Better doc-strings n styling in `piker.cli` eps

Add comprehensive docstrings to the top-level CLI endpoints and helpers,
explaining the purpose and structure of each (sub)command.

Deats,
- add detailed docstring to `pikerd()` explaining its role as the
  root service-actor/daemon supervisor.
- add docstring to `cli()` noting it's the root endpoint generally
  requiring a sub-cmd input.
- add extensive docstring to `services()` explaining the daemon naming
  conventions and listing a few current/common service actors.
- add docstring to `_load_clis()` explaining dynamic CLI loading.

Stylin,
- add multiline style to `and not maddrs` conditional in
  `load_trans_eps()`.
- drop commented-out `--tsdb` and `--es` click options from
  `pikerd()`, they're more or less obsolete given `nativedb`.
- add type annots where obviously handy.
- add TODO comment about UDS support in `services()`.

(this commit msg was generated in some part by [`claude-code`][claude-code-gh])
[claude-code-gh]: https://github.com/anthropics/claude-code

piker/brokers/ib/_util.py

@@ -250,9 +250,7 @@ async def vnc_click_hack(
         'connection': 'r'
     }[reset_type]
 
-    with tractor.devx.open_crash_handler(
+    with tractor.devx.open_crash_handler():
-        ignore={TimeoutError,},
-    ):
         client = await AsyncVNCClient.connect(
             VNCConfig(
                 host=host,
@@ -333,14 +331,7 @@ def i3ipc_xdotool_manual_click_hack() -> None:
 
     '''
     focussed, matches = i3ipc_fin_wins_titled()
-    try:
     orig_win_id = focussed.window
-    except AttributeError:
-        # XXX if .window cucks we prolly aren't intending to
-        # use this and/or just woke up from suspend..
-        log.exception('xdotool invalid usage ya ??\n')
-        return
-
     try:
         for name, con in matches:
             print(f'Resetting data feed for {name}')

piker/brokers/ib/api.py

@@ -1187,7 +1187,7 @@ async def load_aio_clients(
     # the API TCP in `ib_insync` connection can be flaky af so instead
     # retry a few times to get the client going..
     connect_retries: int = 3,
-    connect_timeout: float = 30,  # in case a remote-host
+    connect_timeout: float = 10,
     disconnect_on_exit: bool = True,
 
 ) -> dict[str, Client]:

piker/brokers/ib/feed.py

@@ -178,8 +178,8 @@ async def open_history_client(
 
         async def get_hist(
             timeframe: float,
-            end_dt: datetime|None = None,
+            end_dt: datetime | None = None,
-            start_dt: datetime|None = None,
+            start_dt: datetime | None = None,
 
         ) -> tuple[np.ndarray, str]:
 
@@ -262,38 +262,7 @@ async def open_history_client(
             vlm = bars_array['volume']
             vlm[vlm < 0] = 0
 
-            # XXX, if a start-limit was passed ensure we only
+            return bars_array, first_dt, last_dt
-            # return history that far back!
-            if (
-                start_dt
-                and
-                first_dt < start_dt
-            ):
-                trimmed_bars = bars_array[
-                    bars_array['time'] >= start_dt.timestamp()
-                ]
-                if (
-                    trimmed_first_dt := from_timestamp(trimmed_bars['time'][0])
-                    !=
-                    start_dt
-                ):
-                    # TODO! rm this once we're more confident it never hits!
-                    breakpoint()
-                    raise RuntimeError(
-                        f'OHLC-bars array start is gt `start_dt` limit !!\n'
-                        f'start_dt: {start_dt}\n'
-                        f'first_dt: {first_dt}\n'
-                        f'trimmed_first_dt: {trimmed_first_dt}\n'
-                    )
-
-                # XXX, overwrite with start_dt-limited frame
-                bars_array = trimmed_bars
-
-            return (
-                bars_array,
-                first_dt,
-                last_dt,
-            )
 
         # TODO: it seems like we can do async queries for ohlc
         # but getting the order right still isn't working and I'm not
@@ -428,7 +397,7 @@ async def get_bars(
 
     # blank to start which tells ib to look up the latest datum
     end_dt: str = '',
-    start_dt: str|None = '',
+    start_dt: str | None = '',
 
     # TODO: make this more dynamic based on measured frame rx latency?
     # how long before we trigger a feed reset (seconds)
@@ -482,8 +451,6 @@ async def get_bars(
                     dt_duration,
                 ) = await proxy.bars(
                     fqme=fqme,
-                    # XXX TODO! lol we're not using this..
-                    # start_dt=start_dt,
                     end_dt=end_dt,
                     sample_period_s=timeframe,
 
