9008b0d82b4cfa0fa2f3c6008d840d01a597e4/blake3-1.0.8-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:4f54cff7f15d91dc78a63a2dd02a3dccdc932946f271e2adb4130e0b4cf608ba", size = 374372, upload-time = "2025-10-14T06:46:08.698Z" },
{ url = "https://files.pythonhosted.org/packages/36/7a/32084eadbb28592bb07298f0de316d2da586c62f31500a6b1339a7e7b29b/blake3-1.0.8-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e7e12a777f6b798eb8d06f875d6e108e3008bd658d274d8c676dcf98e0f10537", size = 447627, upload-time = "2025-10-14T06:46:10.002Z" },
{ url = "https://files.pythonhosted.org/packages/a7/f4/3788a1d86e17425eea147e28d7195d7053565fc279236a9fd278c2ec495e/blake3-1.0.8-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ddfc59b0176fb31168f08d5dd536e69b1f4f13b5a0f4b0c3be1003efd47f9308", size = 507536, upload-time = "2025-10-14T06:46:11.614Z" },
{ url = "https://files.pythonhosted.org/packages/fe/01/4639cba48513b94192681b4da472cdec843d3001c5344d7051ee5eaef606/blake3-1.0.8-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a2336d5b2a801a7256da21150348f41610a6c21dae885a3acb1ebbd7333d88d8", size = 394105, upload-time = "2025-10-14T06:46:12.808Z" },
{ url = "https://files.pythonhosted.org/packages/21/ae/6e55c19c8460fada86cd1306a390a09b0c5a2e2e424f9317d2edacea439f/blake3-1.0.8-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e4072196547484c95a5a09adbb952e9bb501949f03f9e2a85e7249ef85faaba8", size = 386928, upload-time = "2025-10-14T06:46:16.284Z" },
{ url = "https://files.pythonhosted.org/packages/ee/6c/05b7a5a907df1be53a8f19e7828986fc6b608a44119641ef9c0804fbef15/blake3-1.0.8-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:0eab3318ec02f8e16fe549244791ace2ada2c259332f0c77ab22cf94dfff7130", size = 550003, upload-time = "2025-10-14T06:46:17.791Z" },
{ url = "https://files.pythonhosted.org/packages/b4/03/f0ea4adfedc1717623be6460b3710fcb725ca38082c14274369803f727e1/blake3-1.0.8-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:a33b9a1fb6d1d559a8e0d04b041e99419a6bb771311c774f6ff57ed7119c70ed", size = 553857, upload-time = "2025-10-14T06:46:19.088Z" },
{ url = "https://files.pythonhosted.org/packages/cc/6f/e5410d2e2a30c8aba8389ffc1c0061356916bf5ecd0a210344e7b69b62ab/blake3-1.0.8-cp313-cp313-win32.whl", hash = "sha256:e171b169cb7ea618e362a4dddb7a4d4c173bbc08b9ba41ea3086dd1265530d4f", size = 228315, upload-time = "2025-10-14T06:46:20.391Z" },
{ url = "https://files.pythonhosted.org/packages/79/ef/d9c297956dfecd893f29f59e7b22445aba5b47b7f6815d9ba5dcd73fcae6/blake3-1.0.8-cp313-cp313-win_amd64.whl", hash = "sha256:3168c457255b5d2a2fc356ba696996fcaff5d38284f968210d54376312107662", size = 215477, upload-time = "2025-10-14T06:46:21.542Z" },
{ url = "https://files.pythonhosted.org/packages/20/ba/eaa7723d66dd8ab762a3e85e139bb9c46167b751df6e950ad287adb8fb61/blake3-1.0.8-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:b4d672c24dc15ec617d212a338a4ca14b449829b6072d09c96c63b6e6b621aed", size = 347289, upload-time = "2025-10-14T06:46:22.772Z" },
{ url = "https://files.pythonhosted.org/packages/47/b3/6957f6ee27f0d5b8c4efdfda68a1298926a88c099f4dd89c711049d16526/blake3-1.0.8-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:1af0e5a29aa56d4fba904452ae784740997440afd477a15e583c38338e641f41", size = 324444, upload-time = "2025-10-14T06:46:24.729Z" },
{ url = "https://files.pythonhosted.org/packages/13/da/722cebca11238f3b24d3cefd2361c9c9ea47cfa0ad9288eeb4d1e0b7cf93/blake3-1.0.8-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ef153c5860d5bf1cc71aece69b28097d2a392913eb323d6b52555c875d0439fc", size = 370441, upload-time = "2025-10-14T06:46:26.29Z" },
{ url = "https://files.pythonhosted.org/packages/2e/d5/2f7440c8e41c0af995bad3a159e042af0f4ed1994710af5b4766ca918f65/blake3-1.0.8-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e8ae3689f0c7bfa6ce6ae45cab110e4c3442125c4c23b28f1f097856de26e4d1", size = 374312, upload-time = "2025-10-14T06:46:27.451Z" },
{ url = "https://files.pythonhosted.org/packages/a6/6c/fb6a7812e60ce3e110bcbbb11f167caf3e975c589572c41e1271f35f2c41/blake3-1.0.8-cp313-cp313t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3fb83532f7456ddeb68dae1b36e1f7c52f9cb72852ac01159bbcb1a12b0f8be0", size = 447007, upload-time = "2025-10-14T06:46:29.056Z" },
{ url = "https://files.pythonhosted.org/packages/13/3b/c99b43fae5047276ea9d944077c190fc1e5f22f57528b9794e21f7adedc6/blake3-1.0.8-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:6ae7754c7d96e92a70a52e07c732d594cf9924d780f49fffd3a1e9235e0f5ba7", size = 507323, upload-time = "2025-10-14T06:46:30.661Z" },
{ url = "https://files.pythonhosted.org/packages/fc/bb/ba90eddd592f8c074a0694cb0a744b6bd76bfe67a14c2b490c8bdfca3119/blake3-1.0.8-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:4bacaae75e98dee3b7da6c5ee3b81ee21a3352dd2477d6f1d1dbfd38cdbf158a", size = 393449, upload-time = "2025-10-14T06:46:31.805Z" },
{ url = "https://files.pythonhosted.org/packages/25/ed/58a2acd0b9e14459cdaef4344db414d4a36e329b9720921b442a454dd443/blake3-1.0.8-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9456c829601d72852d8ba0af8dae0610f7def1d59f5942efde1e2ef93e8a8b57", size = 386844, upload-time = "2025-10-14T06:46:33.195Z" },
{ url = "https://files.pythonhosted.org/packages/4a/04/fed09845b18d90862100c8e48308261e2f663aab25d3c71a6a0bdda6618b/blake3-1.0.8-cp313-cp313t-musllinux_1_1_aarch64.whl", hash = "sha256:497ef8096ec4ac1ffba9a66152cee3992337cebf8ea434331d8fd9ce5423d227", size = 549550, upload-time = "2025-10-14T06:46:35.23Z" },
{ url = "https://files.pythonhosted.org/packages/d6/65/1859fddfabc1cc72548c2269d988819aad96d854e25eae00531517925901/blake3-1.0.8-cp313-cp313t-musllinux_1_1_x86_64.whl", hash = "sha256:511133bab85ff60ed143424ce484d08c60894ff7323f685d7a6095f43f0c85c3", size = 553805, upload-time = "2025-10-14T06:46:36.532Z" },
{ url = "https://files.pythonhosted.org/packages/c1/c7/2969352017f62378e388bb07bb2191bc9a953f818dc1cd6b9dd5c24916e1/blake3-1.0.8-cp313-cp313t-win32.whl", hash = "sha256:9c9fbdacfdeb68f7ca53bb5a7a5a593ec996eaf21155ad5b08d35e6f97e60877", size = 228068, upload-time = "2025-10-14T06:46:37.826Z" },
{ url = "https://files.pythonhosted.org/packages/d8/fc/923e25ac9cadfff1cd20038bcc0854d0f98061eb6bc78e42c43615f5982d/blake3-1.0.8-cp313-cp313t-win_amd64.whl", hash = "sha256:3cec94ed5676821cf371e9c9d25a41b4f3ebdb5724719b31b2749653b7cc1dfa", size = 215369, upload-time = "2025-10-14T06:46:39.054Z" },
{ url = "https://files.pythonhosted.org/packages/2e/2a/9f13ea01b03b1b4751a1cc2b6c1ef4b782e19433a59cf35b59cafb2a2696/blake3-1.0.8-cp314-cp314-macosx_10_12_x86_64.whl", hash = "sha256:2c33dac2c6112bc23f961a7ca305c7e34702c8177040eb98d0389d13a347b9e1", size = 347016, upload-time = "2025-10-14T06:46:40.318Z" },
{ url = "https://files.pythonhosted.org/packages/06/8e/8458c4285fbc5de76414f243e4e0fcab795d71a8b75324e14959aee699da/blake3-1.0.8-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c445eff665d21c3b3b44f864f849a2225b1164c08654beb23224a02f087b7ff1", size = 324496, upload-time = "2025-10-14T06:46:42.355Z" },
{ url = "https://files.pythonhosted.org/packages/49/fa/b913eb9cc4af708c03e01e6b88a8bb3a74833ba4ae4b16b87e2829198e06/blake3-1.0.8-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a47939f04b89c5c6ff1e51e883e5efab1ea1bf01a02f4d208d216dddd63d0dd8", size = 370654, upload-time = "2025-10-14T06:46:43.907Z" },
{ url = "https://files.pythonhosted.org/packages/7f/4f/245e0800c33b99c8f2b570d9a7199b51803694913ee4897f339648502933/blake3-1.0.8-cp314-cp314-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:73e0b4fa25f6e3078526a592fb38fca85ef204fd02eced6731e1cdd9396552d4", size = 374693, upload-time = "2025-10-14T06:46:45.186Z" },
{ url = "https://files.pythonhosted.org/packages/a2/a6/8cb182c8e482071dbdfcc6ec0048271fd48bcb78782d346119ff54993700/blake3-1.0.8-cp314-cp314-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4b0543c57eb9d6dac9d4bced63e9f7f7b546886ac04cec8da3c3d9c8f30cbbb7", size = 447673, upload-time = "2025-10-14T06:46:46.358Z" },