@@ -1115,7 +1082,6 @@ async def stream_quotes(
 
         con: Contract = details.contract
         first_ticker: Ticker|None = None
-        first_quote: dict[str, Any] = {}
 
         timeout: float = 1.6
         with trio.move_on_after(timeout) as quote_cs:
@@ -1168,14 +1134,15 @@ async def stream_quotes(
                 first_quote,
             ))
 
+            # it's not really live but this will unblock
+            # the brokerd feed task to tell the ui to update?
+            feed_is_live.set()
+
             # block and let data history backfill code run.
             # XXX obvi given the venue is closed, we never expect feed
             # to come up; a taskc should be the only way to
             # terminate this task.
             await trio.sleep_forever()
-            #
-            # ^^XXX^^TODO! INSTEAD impl a `trio.sleep()` for the
-            # duration until the venue opens!!
 
         # ?TODO, we could instead spawn a task that waits on a feed
         # to start and let it wait indefinitely..instead of this
@@ -1199,9 +1166,6 @@ async def stream_quotes(
             'Rxed init quote:\n'
             f'{pformat(first_quote)}'
         )
-        # signal `.data.feed` layer that mkt quotes are LIVE
-        feed_is_live.set()
-
         cs: trio.CancelScope|None = None
         startup: bool = True
         iter_quotes: trio.abc.Channel
@@ -1249,12 +1213,55 @@ async def stream_quotes(
                     tn.start_soon(reset_on_feed)
 
                     async with aclosing(iter_quotes):
+                        # if syminfo.get('no_vlm', False):
+                        if not init_msg.shm_write_opts['has_vlm']:
+
+                            # generally speaking these feeds don't
+                            # include vlm data.
+                            atype: str = mkt.dst.atype
+                            log.info(
+                                f'No-vlm {mkt.fqme}@{atype}, skipping quote poll'
+                            )
+
+                        else:
+                            # wait for real volume on feed (trading might be
+                            # closed)
+                            while True:
+                                ticker = await iter_quotes.receive()
+
+                                # for a real volume contract we rait for
+                                # the first "real" trade to take place
+                                if (
+                                    # not calc_price
+                                    # and not ticker.rtTime
+                                    False
+                                    # not ticker.rtTime
+                                ):
+                                    # spin consuming tickers until we
+                                    # get a real market datum
+                                    log.debug(f"New unsent ticker: {ticker}")
+                                    continue
+
+                                else:
+                                    log.debug("Received first volume tick")
+                                    # ugh, clear ticks since we've
+                                    # consumed them (ahem, ib_insync is
+                                    # truly stateful trash)
+                                    # ticker.ticks = []
+
+                                    # XXX: this works because we don't use
+                                    # ``aclosing()`` above?
+                                    break
+
+                            quote = normalize(ticker)
+                            log.debug(f"First ticker received {quote}")
+
                         # tell data-layer spawner-caller that live
                         # quotes are now active desptie not having
                         # necessarily received a first vlm/clearing
                         # tick.
                         ticker = await iter_quotes.receive()
-                        quote = normalize(ticker)
+                        feed_is_live.set()
                         fqme: str = quote['fqme']
                         await send_chan.send({fqme: quote})
 

piker/cli/__init__.py

@@ -61,7 +61,8 @@ def load_trans_eps(
 
     if (
         network
-        and not maddrs
+        and
+        not maddrs
     ):
         # load network section and (attempt to) connect all endpoints
         # which are reachable B)
@@ -112,26 +113,19 @@ def load_trans_eps(
     default=None,
     help='Multiaddrs to bind or contact',
 )
-# @click.option(
-#     '--tsdb',
-#     is_flag=True,
-#     help='Enable local ``marketstore`` instance'
-# )
-# @click.option(
-#     '--es',
-#     is_flag=True,
-#     help='Enable local ``elasticsearch`` instance'
-# )
 def pikerd(
     maddr: list[str] | None,
     loglevel: str,
     tl: bool,
     pdb: bool,
-    # tsdb: bool,
-    # es: bool,
 ):
     '''
-    Spawn the piker broker-daemon.
+    Start the "root service actor", `pikerd`, run it until
+    cancellation.
+
+    This "root daemon" operates as the top most service-mngr and
+    subsys-as-subactor supervisor, think of it as the "init proc" of
+    any of any `piker` application or daemon-process tree.
 
     '''
     # from tractor.devx import maybe_open_crash_handler
@@ -237,6 +231,14 @@ def cli(
     regaddr: str,
 
 ) -> None:
+    '''
+    The "root" `piker`-cmd CLI endpoint.
+
+    NOTE, this def generally relies on and requires a sub-cmd to be
+    provided by the user, OW only a `--help` msg (listing said
+    subcmds) will be dumped to console.
+
+    '''
     if configdir is not None:
         assert os.path.isdir(configdir), f"`{configdir}` is not a valid path"
         config._override_config_dir(configdir)
@@ -295,17 +297,50 @@ def cli(
 @click.option('--tl', is_flag=True, help='Enable tractor logging')
 @click.argument('ports', nargs=-1, required=False)
 @click.pass_obj
-def services(config, tl, ports):
+def services(
+    config,
+    tl: bool,
+    ports: list[int],
+):
+    '''
+    List all `piker` "service deamons" to the console in
+    a `json`-table which maps each actor's UID in the form,
 
-    from ..service import (
+    `{service_name}.{subservice_name}.{UUID}`
+
+    to its (primary) IPC server address.
+
+    (^TODO, should be its multiaddr form once we support it)
+
+    Note that by convention actors which operate as "headless"
+    processes (those without GUIs/graphics, and which generally
+    parent some noteworthy subsystem) are normally suffixed by
+    a "d" such as,
+
+    - pikerd: the root runtime supervisor
+    - brokerd: a broker-backend order ctl daemon
+    - emsd: the internal dark-clearing and order routing daemon
+    - datad: a data-provider-backend data feed daemon
+    - samplerd: the real-time data sampling and clock-syncing daemon
+
+    "Headed units" are normally just given an obvious app-like name
+    with subactors indexed by `.` such as,
+    - chart: the primary modal charting iface, a Qt app
+    - chart.fsp_0: a financial-sig-proc cascade instance which
+                   delivers graphics to a parent `chart` app.
+    - polars_boi: some (presumably) `polars` using console app.
+
+    '''
+    from piker.service import (
         open_piker_runtime,
         _default_registry_port,
         _default_registry_host,
     )
 
-    host = _default_registry_host
+    # !TODO, mk this to work with UDS!
+    host: str = _default_registry_host
     if not ports:
-        ports = [_default_registry_port]
+        ports: list[int] = [_default_registry_port]
 
     addr = tractor._addr.wrap_address(
         addr=(host, ports[0])
@@ -336,7 +371,15 @@ def services(config, tl, ports):
 
 
 def _load_clis() -> None:
-    # from ..service import elastic  # noqa
+    '''
+    Dynamically load and register all subsys CLI endpoints (at call
+    time).
+
+    NOTE, obviously this is normally expected to be called at
+    `import` time and implicitly relies on our use of various
+    `click`/`typer` decorator APIs.
+
+    '''
     from ..brokers import cli  # noqa
     from ..ui import cli  # noqa
     from ..watchlists import cli  # noqa
@@ -346,5 +389,5 @@ def _load_clis() -> None:
     from ..accounting import cli  # noqa
 
 
-# load downstream cli modules
+# load all subsytem cli eps
 _load_clis()

piker/data/_sampling.py

@@ -80,20 +80,20 @@ class Sampler:
     This non-instantiated type is meant to be a singleton within
     a `samplerd` actor-service spawned once by the user wishing to
     time-step-sample (real-time) quote feeds, see
-    `.service.maybe_open_samplerd()` and the below
+    ``.service.maybe_open_samplerd()`` and the below
-    `register_with_sampler()`.
+    ``register_with_sampler()``.
 
     '''
-    service_nursery: None|trio.Nursery = None
+    service_nursery: None | trio.Nursery = None
 
-    # TODO: we could stick these in a composed type to avoid angering
+    # TODO: we could stick these in a composed type to avoid
-    # the "i hate module scoped variables crowd" (yawn).
+    # angering the "i hate module scoped variables crowd" (yawn).
     ohlcv_shms: dict[float, list[ShmArray]] = {}
 
     # holds one-task-per-sample-period tasks which are spawned as-needed by
     # data feed requests with a given detected time step usually from
     # history loading.
-    incr_task_cs: trio.CancelScope|None = None
+    incr_task_cs: trio.CancelScope | None = None
 
     bcast_errors: tuple[Exception] = (
         trio.BrokenResourceError,
@@ -249,8 +249,8 @@ class Sampler:
     async def broadcast(
         self,
         period_s: float,
-        time_stamp: float|None = None,
+        time_stamp: float | None = None,
-        info: dict|None = None,
+        info: dict | None = None,
 