{ url = "https://files.pythonhosted.org/packages/06/b7/1cbbb5574d2a9436d1b15e7eb5b9d82e178adcaca71a97b0fddaca4bfe3a/blake3-1.0.8-cp314-cp314-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ed972ebd553c0c25363459e9fc71a38c045d8419e365b59acd8cd791eff13981", size = 507233, upload-time = "2025-10-14T06:46:48.109Z" },
{ url = "https://files.pythonhosted.org/packages/9c/45/b55825d90af353b3e26c653bab278da9d6563afcf66736677f9397e465be/blake3-1.0.8-cp314-cp314-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3bafdec95dfffa3f6571e529644744e280337df15ddd9728f224ba70c5779b23", size = 393852, upload-time = "2025-10-14T06:46:49.511Z" },
{ url = "https://files.pythonhosted.org/packages/34/73/9058a1a457dd20491d1b37de53d6876eff125e1520d9b2dd7d0acbc88de2/blake3-1.0.8-cp314-cp314-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2d78f06f3fb838b34c330e2987090376145cbe5944d8608a0c4779c779618f7b", size = 386442, upload-time = "2025-10-14T06:46:51.205Z" },
{ url = "https://files.pythonhosted.org/packages/30/6d/561d537ffc17985e276e08bf4513f1c106f1fdbef571e782604dc4e44070/blake3-1.0.8-cp314-cp314-musllinux_1_1_aarch64.whl", hash = "sha256:dd03ff08d1b6e4fdda1cd03826f971ae8966ef6f683a8c68aa27fb21904b5aa9", size = 549929, upload-time = "2025-10-14T06:46:52.494Z" },
{ url = "https://files.pythonhosted.org/packages/03/2f/dbe20d2c57f1a67c63be4ba310bcebc707b945c902a0bde075d2a8f5cd5c/blake3-1.0.8-cp314-cp314-musllinux_1_1_x86_64.whl", hash = "sha256:4e02a3c499e35bf51fc15b2738aca1a76410804c877bcd914752cac4f71f052a", size = 553750, upload-time = "2025-10-14T06:46:54.194Z" },
{ url = "https://files.pythonhosted.org/packages/6b/da/c6cb712663c869b2814870c2798e57289c4268c5ac5fb12d467fce244860/blake3-1.0.8-cp314-cp314-win32.whl", hash = "sha256:a585357d5d8774aad9ffc12435de457f9e35cde55e0dc8bc43ab590a6929e59f", size = 228404, upload-time = "2025-10-14T06:46:56.807Z" },
{ url = "https://files.pythonhosted.org/packages/dc/b6/c7dcd8bc3094bba1c4274e432f9e77a7df703532ca000eaa550bd066b870/blake3-1.0.8-cp314-cp314-win_amd64.whl", hash = "sha256:9ab5998e2abd9754819753bc2f1cf3edf82d95402bff46aeef45ed392a5468bf", size = 215460, upload-time = "2025-10-14T06:46:58.15Z" },
{ url = "https://files.pythonhosted.org/packages/75/3c/6c8afd856c353176836daa5cc33a7989e8f54569e9d53eb1c53fc8f80c34/blake3-1.0.8-cp314-cp314t-macosx_10_12_x86_64.whl", hash = "sha256:e2df12f295f95a804338bd300e8fad4a6f54fd49bd4d9c5893855a230b5188a8", size = 347482, upload-time = "2025-10-14T06:47:00.189Z" },
{ url = "https://files.pythonhosted.org/packages/6a/35/92cd5501ce8e1f5cabdc0c3ac62d69fdb13ff0b60b62abbb2b6d0a53a790/blake3-1.0.8-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:63379be58438878eeb76ebe4f0efbeaabf42b79f2cff23b6126b7991588ced67", size = 324376, upload-time = "2025-10-14T06:47:01.413Z" },
{ url = "https://files.pythonhosted.org/packages/11/33/503b37220a3e2e31917ef13722efd00055af51c5e88ae30974c733d7ece6/blake3-1.0.8-cp314-cp314t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:88d527c247f9609dc1d45a08fd243e39f0d5300d54c57e048de24d4fa9240ebb", size = 370220, upload-time = "2025-10-14T06:47:02.573Z" },
{ url = "https://files.pythonhosted.org/packages/3e/df/fe817843adf59516c04d44387bd643b422a3b0400ea95c6ede6a49920737/blake3-1.0.8-cp314-cp314t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:506a47897a11ebe8f3cdeb52f1365d6a2f83959e98ccb0c830f8f73277d4d358", size = 373454, upload-time = "2025-10-14T06:47:03.784Z" },
{ url = "https://files.pythonhosted.org/packages/d1/4d/90a2a623575373dfc9b683f1bad1bf017feafa5a6d65d94fb09543050740/blake3-1.0.8-cp314-cp314t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e5122a61b3b004bbbd979bdf83a3aaab432da3e2a842d7ddf1c273f2503b4884", size = 447102, upload-time = "2025-10-14T06:47:04.958Z" },
{ url = "https://files.pythonhosted.org/packages/93/ff/4e8ce314f60115c4c657b1fdbe9225b991da4f5bcc5d1c1f1d151e2f39d6/blake3-1.0.8-cp314-cp314t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0171e85d56dec1219abdae5f49a0ed12cb3f86a454c29160a64fd8a8166bba37", size = 506791, upload-time = "2025-10-14T06:47:06.82Z" },
{ url = "https://files.pythonhosted.org/packages/44/88/2963a1f18aab52bdcf35379b2b48c34bbc462320c37e76960636b8602c36/blake3-1.0.8-cp314-cp314t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:003f61e8c41dd9931edddf1cc6a1bb680fb2ac0ad15493ef4a1df9adc59ce9df", size = 393717, upload-time = "2025-10-14T06:47:09.085Z" },
{ url = "https://files.pythonhosted.org/packages/45/d1/a848ed8e8d4e236b9b16381768c9ae99d92890c24886bb4505aa9c3d2033/blake3-1.0.8-cp314-cp314t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d2c3151955efb09ba58cd3e1263521e15e9e3866a40d6bd3556d86fc968e8f95", size = 386150, upload-time = "2025-10-14T06:47:10.363Z" },
{ url = "https://files.pythonhosted.org/packages/96/09/e3eb5d60f97c01de23d9f434e6e1fc117efb466eaa1f6ddbbbcb62580d6e/blake3-1.0.8-cp314-cp314t-musllinux_1_1_aarch64.whl", hash = "sha256:5eb25bca3cee2e0dd746a214784fb36be6a43640c01c55b6b4e26196e72d076c", size = 549120, upload-time = "2025-10-14T06:47:11.713Z" },
{ url = "https://files.pythonhosted.org/packages/14/ad/3d9661c710febb8957dd685fdb3e5a861aa0ac918eda3031365ce45789e2/blake3-1.0.8-cp314-cp314t-musllinux_1_1_x86_64.whl", hash = "sha256:ab4e1dea4fa857944944db78e8f20d99ee2e16b2dea5a14f514fb0607753ac83", size = 553264, upload-time = "2025-10-14T06:47:13.317Z" },
{ url = "https://files.pythonhosted.org/packages/11/55/e332a5b49edf377d0690e95951cca21a00c568f6e37315f9749efee52617/blake3-1.0.8-cp314-cp314t-win32.whl", hash = "sha256:67f1bc11bf59464ef092488c707b13dd4e872db36e25c453dfb6e0c7498df9f1", size = 228116, upload-time = "2025-10-14T06:47:14.516Z" },
{ url = "https://files.pythonhosted.org/packages/b0/5c/dbd00727a3dd165d7e0e8af40e630cd7e45d77b525a3218afaff8a87358e/blake3-1.0.8-cp314-cp314t-win_amd64.whl", hash = "sha256:421b99cdf1ff2d1bf703bc56c454f4b286fce68454dd8711abbcb5a0df90c19a", size = 215133, upload-time = "2025-10-14T06:47:16.069Z" },
]
[[package]] [[package]]
name = "caio" name = "caio"
version = "0.9.24" version = "0.9.24"
@ -442,15 +365,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/76/f2/98fd8d0b514622a789fd2824b59bd6041b799aaeeba14a8d92d52f6654dd/cython-3.2.2-py3-none-any.whl", hash = "sha256:13b99ecb9482aff6a6c12d1ca6feef6940c507af909914b49f568de74fa965fb", size = 1255106, upload-time = "2025-11-30T12:48:18.454Z" }, { url = "https://files.pythonhosted.org/packages/76/f2/98fd8d0b514622a789fd2824b59bd6041b799aaeeba14a8d92d52f6654dd/cython-3.2.2-py3-none-any.whl", hash = "sha256:13b99ecb9482aff6a6c12d1ca6feef6940c507af909914b49f568de74fa965fb", size = 1255106, upload-time = "2025-11-30T12:48:18.454Z" },
] ]
[[package]]
name = "dnspython"
version = "2.8.0"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/8c/8b/57666417c0f90f08bcafa776861060426765fdb422eb10212086fb811d26/dnspython-2.8.0.tar.gz", hash = "sha256:181d3c6996452cb1189c4046c61599b84a5a86e099562ffde77d26984ff26d0f", size = 368251, upload-time = "2025-09-07T18:58:00.022Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/ba/5a/18ad964b0086c6e62e2e7500f7edc89e3faa45033c71c1893d34eed2b2de/dnspython-2.8.0-py3-none-any.whl", hash = "sha256:01d9bbc4a2d76bf0db7c1f729812ded6d912bd318d3b1cf81d30c0f845dbf3af", size = 331094, upload-time = "2025-09-07T18:57:58.071Z" },
]
[[package]] [[package]]
name = "elastic-transport" name = "elastic-transport"
version = "8.17.1" version = "8.17.1"
@ -784,94 +698,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979, upload-time = "2022-08-14T12:40:09.779Z" }, { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979, upload-time = "2022-08-14T12:40:09.779Z" },
] ]
[[package]]
name = "mmh3"
version = "5.2.0"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/a7/af/f28c2c2f51f31abb4725f9a64bc7863d5f491f6539bd26aee2a1d21a649e/mmh3-5.2.0.tar.gz", hash = "sha256:1efc8fec8478e9243a78bb993422cf79f8ff85cb4cf6b79647480a31e0d950a8", size = 33582, upload-time = "2025-07-29T07:43:48.49Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/bf/6a/d5aa7edb5c08e0bd24286c7d08341a0446f9a2fbbb97d96a8a6dd81935ee/mmh3-5.2.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:384eda9361a7bf83a85e09447e1feafe081034af9dd428893701b959230d84be", size = 56141, upload-time = "2025-07-29T07:42:13.456Z" },