     ) -> None:
         '''
@@ -292,9 +292,10 @@ class Sampler:
 
                     except self.bcast_errors as err:
                         log.error(
-                            f'Connection dropped for IPC ctx\n'
+                            f'Connection dropped for IPC ctx due to,\n'
-                            f'{stream._ctx}\n\n'
+                            f'{type(err)!r}\n'
-                            f'Due to {type(err)}'
+                            f'\n'
+                            f'{stream._ctx}'
                         )
                         borked.add(stream)
                 else:
@@ -314,7 +315,7 @@ class Sampler:
     @classmethod
     async def broadcast_all(
         self,
-        info: dict|None = None,
+        info: dict | None = None,
     ) -> None:
 
         # NOTE: take a copy of subs since removals can happen
@@ -331,12 +332,12 @@ class Sampler:
 async def register_with_sampler(
     ctx: Context,
     period_s: float,
-    shms_by_period: dict[float, dict]|None = None,
+    shms_by_period: dict[float, dict] | None = None,
 
     open_index_stream: bool = True,  # open a 2way stream for sample step msgs?
     sub_for_broadcasts: bool = True,  # sampler side to send step updates?
 
-) -> set[int]:
+) -> None:
 
     get_console_log(tractor.current_actor().loglevel)
     incr_was_started: bool = False
@@ -363,12 +364,7 @@ async def register_with_sampler(
 
             # insert the base 1s period (for OHLC style sampling) into
             # the increment buffer set to update and shift every second.
-            if (
+            if shms_by_period is not None:
-                shms_by_period is not None
-                # and
-                # feed_is_live.is_set()
-                # ^TODO? pass it in instead?
-            ):
                 from ._sharedmem import (
                     attach_shm_array,
                     _Token,
@@ -382,17 +378,12 @@ async def register_with_sampler(
                         readonly=False,
                     )
                     shms_by_period[period] = shm
-                    Sampler.ohlcv_shms.setdefault(
+                    Sampler.ohlcv_shms.setdefault(period, []).append(shm)
-                        period,
-                        [],
-                    ).append(shm)
 
                 assert Sampler.ohlcv_shms
 
             # unblock caller
-            await ctx.started(
+            await ctx.started(set(Sampler.ohlcv_shms.keys()))
-                set(Sampler.ohlcv_shms.keys())
-            )
 
             if open_index_stream:
                 try:
@@ -438,7 +429,7 @@ async def register_with_sampler(
 
 async def spawn_samplerd(
 
-    loglevel: str|None = None,
+    loglevel: str | None = None,
     **extra_tractor_kwargs
 
 ) -> bool:
@@ -484,7 +475,7 @@ async def spawn_samplerd(
 @acm
 async def maybe_open_samplerd(
 
-    loglevel: str|None = None,
+    loglevel: str | None = None,
     **pikerd_kwargs,
 
 ) -> tractor.Portal:  # noqa
@@ -509,11 +500,11 @@ async def maybe_open_samplerd(
 @acm
 async def open_sample_stream(
     period_s: float,
-    shms_by_period: dict[float, dict]|None = None,
+    shms_by_period: dict[float, dict] | None = None,
     open_index_stream: bool = True,
     sub_for_broadcasts: bool = True,
 
-    cache_key: str|None = None,
+    cache_key: str | None = None,
     allow_new_sampler: bool = True,
 
     ensure_is_active: bool = False,
@@ -544,8 +535,6 @@ async def open_sample_stream(
     #         yield bistream
     # else:
 
-    ctx: tractor.Context
-    shm_periods: set[int]  # in `int`-seconds
     async with (
         # XXX: this should be singleton on a host,
         # a lone broker-daemon per provider should be
@@ -560,10 +549,10 @@ async def open_sample_stream(
                 'open_index_stream': open_index_stream,
                 'sub_for_broadcasts': sub_for_broadcasts,
             },
-        ) as (ctx, shm_periods)
+        ) as (ctx, first)
     ):
         if ensure_is_active:
-            assert len(shm_periods) > 1
+            assert len(first) > 1
 
         async with (
             ctx.open_stream(

piker/data/_sharedmem.py

@@ -520,10 +520,7 @@ def open_shm_array(
 
     # "unlink" created shm on process teardown by
     # pushing teardown calls onto actor context stack
-    stack = tractor.current_actor(
+    stack = tractor.current_actor().lifetime_stack
-        err_on_no_runtime=False,
-    ).lifetime_stack
-    if stack:
     stack.callback(shmarr.close)
     stack.callback(shmarr.destroy)
 
@@ -610,10 +607,7 @@ def attach_shm_array(
         _known_tokens[key] = token
 
     # "close" attached shm on actor teardown
-    if (actor := tractor.current_actor(
+    tractor.current_actor().lifetime_stack.callback(sha.close)
-        err_on_no_runtime=False,
-    )):
-        actor.lifetime_stack.callback(sha.close)
 
     return sha
 

piker/data/_web_bs.py

@@ -31,6 +31,7 @@ from typing import (
     AsyncContextManager,
     AsyncGenerator,
     Iterable,
+    Type,
 )
 import json
 
@@ -67,7 +68,7 @@ class NoBsWs:
 
     '''
     # apparently we can QoS for all sorts of reasons..so catch em.
-    recon_errors = (
+    recon_errors: tuple[Type[Exception]] = (
         ConnectionClosed,
         DisconnectionTimeout,
         ConnectionRejected,
@@ -370,6 +371,7 @@ async def open_autorecon_ws(
     rcv: trio.MemoryReceiveChannel
     snd, rcv = trio.open_memory_channel(616)
 
+    try:
         async with (
             tractor.trionics.collapse_eg(),
             trio.open_nursery() as tn
@@ -397,6 +399,12 @@ async def open_autorecon_ws(
             finally:
                 tn.cancel_scope.cancel()
 
+    except NoBsWs.recon_errors as con_err:
+        log.warning(
+            f'Entire ws-channel disconnect due to,\n'
+            f'con_err: {con_err!r}\n'
+        )
+
 
 '''
 JSONRPC response-request style machinery for transparent multiplexing

piker/storage/__init__.py

@@ -43,6 +43,7 @@ from typing import (
 
 import numpy as np
 
+
 from .. import config
 from ..service import (
     check_for_service,
@@ -151,10 +152,7 @@ class StorageConnectionError(ConnectionError):
 
     '''
 
-def get_storagemod(
+def get_storagemod(name: str) -> ModuleType:
-    name: str,
-
-) -> ModuleType:
     mod: ModuleType = import_module(
         '.' + name,
         'piker.storage',
@@ -167,12 +165,9 @@ def get_storagemod(
 
 @acm
 async def open_storage_client(
-    backend: str|None = None,
+    backend: str | None = None,
 
-) -> tuple[
+) -> tuple[ModuleType, StorageClient]:
-    ModuleType,
-    StorageClient,
-]:
     '''
     Load the ``StorageClient`` for named backend.
 
@@ -272,10 +267,7 @@ async def open_tsdb_client(
     from ..data.feed import maybe_open_feed
 
     async with (
-        open_storage_client() as (
+        open_storage_client() as (_, storage),
-            _,
-            storage,
-        ),
 
         maybe_open_feed(
             [fqme],
@@ -283,7 +275,7 @@ async def open_tsdb_client(
 
         ) as feed,
     ):
-        profiler(f'opened feed for {fqme!r}')
+        profiler(f'opened feed for {fqme}')
 
         # to_append = feed.hist_shm.array
         # to_prepend = None

piker/storage/cli.py

@@ -19,10 +19,16 @@ Storage middle-ware CLIs.
 
 """
 from __future__ import annotations
+# from datetime import datetime
+# from contextlib import (
+#     AsyncExitStack,
+# )
 from pathlib import Path
+from math import copysign
 import time
 from types import ModuleType
 from typing import (
+    Any,
     TYPE_CHECKING,
 )
 
@@ -41,6 +47,7 @@ from piker.data import (
     ShmArray,
 )
 from piker import tsp
+from piker.data._formatters import BGM
 from . import log
 from . import (
     __tsdbs__,
@@ -235,12 +242,122 @@ def anal(
     trio.run(main)
 