{ url = "https://files.pythonhosted.org/packages/08/49/131d0fae6447bc4a7299ebdb1a6fb9d08c9f8dcf97d75ea93e8152ddf7ab/mmh3-5.2.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:2c9da0d568569cc87315cb063486d761e38458b8ad513fedd3dc9263e1b81bcd", size = 40681, upload-time = "2025-07-29T07:42:14.306Z" },
{ url = "https://files.pythonhosted.org/packages/8f/6f/9221445a6bcc962b7f5ff3ba18ad55bba624bacdc7aa3fc0a518db7da8ec/mmh3-5.2.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:86d1be5d63232e6eb93c50881aea55ff06eb86d8e08f9b5417c8c9b10db9db96", size = 40062, upload-time = "2025-07-29T07:42:15.08Z" },
{ url = "https://files.pythonhosted.org/packages/1e/d4/6bb2d0fef81401e0bb4c297d1eb568b767de4ce6fc00890bc14d7b51ecc4/mmh3-5.2.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:bf7bee43e17e81671c447e9c83499f53d99bf440bc6d9dc26a841e21acfbe094", size = 97333, upload-time = "2025-07-29T07:42:16.436Z" },
{ url = "https://files.pythonhosted.org/packages/44/e0/ccf0daff8134efbb4fbc10a945ab53302e358c4b016ada9bf97a6bdd50c1/mmh3-5.2.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:7aa18cdb58983ee660c9c400b46272e14fa253c675ed963d3812487f8ca42037", size = 103310, upload-time = "2025-07-29T07:42:17.796Z" },
{ url = "https://files.pythonhosted.org/packages/02/63/1965cb08a46533faca0e420e06aff8bbaf9690a6f0ac6ae6e5b2e4544687/mmh3-5.2.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ae9d032488fcec32d22be6542d1a836f00247f40f320844dbb361393b5b22773", size = 106178, upload-time = "2025-07-29T07:42:19.281Z" },
{ url = "https://files.pythonhosted.org/packages/c2/41/c883ad8e2c234013f27f92061200afc11554ea55edd1bcf5e1accd803a85/mmh3-5.2.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:e1861fb6b1d0453ed7293200139c0a9011eeb1376632e048e3766945b13313c5", size = 113035, upload-time = "2025-07-29T07:42:20.356Z" },
{ url = "https://files.pythonhosted.org/packages/df/b5/1ccade8b1fa625d634a18bab7bf08a87457e09d5ec8cf83ca07cbea9d400/mmh3-5.2.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:99bb6a4d809aa4e528ddfe2c85dd5239b78b9dd14be62cca0329db78505e7b50", size = 120784, upload-time = "2025-07-29T07:42:21.377Z" },
{ url = "https://files.pythonhosted.org/packages/77/1c/919d9171fcbdcdab242e06394464ccf546f7d0f3b31e0d1e3a630398782e/mmh3-5.2.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1f8d8b627799f4e2fcc7c034fed8f5f24dc7724ff52f69838a3d6d15f1ad4765", size = 99137, upload-time = "2025-07-29T07:42:22.344Z" },
{ url = "https://files.pythonhosted.org/packages/66/8a/1eebef5bd6633d36281d9fc83cf2e9ba1ba0e1a77dff92aacab83001cee4/mmh3-5.2.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:b5995088dd7023d2d9f310a0c67de5a2b2e06a570ecfd00f9ff4ab94a67cde43", size = 98664, upload-time = "2025-07-29T07:42:23.269Z" },
{ url = "https://files.pythonhosted.org/packages/13/41/a5d981563e2ee682b21fb65e29cc0f517a6734a02b581359edd67f9d0360/mmh3-5.2.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:1a5f4d2e59d6bba8ef01b013c472741835ad961e7c28f50c82b27c57748744a4", size = 106459, upload-time = "2025-07-29T07:42:24.238Z" },
{ url = "https://files.pythonhosted.org/packages/24/31/342494cd6ab792d81e083680875a2c50fa0c5df475ebf0b67784f13e4647/mmh3-5.2.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:fd6e6c3d90660d085f7e73710eab6f5545d4854b81b0135a3526e797009dbda3", size = 110038, upload-time = "2025-07-29T07:42:25.629Z" },
{ url = "https://files.pythonhosted.org/packages/28/44/efda282170a46bb4f19c3e2b90536513b1d821c414c28469a227ca5a1789/mmh3-5.2.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:c4a2f3d83879e3de2eb8cbf562e71563a8ed15ee9b9c2e77ca5d9f73072ac15c", size = 97545, upload-time = "2025-07-29T07:42:27.04Z" },
{ url = "https://files.pythonhosted.org/packages/68/8f/534ae319c6e05d714f437e7206f78c17e66daca88164dff70286b0e8ea0c/mmh3-5.2.0-cp312-cp312-win32.whl", hash = "sha256:2421b9d665a0b1ad724ec7332fb5a98d075f50bc51a6ff854f3a1882bd650d49", size = 40805, upload-time = "2025-07-29T07:42:28.032Z" },
{ url = "https://files.pythonhosted.org/packages/b8/f6/f6abdcfefcedab3c964868048cfe472764ed358c2bf6819a70dd4ed4ed3a/mmh3-5.2.0-cp312-cp312-win_amd64.whl", hash = "sha256:72d80005b7634a3a2220f81fbeb94775ebd12794623bb2e1451701ea732b4aa3", size = 41597, upload-time = "2025-07-29T07:42:28.894Z" },
{ url = "https://files.pythonhosted.org/packages/15/fd/f7420e8cbce45c259c770cac5718badf907b302d3a99ec587ba5ce030237/mmh3-5.2.0-cp312-cp312-win_arm64.whl", hash = "sha256:3d6bfd9662a20c054bc216f861fa330c2dac7c81e7fb8307b5e32ab5b9b4d2e0", size = 39350, upload-time = "2025-07-29T07:42:29.794Z" },
{ url = "https://files.pythonhosted.org/packages/d8/fa/27f6ab93995ef6ad9f940e96593c5dd24744d61a7389532b0fec03745607/mmh3-5.2.0-cp313-cp313-android_21_arm64_v8a.whl", hash = "sha256:e79c00eba78f7258e5b354eccd4d7907d60317ced924ea4a5f2e9d83f5453065", size = 40874, upload-time = "2025-07-29T07:42:30.662Z" },
{ url = "https://files.pythonhosted.org/packages/11/9c/03d13bcb6a03438bc8cac3d2e50f80908d159b31a4367c2e1a7a077ded32/mmh3-5.2.0-cp313-cp313-android_21_x86_64.whl", hash = "sha256:956127e663d05edbeec54df38885d943dfa27406594c411139690485128525de", size = 42012, upload-time = "2025-07-29T07:42:31.539Z" },
{ url = "https://files.pythonhosted.org/packages/4e/78/0865d9765408a7d504f1789944e678f74e0888b96a766d578cb80b040999/mmh3-5.2.0-cp313-cp313-ios_13_0_arm64_iphoneos.whl", hash = "sha256:c3dca4cb5b946ee91b3d6bb700d137b1cd85c20827f89fdf9c16258253489044", size = 39197, upload-time = "2025-07-29T07:42:32.374Z" },
{ url = "https://files.pythonhosted.org/packages/3e/12/76c3207bd186f98b908b6706c2317abb73756d23a4e68ea2bc94825b9015/mmh3-5.2.0-cp313-cp313-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:e651e17bfde5840e9e4174b01e9e080ce49277b70d424308b36a7969d0d1af73", size = 39840, upload-time = "2025-07-29T07:42:33.227Z" },
{ url = "https://files.pythonhosted.org/packages/5d/0d/574b6cce5555c9f2b31ea189ad44986755eb14e8862db28c8b834b8b64dc/mmh3-5.2.0-cp313-cp313-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:9f64bf06f4bf623325fda3a6d02d36cd69199b9ace99b04bb2d7fd9f89688504", size = 40644, upload-time = "2025-07-29T07:42:34.099Z" },
{ url = "https://files.pythonhosted.org/packages/52/82/3731f8640b79c46707f53ed72034a58baad400be908c87b0088f1f89f986/mmh3-5.2.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:ddc63328889bcaee77b743309e5c7d2d52cee0d7d577837c91b6e7cc9e755e0b", size = 56153, upload-time = "2025-07-29T07:42:35.031Z" },
{ url = "https://files.pythonhosted.org/packages/4f/34/e02dca1d4727fd9fdeaff9e2ad6983e1552804ce1d92cc796e5b052159bb/mmh3-5.2.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:bb0fdc451fb6d86d81ab8f23d881b8d6e37fc373a2deae1c02d27002d2ad7a05", size = 40684, upload-time = "2025-07-29T07:42:35.914Z" },
{ url = "https://files.pythonhosted.org/packages/8f/36/3dee40767356e104967e6ed6d102ba47b0b1ce2a89432239b95a94de1b89/mmh3-5.2.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:b29044e1ffdb84fe164d0a7ea05c7316afea93c00f8ed9449cf357c36fc4f814", size = 40057, upload-time = "2025-07-29T07:42:36.755Z" },
{ url = "https://files.pythonhosted.org/packages/31/58/228c402fccf76eb39a0a01b8fc470fecf21965584e66453b477050ee0e99/mmh3-5.2.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:58981d6ea9646dbbf9e59a30890cbf9f610df0e4a57dbfe09215116fd90b0093", size = 97344, upload-time = "2025-07-29T07:42:37.675Z" },
{ url = "https://files.pythonhosted.org/packages/34/82/fc5ce89006389a6426ef28e326fc065b0fbaaed230373b62d14c889f47ea/mmh3-5.2.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:7e5634565367b6d98dc4aa2983703526ef556b3688ba3065edb4b9b90ede1c54", size = 103325, upload-time = "2025-07-29T07:42:38.591Z" },
{ url = "https://files.pythonhosted.org/packages/09/8c/261e85777c6aee1ebd53f2f17e210e7481d5b0846cd0b4a5c45f1e3761b8/mmh3-5.2.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b0271ac12415afd3171ab9a3c7cbfc71dee2c68760a7dc9d05bf8ed6ddfa3a7a", size = 106240, upload-time = "2025-07-29T07:42:39.563Z" },