 
+async def markup_gaps(
+    fqme: str,
+    timeframe: float,
+    actl: AnnotCtl,
+    wdts: pl.DataFrame,
+    gaps: pl.DataFrame,
+
+) -> dict[int, dict]:
+    '''
+    Remote annotate time-gaps in a dt-fielded ts (normally OHLC)
+    with rectangles.
+
+    '''
+    aids: dict[int] = {}
+    for i in range(gaps.height):
+
+        row: pl.DataFrame = gaps[i]
+
+        # the gap's RIGHT-most bar's OPEN value
+        # at that time (sample) step.
+        iend: int = row['index'][0]
+        # dt: datetime = row['dt'][0]
+        # dt_prev: datetime = row['dt_prev'][0]
+        # dt_end_t: float = dt.timestamp()
+
+
+        # TODO: can we eventually remove this
+        # once we figure out why the epoch cols
+        # don't match?
+        # TODO: FIX HOW/WHY these aren't matching
+        # and are instead off by 4hours (EST
+        # vs. UTC?!?!)
+        # end_t: float = row['time']
+        # assert (
+        #     dt.timestamp()
+        #     ==
+        #     end_t
+        # )
+
+        # the gap's LEFT-most bar's CLOSE value
+        # at that time (sample) step.
+        prev_r: pl.DataFrame = wdts.filter(
+            pl.col('index') == iend - 1
+        )
+        # XXX: probably a gap in the (newly sorted or de-duplicated)
+        # dt-df, so we might need to re-index first..
+        if prev_r.is_empty():
+            await tractor.pause()
+
+        istart: int = prev_r['index'][0]
+        # dt_start_t: float = dt_prev.timestamp()
+
+        # start_t: float = prev_r['time']
+        # assert (
+        #     dt_start_t
+        #     ==
+        #     start_t
+        # )
+
+        # TODO: implement px-col width measure
+        # and ensure at least as many px-cols
+        # shown per rect as configured by user.
+        # gap_w: float = abs((iend - istart))
+        # if gap_w < 6:
+        #     margin: float = 6
+        #     iend += margin
+        #     istart -= margin
+
+        rect_gap: float = BGM*3/8
+        opn: float = row['open'][0]
+        ro: tuple[float, float] = (
+            # dt_end_t,
+            iend + rect_gap + 1,
+            opn,
+        )
+        cls: float = prev_r['close'][0]
+        lc: tuple[float, float] = (
+            # dt_start_t,
+            istart - rect_gap, # + 1 ,
+            cls,
+        )
+
+        color: str = 'dad_blue'
+        diff: float = cls - opn
+        sgn: float = copysign(1, diff)
+        color: str = {
+            -1: 'buy_green',
+            1: 'sell_red',
+        }[sgn]
+
+        rect_kwargs: dict[str, Any] = dict(
+            fqme=fqme,
+            timeframe=timeframe,
+            start_pos=lc,
+            end_pos=ro,
+            color=color,
+        )
+
+        aid: int = await actl.add_rect(**rect_kwargs)
+        assert aid
+        aids[aid] = rect_kwargs
+
+    # tell chart to redraw all its
+    # graphics view layers Bo
+    await actl.redraw(
+        fqme=fqme,
+        timeframe=timeframe,
+    )
+    return aids
+
+
 @store.command()
 def ldshm(
     fqme: str,
     write_parquet: bool = True,
     reload_parquet_to_shm: bool = True,
-    pdb: bool = False,  # --pdb passed?
 
 ) -> None:
     '''
@@ -260,7 +377,7 @@ def ldshm(
             open_piker_runtime(
                 'polars_boi',
                 enable_modules=['piker.data._sharedmem'],
-                debug_mode=pdb,
+                debug_mode=True,
             ),
             open_storage_client() as (
                 mod,
@@ -280,9 +397,6 @@ def ldshm(
 
                 times: np.ndarray = shm.array['time']
                 d1: float = float(times[-1] - times[-2])
-                d2: float = 0
-                # XXX, take a median sample rate if sufficient data
-                if times.size > 2:
                 d2: float = float(times[-2] - times[-3])
                 med: float = np.median(np.diff(times))
                 if (
@@ -293,12 +407,8 @@ def ldshm(
                     raise ValueError(
                         f'Something is wrong with time period for {shm}:\n{times}'
                     )
+
                 period_s: float = float(max(d1, d2, med))
-                log.info(
-                    f'Processing shm buffer:\n'
-                    f'  file: {shmfile.name}\n'
-                    f'  period: {period_s}s\n'
-                )
 
                 null_segs: tuple = tsp.get_null_segs(
                     frame=shm.array,
@@ -307,8 +417,6 @@ def ldshm(
 
                 # TODO: call null-seg fixer somehow?
                 if null_segs:
-
-                    if tractor._state.is_debug_mode():
                     await tractor.pause()
                 #     async with (
                 #         trio.open_nursery() as tn,
@@ -333,35 +441,9 @@ def ldshm(
                     wdts,
                     deduped,
                     diff,
-                    valid_races,
+                ) = tsp.dedupe(
-                    dq_issues,
-                ) = tsp.dedupe_ohlcv_smart(
                     shm_df,
-                )
+                    period=period_s,
-
-                # Report duplicate analysis
-                if diff > 0:
-                    log.info(
-                        f'Removed {diff} duplicate timestamp(s)\n'
-                    )
-                    if valid_races is not None:
-                        identical: int = (
-                            valid_races
-                            .filter(pl.col('identical_bars'))
-                            .height
-                        )
-                        monotonic: int = valid_races.height - identical
-                        log.info(
-                            f'Valid race conditions: {valid_races.height}\n'
-                            f'  - Identical bars: {identical}\n'
-                            f'  - Volume monotonic: {monotonic}\n'
-                        )
-
-                    if dq_issues is not None:
-                        log.warning(
-                            f'DATA QUALITY ISSUES from provider: '
-                            f'{dq_issues.height} timestamp(s)\n'
-                            f'{dq_issues}\n'
                 )
 
                 # detect gaps from in expected (uniform OHLC) sample period
@@ -378,8 +460,7 @@ def ldshm(
 
                     # TODO: actually pull the exact duration
                     # expected for each venue operational period?
-                    # gap_dt_unit='day',
+                    gap_dt_unit='days',
-                    gap_dt_unit='day',
                     gap_thresh=1,
                 )
 
@@ -390,11 +471,8 @@ def ldshm(
                 if (
                     not venue_gaps.is_empty()
                     or (
-                        not step_gaps.is_empty()
+                        period_s < 60
-                        # XXX, i presume i put this bc i was guarding
+                        and not step_gaps.is_empty()
-                        # for ib venue gaps?
-                        # and
-                        # period_s < 60
                     )
                 ):
                     # write repaired ts to parquet-file?
@@ -443,7 +521,7 @@ def ldshm(
                     do_markup_gaps: bool = True
                     if do_markup_gaps:
                         new_df: pl.DataFrame = tsp.np2pl(new)
-                        aids: dict = await tsp._annotate.markup_gaps(
+                        aids: dict = await markup_gaps(
                             fqme,
                             period_s,
                             actl,
@@ -456,13 +534,8 @@ def ldshm(
                         tf2aids[period_s] = aids
 
                 else:
-                    # No significant gaps to handle, but may have had
+                    # allow interaction even when no ts problems.
-                    # duplicates removed (valid race conditions are ok)
+                    assert not diff
-                    if diff > 0 and dq_issues is not None:
-                        log.warning(
-                            'Found duplicates with data quality issues '
-                            'but no significant time gaps!\n'
-                        )
 
             await tractor.pause()
             log.info('Exiting TSP shm anal-izer!')

piker/tsp/_anal.py

@@ -275,18 +275,6 @@ def get_null_segs(
         # diff of abs index steps between each zeroed row
         absi_zdiff: np.ndarray = np.diff(absi_zeros)
 
-        if zero_t.size < 2:
-            try:
-                breakpoint()
-            except RuntimeError:
-                # XXX, if greenback not active from
-                # piker store ldshm cmd..
-                log.exception(
-                    "Can't debug single-sample null!\n"
-                )
-
-            return None
-
         # scan for all frame-indices where the
         # zeroed-row-abs-index-step-diff is greater then the
         # expected increment of 1.
@@ -446,8 +434,8 @@ def get_null_segs(
 
 def iter_null_segs(
     timeframe: float,
-    frame: Frame|None = None,
+    frame: Frame | None = None,
-    null_segs: tuple|None = None,
+    null_segs: tuple | None = None,
 
 ) -> Generator[
     tuple[
@@ -499,8 +487,7 @@ def iter_null_segs(
         start_dt = None
         if (
             absi_start is not None
-            and
+            and start_t != 0
-            start_t != 0
         ):
             fi_start: int = absi_start - absi_first
             start_row: Seq = frame[fi_start]
@@ -514,8 +501,8 @@ def iter_null_segs(
         yield (
             absi_start, absi_end,  # abs indices
             fi_start, fi_end,  # relative "frame" indices
-            start_t, end_t,  # epoch times
+            start_t, end_t,
-            start_dt, end_dt,  # dts
+            start_dt, end_dt,
         )
 
 
@@ -591,22 +578,11 @@ def detect_time_gaps(
     # NOTE: this flag is to indicate that on this (sampling) time
     # scale we expect to only be filtering against larger venue
     # closures-scale time gaps.
-    #
-    # Map to total_ method since `dt_diff` is a duration type,
-    # not datetime - modern polars requires `total_*` methods
-    # for duration types (e.g. `total_days()` not `day()`)
-    # Ensure plural form for polars API (e.g. 'day' -> 'days')
-    unit_plural: str = (
-        gap_dt_unit
-        if gap_dt_unit.endswith('s')
-        else f'{gap_dt_unit}s'
-    )
-    duration_method: str = f'total_{unit_plural}'
     return step_gaps.filter(
         # Second by an arbitrary dt-unit step size
         getattr(
             pl.col('dt_diff').dt,
-            duration_method,
+            gap_dt_unit,
         )().abs() > gap_thresh
     )
 