{ url = "https://files.pythonhosted.org/packages/70/73/2f76b3ad8a3d431824e9934403df36c0ddacc7831acf82114bce3c4309c8/mmh3-5.2.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:45b590e31bc552c6f8e2150ff1ad0c28dd151e9f87589e7eaf508fbdd8e8e908", size = 113060, upload-time = "2025-07-29T07:42:40.585Z" },
{ url = "https://files.pythonhosted.org/packages/9f/b9/7ea61a34e90e50a79a9d87aa1c0b8139a7eaf4125782b34b7d7383472633/mmh3-5.2.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:bdde97310d59604f2a9119322f61b31546748499a21b44f6715e8ced9308a6c5", size = 120781, upload-time = "2025-07-29T07:42:41.618Z" },
{ url = "https://files.pythonhosted.org/packages/0f/5b/ae1a717db98c7894a37aeedbd94b3f99e6472a836488f36b6849d003485b/mmh3-5.2.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:fc9c5f280438cf1c1a8f9abb87dc8ce9630a964120cfb5dd50d1e7ce79690c7a", size = 99174, upload-time = "2025-07-29T07:42:42.587Z" },
{ url = "https://files.pythonhosted.org/packages/e3/de/000cce1d799fceebb6d4487ae29175dd8e81b48e314cba7b4da90bcf55d7/mmh3-5.2.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:c903e71fd8debb35ad2a4184c1316b3cb22f64ce517b4e6747f25b0a34e41266", size = 98734, upload-time = "2025-07-29T07:42:43.996Z" },
{ url = "https://files.pythonhosted.org/packages/79/19/0dc364391a792b72fbb22becfdeacc5add85cc043cd16986e82152141883/mmh3-5.2.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:eed4bba7ff8a0d37106ba931ab03bdd3915fbb025bcf4e1f0aa02bc8114960c5", size = 106493, upload-time = "2025-07-29T07:42:45.07Z" },
{ url = "https://files.pythonhosted.org/packages/3c/b1/bc8c28e4d6e807bbb051fefe78e1156d7f104b89948742ad310612ce240d/mmh3-5.2.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:1fdb36b940e9261aff0b5177c5b74a36936b902f473180f6c15bde26143681a9", size = 110089, upload-time = "2025-07-29T07:42:46.122Z" },
{ url = "https://files.pythonhosted.org/packages/3b/a2/d20f3f5c95e9c511806686c70d0a15479cc3941c5f322061697af1c1ff70/mmh3-5.2.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7303aab41e97adcf010a09efd8f1403e719e59b7705d5e3cfed3dd7571589290", size = 97571, upload-time = "2025-07-29T07:42:47.18Z" },
{ url = "https://files.pythonhosted.org/packages/7b/23/665296fce4f33488deec39a750ffd245cfc07aafb0e3ef37835f91775d14/mmh3-5.2.0-cp313-cp313-win32.whl", hash = "sha256:03e08c6ebaf666ec1e3d6ea657a2d363bb01effd1a9acfe41f9197decaef0051", size = 40806, upload-time = "2025-07-29T07:42:48.166Z" },
{ url = "https://files.pythonhosted.org/packages/59/b0/92e7103f3b20646e255b699e2d0327ce53a3f250e44367a99dc8be0b7c7a/mmh3-5.2.0-cp313-cp313-win_amd64.whl", hash = "sha256:7fddccd4113e7b736706e17a239a696332360cbaddf25ae75b57ba1acce65081", size = 41600, upload-time = "2025-07-29T07:42:49.371Z" },
{ url = "https://files.pythonhosted.org/packages/99/22/0b2bd679a84574647de538c5b07ccaa435dbccc37815067fe15b90fe8dad/mmh3-5.2.0-cp313-cp313-win_arm64.whl", hash = "sha256:fa0c966ee727aad5406d516375593c5f058c766b21236ab8985693934bb5085b", size = 39349, upload-time = "2025-07-29T07:42:50.268Z" },
{ url = "https://files.pythonhosted.org/packages/f7/ca/a20db059a8a47048aaf550da14a145b56e9c7386fb8280d3ce2962dcebf7/mmh3-5.2.0-cp314-cp314-ios_13_0_arm64_iphoneos.whl", hash = "sha256:e5015f0bb6eb50008bed2d4b1ce0f2a294698a926111e4bb202c0987b4f89078", size = 39209, upload-time = "2025-07-29T07:42:51.559Z" },
{ url = "https://files.pythonhosted.org/packages/98/dd/e5094799d55c7482d814b979a0fd608027d0af1b274bfb4c3ea3e950bfd5/mmh3-5.2.0-cp314-cp314-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:e0f3ed828d709f5b82d8bfe14f8856120718ec4bd44a5b26102c3030a1e12501", size = 39843, upload-time = "2025-07-29T07:42:52.536Z" },
{ url = "https://files.pythonhosted.org/packages/f4/6b/7844d7f832c85400e7cc89a1348e4e1fdd38c5a38415bb5726bbb8fcdb6c/mmh3-5.2.0-cp314-cp314-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:f35727c5118aba95f0397e18a1a5b8405425581bfe53e821f0fb444cbdc2bc9b", size = 40648, upload-time = "2025-07-29T07:42:53.392Z" },
{ url = "https://files.pythonhosted.org/packages/1f/bf/71f791f48a21ff3190ba5225807cbe4f7223360e96862c376e6e3fb7efa7/mmh3-5.2.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3bc244802ccab5220008cb712ca1508cb6a12f0eb64ad62997156410579a1770", size = 56164, upload-time = "2025-07-29T07:42:54.267Z" },
{ url = "https://files.pythonhosted.org/packages/70/1f/f87e3d34d83032b4f3f0f528c6d95a98290fcacf019da61343a49dccfd51/mmh3-5.2.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:ff3d50dc3fe8a98059f99b445dfb62792b5d006c5e0b8f03c6de2813b8376110", size = 40692, upload-time = "2025-07-29T07:42:55.234Z" },
{ url = "https://files.pythonhosted.org/packages/a6/e2/db849eaed07117086f3452feca8c839d30d38b830ac59fe1ce65af8be5ad/mmh3-5.2.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:37a358cc881fe796e099c1db6ce07ff757f088827b4e8467ac52b7a7ffdca647", size = 40068, upload-time = "2025-07-29T07:42:56.158Z" },
{ url = "https://files.pythonhosted.org/packages/df/6b/209af927207af77425b044e32f77f49105a0b05d82ff88af6971d8da4e19/mmh3-5.2.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:b9a87025121d1c448f24f27ff53a5fe7b6ef980574b4a4f11acaabe702420d63", size = 97367, upload-time = "2025-07-29T07:42:57.037Z" },
{ url = "https://files.pythonhosted.org/packages/ca/e0/78adf4104c425606a9ce33fb351f790c76a6c2314969c4a517d1ffc92196/mmh3-5.2.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:1ba55d6ca32eeef8b2625e1e4bfc3b3db52bc63014bd7e5df8cc11bf2b036b12", size = 103306, upload-time = "2025-07-29T07:42:58.522Z" },
{ url = "https://files.pythonhosted.org/packages/a3/79/c2b89f91b962658b890104745b1b6c9ce38d50a889f000b469b91eeb1b9e/mmh3-5.2.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c9ff37ba9f15637e424c2ab57a1a590c52897c845b768e4e0a4958084ec87f22", size = 106312, upload-time = "2025-07-29T07:42:59.552Z" },
{ url = "https://files.pythonhosted.org/packages/4b/14/659d4095528b1a209be90934778c5ffe312177d51e365ddcbca2cac2ec7c/mmh3-5.2.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a094319ec0db52a04af9fdc391b4d39a1bc72bc8424b47c4411afb05413a44b5", size = 113135, upload-time = "2025-07-29T07:43:00.745Z" },
{ url = "https://files.pythonhosted.org/packages/8d/6f/cd7734a779389a8a467b5c89a48ff476d6f2576e78216a37551a97e9e42a/mmh3-5.2.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:c5584061fd3da584659b13587f26c6cad25a096246a481636d64375d0c1f6c07", size = 120775, upload-time = "2025-07-29T07:43:02.124Z" },
{ url = "https://files.pythonhosted.org/packages/1d/ca/8256e3b96944408940de3f9291d7e38a283b5761fe9614d4808fcf27bd62/mmh3-5.2.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:ecbfc0437ddfdced5e7822d1ce4855c9c64f46819d0fdc4482c53f56c707b935", size = 99178, upload-time = "2025-07-29T07:43:03.182Z" },
{ url = "https://files.pythonhosted.org/packages/8a/32/39e2b3cf06b6e2eb042c984dab8680841ac2a0d3ca6e0bea30db1f27b565/mmh3-5.2.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:7b986d506a8e8ea345791897ba5d8ba0d9d8820cd4fc3e52dbe6de19388de2e7", size = 98738, upload-time = "2025-07-29T07:43:04.207Z" },
{ url = "https://files.pythonhosted.org/packages/61/d3/7bbc8e0e8cf65ebbe1b893ffa0467b7ecd1bd07c3bbf6c9db4308ada22ec/mmh3-5.2.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:38d899a156549da8ef6a9f1d6f7ef231228d29f8f69bce2ee12f5fba6d6fd7c5", size = 106510, upload-time = "2025-07-29T07:43:05.656Z" },
{ url = "https://files.pythonhosted.org/packages/10/99/b97e53724b52374e2f3859046f0eb2425192da356cb19784d64bc17bb1cf/mmh3-5.2.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:d86651fa45799530885ba4dab3d21144486ed15285e8784181a0ab37a4552384", size = 110053, upload-time = "2025-07-29T07:43:07.204Z" },
{ url = "https://files.pythonhosted.org/packages/ac/62/3688c7d975ed195155671df68788c83fed6f7909b6ec4951724c6860cb97/mmh3-5.2.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:c463d7c1c4cfc9d751efeaadd936bbba07b5b0ed81a012b3a9f5a12f0872bd6e", size = 97546, upload-time = "2025-07-29T07:43:08.226Z" },
{ url = "https://files.pythonhosted.org/packages/ca/3b/c6153250f03f71a8b7634cded82939546cdfba02e32f124ff51d52c6f991/mmh3-5.2.0-cp314-cp314-win32.whl", hash = "sha256:bb4fe46bdc6104fbc28db7a6bacb115ee6368ff993366bbd8a2a7f0076e6f0c0", size = 41422, upload-time = "2025-07-29T07:43:09.216Z" },
{ url = "https://files.pythonhosted.org/packages/74/01/a27d98bab083a435c4c07e9d1d720d4c8a578bf4c270bae373760b1022be/mmh3-5.2.0-cp314-cp314-win_amd64.whl", hash = "sha256:7c7f0b342fd06044bedd0b6e72177ddc0076f54fd89ee239447f8b271d919d9b", size = 42135, upload-time = "2025-07-29T07:43:10.183Z" },
{ url = "https://files.pythonhosted.org/packages/cb/c9/dbba5507e95429b8b380e2ba091eff5c20a70a59560934dff0ad8392b8c8/mmh3-5.2.0-cp314-cp314-win_arm64.whl", hash = "sha256:3193752fc05ea72366c2b63ff24b9a190f422e32d75fdeae71087c08fff26115", size = 39879, upload-time = "2025-07-29T07:43:11.106Z" },
{ url = "https://files.pythonhosted.org/packages/b5/d1/c8c0ef839c17258b9de41b84f663574fabcf8ac2007b7416575e0f65ff6e/mmh3-5.2.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:69fc339d7202bea69ef9bd7c39bfdf9fdabc8e6822a01eba62fb43233c1b3932", size = 57696, upload-time = "2025-07-29T07:43:11.989Z" },
{ url = "https://files.pythonhosted.org/packages/2f/55/95e2b9ff201e89f9fe37036037ab61a6c941942b25cdb7b6a9df9b931993/mmh3-5.2.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:12da42c0a55c9d86ab566395324213c319c73ecb0c239fad4726324212b9441c", size = 41421, upload-time = "2025-07-29T07:43:13.269Z" },
{ url = "https://files.pythonhosted.org/packages/77/79/9be23ad0b7001a4b22752e7693be232428ecc0a35068a4ff5c2f14ef8b20/mmh3-5.2.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:f7f9034c7cf05ddfaac8d7a2e63a3c97a840d4615d0a0e65ba8bdf6f8576e3be", size = 40853, upload-time = "2025-07-29T07:43:14.888Z" },
{ url = "https://files.pythonhosted.org/packages/ac/1b/96b32058eda1c1dee8264900c37c359a7325c1f11f5ff14fd2be8e24eff9/mmh3-5.2.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:11730eeb16dfcf9674fdea9bb6b8e6dd9b40813b7eb839bc35113649eef38aeb", size = 109694, upload-time = "2025-07-29T07:43:15.816Z" },
{ url = "https://files.pythonhosted.org/packages/8d/6f/a2ae44cd7dad697b6dea48390cbc977b1e5ca58fda09628cbcb2275af064/mmh3-5.2.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:932a6eec1d2e2c3c9e630d10f7128d80e70e2d47fe6b8c7ea5e1afbd98733e65", size = 117438, upload-time = "2025-07-29T07:43:16.865Z" },
{ url = "https://files.pythonhosted.org/packages/a0/08/bfb75451c83f05224a28afeaf3950c7b793c0b71440d571f8e819cfb149a/mmh3-5.2.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3ca975c51c5028947bbcfc24966517aac06a01d6c921e30f7c5383c195f87991", size = 120409, upload-time = "2025-07-29T07:43:18.207Z" },
{ url = "https://files.pythonhosted.org/packages/9f/ea/8b118b69b2ff8df568f742387d1a159bc654a0f78741b31437dd047ea28e/mmh3-5.2.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5b0b58215befe0f0e120b828f7645e97719bbba9f23b69e268ed0ac7adde8645", size = 125909, upload-time = "2025-07-29T07:43:19.39Z" },
{ url = "https://files.pythonhosted.org/packages/3e/11/168cc0b6a30650032e351a3b89b8a47382da541993a03af91e1ba2501234/mmh3-5.2.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:29c2b9ce61886809d0492a274a5a53047742dea0f703f9c4d5d223c3ea6377d3", size = 135331, upload-time = "2025-07-29T07:43:20.435Z" },
{ url = "https://files.pythonhosted.org/packages/31/05/e3a9849b1c18a7934c64e831492c99e67daebe84a8c2f2c39a7096a830e3/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:a367d4741ac0103f8198c82f429bccb9359f543ca542b06a51f4f0332e8de279", size = 110085, upload-time = "2025-07-29T07:43:21.92Z" },
{ url = "https://files.pythonhosted.org/packages/d9/d5/a96bcc306e3404601418b2a9a370baec92af84204528ba659fdfe34c242f/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:5a5dba98e514fb26241868f6eb90a7f7ca0e039aed779342965ce24ea32ba513", size = 111195, upload-time = "2025-07-29T07:43:23.066Z" },
{ url = "https://files.pythonhosted.org/packages/af/29/0fd49801fec5bff37198684e0849b58e0dab3a2a68382a357cfffb0fafc3/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:941603bfd75a46023807511c1ac2f1b0f39cccc393c15039969806063b27e6db", size = 116919, upload-time = "2025-07-29T07:43:24.178Z" },
{ url = "https://files.pythonhosted.org/packages/2d/04/4f3c32b0a2ed762edca45d8b46568fc3668e34f00fb1e0a3b5451ec1281c/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:132dd943451a7c7546978863d2f5a64977928410782e1a87d583cb60eb89e667", size = 123160, upload-time = "2025-07-29T07:43:25.26Z" },
{ url = "https://files.pythonhosted.org/packages/91/76/3d29eaa38821730633d6a240d36fa8ad2807e9dfd432c12e1a472ed211eb/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:f698733a8a494466432d611a8f0d1e026f5286dee051beea4b3c3146817e35d5", size = 110206, upload-time = "2025-07-29T07:43:26.699Z" },
{ url = "https://files.pythonhosted.org/packages/44/1c/ccf35892684d3a408202e296e56843743e0b4fb1629e59432ea88cdb3909/mmh3-5.2.0-cp314-cp314t-win32.whl", hash = "sha256:6d541038b3fc360ec538fc116de87462627944765a6750308118f8b509a8eec7", size = 41970, upload-time = "2025-07-29T07:43:27.666Z" },
{ url = "https://files.pythonhosted.org/packages/75/b2/b9e4f1e5adb5e21eb104588fcee2cd1eaa8308255173481427d5ecc4284e/mmh3-5.2.0-cp314-cp314t-win_amd64.whl", hash = "sha256:e912b19cf2378f2967d0c08e86ff4c6c360129887f678e27e4dde970d21b3f4d", size = 43063, upload-time = "2025-07-29T07:43:28.582Z" },
{ url = "https://files.pythonhosted.org/packages/6a/fc/0e61d9a4e29c8679356795a40e48f647b4aad58d71bfc969f0f8f56fb912/mmh3-5.2.0-cp314-cp314t-win_arm64.whl", hash = "sha256:e7884931fe5e788163e7b3c511614130c2c59feffdc21112290a194487efb2e9", size = 40455, upload-time = "2025-07-29T07:43:29.563Z" },
]
[[package]]
name = "morphys"
version = "1.0"
source = { registry = "https://pypi.org/simple" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/f9/4f/cb781d0ac5d079adabc77dc4f0bc99fc81c390029bd33c6e70552139e762/morphys-1.0-py2.py3-none-any.whl", hash = "sha256:76d6dbaa4d65f597e59d332c81da786d83e4669387b9b2a750cfec74e7beec20", size = 5618, upload-time = "2017-01-10T20:08:56.872Z" },
]
[[package]] [[package]]
name = "msgspec" name = "msgspec"
version = "0.19.0" version = "0.19.0"
@ -894,29 +720,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/23/d8/f15b40611c2d5753d1abb0ca0da0c75348daf1252220e5dda2867bd81062/msgspec-0.19.0-cp313-cp313-win_amd64.whl", hash = "sha256:317050bc0f7739cb30d257ff09152ca309bf5a369854bbf1e57dffc310c1f20f", size = 187432, upload-time = "2024-12-27T17:40:16.256Z" }, { url = "https://files.pythonhosted.org/packages/23/d8/f15b40611c2d5753d1abb0ca0da0c75348daf1252220e5dda2867bd81062/msgspec-0.19.0-cp313-cp313-win_amd64.whl", hash = "sha256:317050bc0f7739cb30d257ff09152ca309bf5a369854bbf1e57dffc310c1f20f", size = 187432, upload-time = "2024-12-27T17:40:16.256Z" },
] ]
[[package]]
name = "multiaddr"
version = "0.1.1"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "base58" },
{ name = "dnspython" },
{ name = "idna" },
{ name = "netaddr" },
{ name = "psutil" },
{ name = "py-cid" },
{ name = "py-multibase" },
{ name = "py-multicodec" },
{ name = "py-multihash" },
{ name = "trio" },
{ name = "trio-typing" },
{ name = "varint" },
]
sdist = { url = "https://files.pythonhosted.org/packages/cf/5c/6d27f2b04c54e7c85b4a05760ac7dfaa7c68214b917e0d4a5043c01cf231/multiaddr-0.1.1.tar.gz", hash = "sha256:04da0afd2097625569073776526eb9733db9d9713286bada44632a9d7275b9bb", size = 54186, upload-time = "2025-12-07T17:19:07.996Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/07/ad/bd8a1748953a8f7a8167ec7d02eeefbed469595089d75e3fcb53047e7e20/multiaddr-0.1.1-py3-none-any.whl", hash = "sha256:d95333effddbd372009dbfce4d2ec922dd633697b6cc89a5af90ae082c4e68d4", size = 38374, upload-time = "2025-12-07T17:19:05.849Z" },
]
[[package]] [[package]]
name = "multidict" name = "multidict"
version = "6.7.0" version = "6.7.0"
@ -1034,15 +837,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/a0/c4/c2971a3ba4c6103a3d10c4b0f24f461ddc027f0f09763220cf35ca1401b3/nest_asyncio-1.6.0-py3-none-any.whl", hash = "sha256:87af6efd6b5e897c81050477ef65c62e2b2f35d51703cae01aff2905b1852e1c", size = 5195, upload-time = "2024-01-21T14:25:17.223Z" }, { url = "https://files.pythonhosted.org/packages/a0/c4/c2971a3ba4c6103a3d10c4b0f24f461ddc027f0f09763220cf35ca1401b3/nest_asyncio-1.6.0-py3-none-any.whl", hash = "sha256:87af6efd6b5e897c81050477ef65c62e2b2f35d51703cae01aff2905b1852e1c", size = 5195, upload-time = "2024-01-21T14:25:17.223Z" },
] ]
[[package]]
name = "netaddr"
version = "1.3.0"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/54/90/188b2a69654f27b221fba92fda7217778208532c962509e959a9cee5229d/netaddr-1.3.0.tar.gz", hash = "sha256:5c3c3d9895b551b763779ba7db7a03487dc1f8e3b385af819af341ae9ef6e48a", size = 2260504, upload-time = "2024-05-28T21:30:37.743Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/12/cc/f4fe2c7ce68b92cbf5b2d379ca366e1edae38cccaad00f69f529b460c3ef/netaddr-1.3.0-py3-none-any.whl", hash = "sha256:c2c6a8ebe5554ce33b7d5b3a306b71bbb373e000bbbf2350dd5213cc56e3dbbe", size = 2262023, upload-time = "2024-05-28T21:30:34.191Z" },
]
[[package]] [[package]]
name = "numba" name = "numba"
version = "0.62.1" version = "0.62.1"
@ -1206,18 +1000,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/6e/23/e98758924d1b3aac11a626268eabf7f3cf177e7837c28d47bf84c64532d0/pendulum-3.1.0-py3-none-any.whl", hash = "sha256:f9178c2a8e291758ade1e8dd6371b1d26d08371b4c7730a6e9a3ef8b16ebae0f", size = 111799, upload-time = "2025-04-19T14:02:34.739Z" }, { url = "https://files.pythonhosted.org/packages/6e/23/e98758924d1b3aac11a626268eabf7f3cf177e7837c28d47bf84c64532d0/pendulum-3.1.0-py3-none-any.whl", hash = "sha256:f9178c2a8e291758ade1e8dd6371b1d26d08371b4c7730a6e9a3ef8b16ebae0f", size = 111799, upload-time = "2025-04-19T14:02:34.739Z" },
] ]
[[package]]
name = "pexpect"
version = "4.9.0"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "ptyprocess" },
]
sdist = { url = "https://files.pythonhosted.org/packages/42/92/cc564bf6381ff43ce1f4d06852fc19a2f11d180f23dc32d9588bee2f149d/pexpect-4.9.0.tar.gz", hash = "sha256:ee7d41123f3c9911050ea2c2dac107568dc43b2d3b0c7557a33212c398ead30f", size = 166450, upload-time = "2023-11-25T09:07:26.339Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/9e/c3/059298687310d527a58bb01f3b1965787ee3b40dce76752eda8b44e9a2c5/pexpect-4.9.0-py2.py3-none-any.whl", hash = "sha256:7236d1e080e4936be2dc3e326cec0af72acf9212a7e1d060210e70a47e253523", size = 63772, upload-time = "2023-11-25T06:56:14.81Z" },
]
[[package]] [[package]]
name = "piker" name = "piker"
version = "0.1.0a0.dev0" version = "0.1.0a0.dev0"
@ -1265,7 +1047,6 @@ dev = [
{ name = "greenback" }, { name = "greenback" },
{ name = "i3ipc" }, { name = "i3ipc" },
{ name = "pdbp" }, { name = "pdbp" },
{ name = "pexpect" },
{ name = "prompt-toolkit" }, { name = "prompt-toolkit" },
{ name = "pyperclip" }, { name = "pyperclip" },
{ name = "pyqt6" }, { name = "pyqt6" },
@ -1281,7 +1062,6 @@ lint = [
repl = [ repl = [
{ name = "greenback" }, { name = "greenback" },
{ name = "pdbp" }, { name = "pdbp" },
{ name = "pexpect" },
{ name = "prompt-toolkit" }, { name = "prompt-toolkit" },
{ name = "pyperclip" }, { name = "pyperclip" },
{ name = "xonsh" }, { name = "xonsh" },
@ -1319,7 +1099,7 @@ requires-dist = [
{ name = "tomli", specifier = ">=2.0.1,<3.0.0" }, { name = "tomli", specifier = ">=2.0.1,<3.0.0" },
{ name = "tomli-w", specifier = ">=1.0.0,<2.0.0" }, { name = "tomli-w", specifier = ">=1.0.0,<2.0.0" },
{ name = "tomlkit", git = "https://github.com/pikers/tomlkit.git?branch=piker_pin" }, { name = "tomlkit", git = "https://github.com/pikers/tomlkit.git?branch=piker_pin" },
{ name = "tractor", editable = "../tractor" }, { name = "tractor", git = "https://github.com/goodboy/tractor.git?branch=piker_pin" },
{ name = "trio", specifier = ">=0.27" }, { name = "trio", specifier = ">=0.27" },
{ name = "trio-typing", specifier = ">=0.10.0" }, { name = "trio-typing", specifier = ">=0.10.0" },
{ name = "trio-util", specifier = ">=0.7.0,<0.8.0" }, { name = "trio-util", specifier = ">=0.7.0,<0.8.0" },
@ -1336,29 +1116,27 @@ dev = [
{ name = "greenback", specifier = ">=1.1.1,<2.0.0" }, { name = "greenback", specifier = ">=1.1.1,<2.0.0" },
{ name = "i3ipc", specifier = ">=2.2.1" }, { name = "i3ipc", specifier = ">=2.2.1" },
{ name = "pdbp", specifier = ">=1.8.2,<2.0.0" }, { name = "pdbp", specifier = ">=1.8.2,<2.0.0" },
{ name = "pexpect", specifier = ">=4.9.0" },
{ name = "prompt-toolkit", specifier = "==3.0.40" }, { name = "prompt-toolkit", specifier = "==3.0.40" },
{ name = "pyperclip", specifier = ">=1.9.0" }, { name = "pyperclip", specifier = ">=1.9.0" },
{ name = "pyqt6", specifier = ">=6.7.0,<7.0.0" }, { name = "pyqt6", specifier = ">=6.7.0,<7.0.0" },
{ name = "pyqtgraph", git = "https://github.com/pyqtgraph/pyqtgraph.git?branch=master" }, { name = "pyqtgraph", git = "https://github.com/pikers/pyqtgraph.git" },
{ name = "pytest" }, { name = "pytest" },
{ name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" }, { name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" },
{ name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" }, { name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" },
{ name = "xonsh", git = "https://github.com/xonsh/xonsh.git?branch=main" }, { name = "xonsh" },
] ]
lint = [{ name = "ruff", specifier = ">=0.9.6" }] lint = [{ name = "ruff", specifier = ">=0.9.6" }]
repl = [ repl = [
{ name = "greenback", specifier = ">=1.1.1,<2.0.0" }, { name = "greenback", specifier = ">=1.1.1,<2.0.0" },
{ name = "pdbp", specifier = ">=1.8.2,<2.0.0" }, { name = "pdbp", specifier = ">=1.8.2,<2.0.0" },
{ name = "pexpect", specifier = ">=4.9.0" },
{ name = "prompt-toolkit", specifier = "==3.0.40" }, { name = "prompt-toolkit", specifier = "==3.0.40" },
{ name = "pyperclip", specifier = ">=1.9.0" }, { name = "pyperclip", specifier = ">=1.9.0" },
{ name = "xonsh", git = "https://github.com/xonsh/xonsh.git?branch=main" }, { name = "xonsh" },
] ]
testing = [{ name = "pytest" }] testing = [{ name = "pytest" }]
uis = [ uis = [
{ name = "pyqt6", specifier = ">=6.7.0,<7.0.0" }, { name = "pyqt6", specifier = ">=6.7.0,<7.0.0" },
{ name = "pyqtgraph", git = "https://github.com/pyqtgraph/pyqtgraph.git?branch=master" }, { name = "pyqtgraph", git = "https://github.com/pikers/pyqtgraph.git" },
{ name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" }, { name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" },
{ name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" }, { name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" },
] ]
@ -1519,101 +1297,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/5b/5a/bc7b4a4ef808fa59a816c17b20c4bef6884daebbdf627ff2a161da67da19/propcache-0.4.1-py3-none-any.whl", hash = "sha256:af2a6052aeb6cf17d3e46ee169099044fd8224cbaf75c76a2ef596e8163e2237", size = 13305, upload-time = "2025-10-08T19:49:00.792Z" }, { url = "https://files.pythonhosted.org/packages/5b/5a/bc7b4a4ef808fa59a816c17b20c4bef6884daebbdf627ff2a161da67da19/propcache-0.4.1-py3-none-any.whl", hash = "sha256:af2a6052aeb6cf17d3e46ee169099044fd8224cbaf75c76a2ef596e8163e2237", size = 13305, upload-time = "2025-10-08T19:49:00.792Z" },
] ]
[[package]]
name = "psutil"
version = "7.2.2"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/aa/c6/d1ddf4abb55e93cebc4f2ed8b5d6dbad109ecb8d63748dd2b20ab5e57ebe/psutil-7.2.2.tar.gz", hash = "sha256:0746f5f8d406af344fd547f1c8daa5f5c33dbc293bb8d6a16d80b4bb88f59372", size = 493740, upload-time = "2026-01-28T18:14:54.428Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/51/08/510cbdb69c25a96f4ae523f733cdc963ae654904e8db864c07585ef99875/psutil-7.2.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:2edccc433cbfa046b980b0df0171cd25bcaeb3a68fe9022db0979e7aa74a826b", size = 130595, upload-time = "2026-01-28T18:14:57.293Z" },
{ url = "https://files.pythonhosted.org/packages/d6/f5/97baea3fe7a5a9af7436301f85490905379b1c6f2dd51fe3ecf24b4c5fbf/psutil-7.2.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:e78c8603dcd9a04c7364f1a3e670cea95d51ee865e4efb3556a3a63adef958ea", size = 131082, upload-time = "2026-01-28T18:14:59.732Z" },
{ url = "https://files.pythonhosted.org/packages/37/d6/246513fbf9fa174af531f28412297dd05241d97a75911ac8febefa1a53c6/psutil-7.2.2-cp313-cp313t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1a571f2330c966c62aeda00dd24620425d4b0cc86881c89861fbc04549e5dc63", size = 181476, upload-time = "2026-01-28T18:15:01.884Z" },
{ url = "https://files.pythonhosted.org/packages/b8/b5/9182c9af3836cca61696dabe4fd1304e17bc56cb62f17439e1154f225dd3/psutil-7.2.2-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:917e891983ca3c1887b4ef36447b1e0873e70c933afc831c6b6da078ba474312", size = 184062, upload-time = "2026-01-28T18:15:04.436Z" },
{ url = "https://files.pythonhosted.org/packages/16/ba/0756dca669f5a9300d0cbcbfae9a4c30e446dfc7440ffe43ded5724bfd93/psutil-7.2.2-cp313-cp313t-win_amd64.whl", hash = "sha256:ab486563df44c17f5173621c7b198955bd6b613fb87c71c161f827d3fb149a9b", size = 139893, upload-time = "2026-01-28T18:15:06.378Z" },
{ url = "https://files.pythonhosted.org/packages/1c/61/8fa0e26f33623b49949346de05ec1ddaad02ed8ba64af45f40a147dbfa97/psutil-7.2.2-cp313-cp313t-win_arm64.whl", hash = "sha256:ae0aefdd8796a7737eccea863f80f81e468a1e4cf14d926bd9b6f5f2d5f90ca9", size = 135589, upload-time = "2026-01-28T18:15:08.03Z" },
{ url = "https://files.pythonhosted.org/packages/81/69/ef179ab5ca24f32acc1dac0c247fd6a13b501fd5534dbae0e05a1c48b66d/psutil-7.2.2-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:eed63d3b4d62449571547b60578c5b2c4bcccc5387148db46e0c2313dad0ee00", size = 130664, upload-time = "2026-01-28T18:15:09.469Z" },
{ url = "https://files.pythonhosted.org/packages/7b/64/665248b557a236d3fa9efc378d60d95ef56dd0a490c2cd37dafc7660d4a9/psutil-7.2.2-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:7b6d09433a10592ce39b13d7be5a54fbac1d1228ed29abc880fb23df7cb694c9", size = 131087, upload-time = "2026-01-28T18:15:11.724Z" },
{ url = "https://files.pythonhosted.org/packages/d5/2e/e6782744700d6759ebce3043dcfa661fb61e2fb752b91cdeae9af12c2178/psutil-7.2.2-cp314-cp314t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1fa4ecf83bcdf6e6c8f4449aff98eefb5d0604bf88cb883d7da3d8d2d909546a", size = 182383, upload-time = "2026-01-28T18:15:13.445Z" },
{ url = "https://files.pythonhosted.org/packages/57/49/0a41cefd10cb7505cdc04dab3eacf24c0c2cb158a998b8c7b1d27ee2c1f5/psutil-7.2.2-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e452c464a02e7dc7822a05d25db4cde564444a67e58539a00f929c51eddda0cf", size = 185210, upload-time = "2026-01-28T18:15:16.002Z" },
{ url = "https://files.pythonhosted.org/packages/dd/2c/ff9bfb544f283ba5f83ba725a3c5fec6d6b10b8f27ac1dc641c473dc390d/psutil-7.2.2-cp314-cp314t-win_amd64.whl", hash = "sha256:c7663d4e37f13e884d13994247449e9f8f574bc4655d509c3b95e9ec9e2b9dc1", size = 141228, upload-time = "2026-01-28T18:15:18.385Z" },
{ url = "https://files.pythonhosted.org/packages/f2/fc/f8d9c31db14fcec13748d373e668bc3bed94d9077dbc17fb0eebc073233c/psutil-7.2.2-cp314-cp314t-win_arm64.whl", hash = "sha256:11fe5a4f613759764e79c65cf11ebdf26e33d6dd34336f8a337aa2996d71c841", size = 136284, upload-time = "2026-01-28T18:15:19.912Z" },
{ url = "https://files.pythonhosted.org/packages/e7/36/5ee6e05c9bd427237b11b3937ad82bb8ad2752d72c6969314590dd0c2f6e/psutil-7.2.2-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:ed0cace939114f62738d808fdcecd4c869222507e266e574799e9c0faa17d486", size = 129090, upload-time = "2026-01-28T18:15:22.168Z" },
{ url = "https://files.pythonhosted.org/packages/80/c4/f5af4c1ca8c1eeb2e92ccca14ce8effdeec651d5ab6053c589b074eda6e1/psutil-7.2.2-cp36-abi3-macosx_11_0_arm64.whl", hash = "sha256:1a7b04c10f32cc88ab39cbf606e117fd74721c831c98a27dc04578deb0c16979", size = 129859, upload-time = "2026-01-28T18:15:23.795Z" },
{ url = "https://files.pythonhosted.org/packages/b5/70/5d8df3b09e25bce090399cf48e452d25c935ab72dad19406c77f4e828045/psutil-7.2.2-cp36-abi3-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:076a2d2f923fd4821644f5ba89f059523da90dc9014e85f8e45a5774ca5bc6f9", size = 155560, upload-time = "2026-01-28T18:15:25.976Z" },
{ url = "https://files.pythonhosted.org/packages/63/65/37648c0c158dc222aba51c089eb3bdfa238e621674dc42d48706e639204f/psutil-7.2.2-cp36-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b0726cecd84f9474419d67252add4ac0cd9811b04d61123054b9fb6f57df6e9e", size = 156997, upload-time = "2026-01-28T18:15:27.794Z" },
{ url = "https://files.pythonhosted.org/packages/8e/13/125093eadae863ce03c6ffdbae9929430d116a246ef69866dad94da3bfbc/psutil-7.2.2-cp36-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:fd04ef36b4a6d599bbdb225dd1d3f51e00105f6d48a28f006da7f9822f2606d8", size = 148972, upload-time = "2026-01-28T18:15:29.342Z" },
{ url = "https://files.pythonhosted.org/packages/04/78/0acd37ca84ce3ddffaa92ef0f571e073faa6d8ff1f0559ab1272188ea2be/psutil-7.2.2-cp36-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:b58fabe35e80b264a4e3bb23e6b96f9e45a3df7fb7eed419ac0e5947c61e47cc", size = 148266, upload-time = "2026-01-28T18:15:31.597Z" },
{ url = "https://files.pythonhosted.org/packages/b4/90/e2159492b5426be0c1fef7acba807a03511f97c5f86b3caeda6ad92351a7/psutil-7.2.2-cp37-abi3-win_amd64.whl", hash = "sha256:eb7e81434c8d223ec4a219b5fc1c47d0417b12be7ea866e24fb5ad6e84b3d988", size = 137737, upload-time = "2026-01-28T18:15:33.849Z" },
{ url = "https://files.pythonhosted.org/packages/8c/c7/7bb2e321574b10df20cbde462a94e2b71d05f9bbda251ef27d104668306a/psutil-7.2.2-cp37-abi3-win_arm64.whl", hash = "sha256:8c233660f575a5a89e6d4cb65d9f938126312bca76d8fe087b947b3a1aaac9ee", size = 134617, upload-time = "2026-01-28T18:15:36.514Z" },
]
[[package]]
name = "ptyprocess"
version = "0.7.0"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/20/e5/16ff212c1e452235a90aeb09066144d0c5a6a8c0834397e03f5224495c4e/ptyprocess-0.7.0.tar.gz", hash = "sha256:5c5d0a3b48ceee0b48485e0c26037c0acd7d29765ca3fbb5cb3831d347423220", size = 70762, upload-time = "2020-12-28T15:15:30.155Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/22/a6/858897256d0deac81a172289110f31629fc4cee19b6f01283303e18c8db3/ptyprocess-0.7.0-py2.py3-none-any.whl", hash = "sha256:4b41f3967fce3af57cc7e94b888626c18bf37a083e3651ca8feeb66d492fef35", size = 13993, upload-time = "2020-12-28T15:15:28.35Z" },
]
[[package]]
name = "py-cid"
version = "0.4.0"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "morphys" },
{ name = "py-multibase" },
{ name = "py-multicodec" },
{ name = "py-multihash" },
]
sdist = { url = "https://files.pythonhosted.org/packages/e7/09/c0ca25eac91c62f6f22f5ac6accd0bfa957e77adfdffd0eccc0700f2ea07/py_cid-0.4.0.tar.gz", hash = "sha256:7c15d6a83f59c3a4c7fbff793f1d4cbfc831e90355fd0e2c5cfe927c21733cc3", size = 25970, upload-time = "2025-12-19T16:55:01.057Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/80/39/d5c1828e79526002f1bf87b9daba01c7db445960daf341e1dd84a5ff0469/py_cid-0.4.0-py3-none-any.whl", hash = "sha256:6a3183a3088b219dbf3cb37eec7d47a644be3f3ebabdf38347c2e9312621d6cc", size = 8833, upload-time = "2025-12-19T16:54:59.233Z" },
]
[[package]]
name = "py-multibase"
version = "2.0.0"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "morphys" },
{ name = "python-baseconv" },
{ name = "six" },
]
sdist = { url = "https://files.pythonhosted.org/packages/bc/52/5ed393ab49df7e3b03995d3c4e53bae1e8c2ca40909cf25a41b346c09a38/py_multibase-2.0.0.tar.gz", hash = "sha256:58c1a264195fa1ae29ea707c6fc8196446f4bdb92e0f9a0f131e0f280b238839", size = 26857, upload-time = "2025-12-18T02:24:49.132Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/36/c7/38035079d9978b32b962f996f1cccaa166ecfe38723ab4349ab32166c037/py_multibase-2.0.0-py3-none-any.whl", hash = "sha256:b29ce489b556134e73998a11712c406b70950812955df64084754e0774e40900", size = 10608, upload-time = "2025-12-18T02:24:47.827Z" },
]
[[package]]
name = "py-multicodec"
version = "1.0.0"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "varint" },
]
sdist = { url = "https://files.pythonhosted.org/packages/5e/26/ef24db0fbfec080b72c5ac4a1000da3a4d696a1e31862c695d683097a1b5/py_multicodec-1.0.0.tar.gz", hash = "sha256:78e4e3e47b6288cf635c3ca987152e6cb5510bdcdab307e7690c76ec3d5bbfeb", size = 44668, upload-time = "2025-12-18T20:41:37.976Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/76/da/768d07490faeae88ac361184164be9c262fececc3c6241b5fc471be4f659/py_multicodec-1.0.0-py3-none-any.whl", hash = "sha256:ae2e687bac8fdf54e3f5b3feded36b61a304d5e3c3af9438f7481f543ec15b8d", size = 26200, upload-time = "2025-12-18T20:41:37.055Z" },
]
[[package]]
name = "py-multihash"
version = "3.0.0"
source = { registry = "https://pypi.org/simple" }
dependencies = [
{ name = "base58" },
{ name = "blake3" },
{ name = "mmh3" },
{ name = "morphys" },
{ name = "six" },
{ name = "varint" },
]
sdist = { url = "https://files.pythonhosted.org/packages/11/3d/ed68b0eccd0654f7f3c163d9b3d428f903e5e3e884ab1f0d0a16ba6a4f11/py_multihash-3.0.0.tar.gz", hash = "sha256:2e848941de5ef0533ca26b81940e2ffcf7b4322a3f803e8c97f4f0eca8767aa7", size = 41630, upload-time = "2025-12-17T19:30:00.596Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/24/e2/d65606db8369916fb5a9b4fe14df7e6072970d919300f3fb1c989a1d8e7d/py_multihash-3.0.0-py3-none-any.whl", hash = "sha256:3863ec1313b4eac1e5169137c143d40bf77456e57388f839441deba089f87326", size = 21215, upload-time = "2025-12-17T19:29:59.322Z" },
]
[[package]] [[package]]
name = "pyarrow" name = "pyarrow"
version = "22.0.0" version = "22.0.0"
@ -1802,10 +1485,9 @@ wheels = [
[[package]] [[package]]
name = "pyqtgraph" name = "pyqtgraph"
version = "0.15.0.dev0" version = "0.12.3"
source = { git = "https://github.com/pyqtgraph/pyqtgraph.git?branch=master#d588dd3ec30915e61c8496a0fe1db21fc25e4da5" } source = { git = "https://github.com/pikers/pyqtgraph.git#373f9561ea8ec4fef9b4e8bdcdd4bbf372dd6512" }
dependencies = [ dependencies = [
{ name = "colorama" },
{ name = "numpy" }, { name = "numpy" },
] ]
@ -1834,12 +1516,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/3b/ab/b3226f0bd7cdcf710fbede2b3548584366da3b19b5021e74f5bde2a8fa3f/pytest-9.0.2-py3-none-any.whl", hash = "sha256:711ffd45bf766d5264d487b917733b453d917afd2b0ad65223959f59089f875b", size = 374801, upload-time = "2025-12-06T21:30:49.154Z" }, { url = "https://files.pythonhosted.org/packages/3b/ab/b3226f0bd7cdcf710fbede2b3548584366da3b19b5021e74f5bde2a8fa3f/pytest-9.0.2-py3-none-any.whl", hash = "sha256:711ffd45bf766d5264d487b917733b453d917afd2b0ad65223959f59089f875b", size = 374801, upload-time = "2025-12-06T21:30:49.154Z" },
] ]
[[package]]
name = "python-baseconv"
version = "1.2.2"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/33/d0/9297d7d8dd74767b4d5560d834b30b2fff17d39987c23ed8656f476e0d9b/python-baseconv-1.2.2.tar.gz", hash = "sha256:0539f8bd0464013b05ad62e0a1673f0ac9086c76b43ebf9f833053527cd9931b", size = 4929, upload-time = "2019-04-04T19:28:57.17Z" }
[[package]] [[package]]
name = "python-dateutil" name = "python-dateutil"
version = "2.9.0.post0" version = "2.9.0.post0"
@ -2167,13 +1843,12 @@ source = { git = "https://github.com/pikers/tomlkit.git?branch=piker_pin#8e0239a
[[package]] [[package]]
name = "tractor" name = "tractor"
version = "0.1.0a6.dev0" version = "0.1.0a6.dev0"
source = { editable = "../tractor" } source = { git = "https://github.com/goodboy/tractor.git?branch=piker_pin#e232d9dd06f41b8dca997f0647f2083d27cc34f2" }
dependencies = [ dependencies = [
{ name = "bidict" }, { name = "bidict" },
{ name = "cffi" }, { name = "cffi" },
{ name = "colorlog" }, { name = "colorlog" },
{ name = "msgspec" }, { name = "msgspec" },
{ name = "multiaddr" },
{ name = "pdbp" }, { name = "pdbp" },
{ name = "platformdirs" }, { name = "platformdirs" },
{ name = "tricycle" }, { name = "tricycle" },
@ -2181,49 +1856,6 @@ dependencies = [
{ name = "wrapt" }, { name = "wrapt" },
] ]
[package.metadata]
requires-dist = [
{ name = "bidict", specifier = ">=0.23.1" },
{ name = "cffi", specifier = ">=1.17.1" },
{ name = "colorlog", specifier = ">=6.8.2,<7" },
{ name = "msgspec", specifier = ">=0.19.0" },
{ name = "multiaddr", specifier = ">=0.1.1" },
{ name = "pdbp", specifier = ">=1.8.2,<2" },
{ name = "platformdirs", specifier = ">=4.4.0" },
{ name = "tricycle", specifier = ">=0.4.1,<0.5" },
{ name = "trio", specifier = ">0.27" },
{ name = "wrapt", specifier = ">=1.16.0,<2" },
]
[package.metadata.requires-dev]
dev = [
{ name = "greenback", specifier = ">=1.2.1,<2" },
{ name = "pexpect", specifier = ">=4.9.0,<5" },
{ name = "prompt-toolkit", specifier = ">=3.0.50" },
{ name = "psutil", specifier = ">=7.0.0" },
{ name = "pyperclip", specifier = ">=1.9.0" },
{ name = "pytest", specifier = ">=8.3.5" },
{ name = "stackscope", specifier = ">=0.2.2,<0.3" },
{ name = "typing-extensions", specifier = ">=4.14.1" },
{ name = "xonsh", specifier = ">=0.22.1" },
]
devx = [
{ name = "greenback", specifier = ">=1.2.1,<2" },
{ name = "stackscope", specifier = ">=0.2.2,<0.3" },
{ name = "typing-extensions", specifier = ">=4.14.1" },
]
lint = [{ name = "ruff", specifier = ">=0.9.6" }]
repl = [
{ name = "prompt-toolkit", specifier = ">=3.0.50" },
{ name = "psutil", specifier = ">=7.0.0" },
{ name = "pyperclip", specifier = ">=1.9.0" },
{ name = "xonsh", specifier = ">=0.22.1" },
]
testing = [
{ name = "pexpect", specifier = ">=4.9.0,<5" },
{ name = "pytest", specifier = ">=8.3.5" },
]
[[package]] [[package]]
name = "tricycle" name = "tricycle"
version = "0.4.1" version = "0.4.1"
@ -2371,12 +2003,6 @@ wheels = [
{ url = "https://files.pythonhosted.org/packages/e4/16/c1fd27e9549f3c4baf1dc9c20c456cd2f822dbf8de9f463824b0c0357e06/uvloop-0.22.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6cde23eeda1a25c75b2e07d39970f3374105d5eafbaab2a4482be82f272d5a5e", size = 4296730, upload-time = "2025-10-16T22:17:00.744Z" }, { url = "https://files.pythonhosted.org/packages/e4/16/c1fd27e9549f3c4baf1dc9c20c456cd2f822dbf8de9f463824b0c0357e06/uvloop-0.22.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6cde23eeda1a25c75b2e07d39970f3374105d5eafbaab2a4482be82f272d5a5e", size = 4296730, upload-time = "2025-10-16T22:17:00.744Z" },
] ]
[[package]]
name = "varint"
version = "1.0.2"
source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/a8/fe/1ea0ba0896dfa47186692655b86db3214c4b7c9e0e76c7b1dc257d101ab1/varint-1.0.2.tar.gz", hash = "sha256:a6ecc02377ac5ee9d65a6a8ad45c9ff1dac8ccee19400a5950fb51d594214ca5", size = 1886, upload-time = "2016-02-24T20:42:38.5Z" }
[[package]] [[package]]
name = "wcwidth" name = "wcwidth"
version = "0.2.14" version = "0.2.14"
@ -2469,8 +2095,14 @@ wheels = [
[[package]] [[package]]
name = "xonsh" name = "xonsh"
version = "0.22.1" version = "0.20.0"
source = { git = "https://github.com/xonsh/xonsh.git?branch=main#336658ff0919f8d7bb96d581136d37d470a8fe99" } source = { registry = "https://pypi.org/simple" }
sdist = { url = "https://files.pythonhosted.org/packages/56/af/7e2ba3885da44cbe03c7ff46f90ea917ba10d91dc74d68604001ea28055f/xonsh-0.20.0.tar.gz", hash = "sha256:d44a50ee9f288ff96bd0456f0a38988ef6d4985637140ea793beeef5ec5d2d38", size = 811907, upload-time = "2025-11-24T07:50:50.847Z" }
wheels = [
{ url = "https://files.pythonhosted.org/packages/e8/db/1c5c057c0b2a89b8919477726558685720ae0849ea1a98a3803e93550824/xonsh-0.20.0-py311-none-any.whl", hash = "sha256:65d27ba31d558f79010d6c652751449fd3ed4df1f1eda78040a6427fa0a0f03e", size = 646312, upload-time = "2025-11-24T07:50:49.488Z" },
{ url = "https://files.pythonhosted.org/packages/d2/a2/d6f7534f31489a4b8b54bd2a2496248f86f7c21a6a6ce9bfdcdd389fe4e7/xonsh-0.20.0-py312-none-any.whl", hash = "sha256:3148900e67b9c2796bef6f2eda003b0a64d4c6f50a0db23324f786d9e1af9353", size = 646323, upload-time = "2025-11-24T07:50:43.028Z" },
{ url = "https://files.pythonhosted.org/packages/bd/48/bcb1e4d329c3d522bc29b066b0b6ee86938ec392376a29c36fac0ad1c586/xonsh-0.20.0-py313-none-any.whl", hash = "sha256:c83daaf6eb2960180fc5a507459dbdf6c0d6d63e1733c43f4e43db77255c7278", size = 646830, upload-time = "2025-11-24T07:50:45.078Z" },
]
[[package]] [[package]]
name = "yapic-json" name = "yapic-json"