piker/tsp/_annotate.py

@@ -1,347 +0,0 @@
-# piker: trading gear for hackers
-# Copyright (C) 2018-present  Tyler Goodlet (in stewardship of pikers)
-
-# This program is free software: you can redistribute it and/or modify
-# it under the terms of the GNU Affero General Public License as published by
-# the Free Software Foundation, either version 3 of the License, or
-# (at your option) any later version.
-
-# This program is distributed in the hope that it will be useful,
-# but WITHOUT ANY WARRANTY; without even the implied warranty of
-# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
-# GNU Affero General Public License for more details.
-
-# You should have received a copy of the GNU Affero General Public License
-# along with this program.  If not, see <https://www.gnu.org/licenses/>.
-
-"""
-Time-series (remote) annotation APIs.
-
-"""
-from __future__ import annotations
-from math import copysign
-from typing import (
-    Any,
-    TYPE_CHECKING,
-)
-
-import polars as pl
-import tractor
-
-from piker.data._formatters import BGM
-from piker.storage import log
-from piker.toolz.profile import (
-    Profiler,
-    pg_profile_enabled,
-    ms_slower_then,
-)
-from piker.ui._style import get_fonts
-
-if TYPE_CHECKING:
-    from piker.ui._remote_ctl import AnnotCtl
-
-
-def humanize_duration(
-    seconds: float,
-) -> str:
-    '''
-    Convert duration in seconds to short human-readable form.
-
-    Uses smallest appropriate time unit:
-    - d: days
-    - h: hours
-    - m: minutes
-    - s: seconds
-
-    Examples:
-    - 86400 -> "1d"
-    - 28800 -> "8h"
-    - 180 -> "3m"
-    - 45 -> "45s"
-
-    '''
-    abs_secs: float = abs(seconds)
-
-    if abs_secs >= 86400:
-        days: float = abs_secs / 86400
-        if days >= 10 or days == int(days):
-            return f'{int(days)}d'
-        return f'{days:.1f}d'
-
-    elif abs_secs >= 3600:
-        hours: float = abs_secs / 3600
-        if hours >= 10 or hours == int(hours):
-            return f'{int(hours)}h'
-        return f'{hours:.1f}h'
-
-    elif abs_secs >= 60:
-        mins: float = abs_secs / 60
-        if mins >= 10 or mins == int(mins):
-            return f'{int(mins)}m'
-        return f'{mins:.1f}m'
-
-    else:
-        if abs_secs >= 10 or abs_secs == int(abs_secs):
-            return f'{int(abs_secs)}s'
-        return f'{abs_secs:.1f}s'
-
-
-async def markup_gaps(
-    fqme: str,
-    timeframe: float,
-    actl: AnnotCtl,
-    wdts: pl.DataFrame,
-    gaps: pl.DataFrame,
-
-    # XXX, switch on to see txt showing a "humanized" label of each
-    # gap's duration.
-    show_txt: bool = False,
-
-    # A/B comparison: render individual arrows alongside batch
-    # for visual comparison
-    show_individual_arrows: bool = False,
-
-) -> dict[int, dict]:
-    '''
-    Remote annotate time-gaps in a dt-fielded ts (normally OHLC)
-    with rectangles.
-
-    '''
-    profiler = Profiler(
-        msg=f'markup_gaps() for {gaps.height} gaps',
-        disabled=False,
-        ms_threshold=0.0,
-    )
-
-    # XXX: force chart redraw FIRST to ensure PlotItem coordinate
-    # system is properly initialized before we position annotations!
-    # Without this, annotations may be misaligned on first creation
-    # due to Qt/pyqtgraph initialization race conditions.
-    await actl.redraw(
-        fqme=fqme,
-        timeframe=timeframe,
-    )
-    profiler('first `.redraw()` before annot creation')
-
-    log.info(
-        f'markup_gaps() called:\n'
-        f'  fqme: {fqme}\n'
-        f'  timeframe: {timeframe}s\n'
-        f'  gaps.height: {gaps.height}\n'
-    )
-
-    # collect all annotation specs for batch submission
-    rect_specs: list[dict] = []
-    arrow_specs: list[dict] = []
-    text_specs: list[dict] = []
-
-    aids: dict[int] = {}
-    for i in range(gaps.height):
-        row: pl.DataFrame = gaps[i]
-
-        # the gap's RIGHT-most bar's OPEN value
-        # at that time (sample) step.
-        iend: int = row['index'][0]
-
-        # dt: datetime = row['dt'][0]
-        # dt_prev: datetime = row['dt_prev'][0]
-        # dt_end_t: float = dt.timestamp()
-
-
-        # TODO: can we eventually remove this
-        # once we figure out why the epoch cols
-        # don't match?
-        # TODO: FIX HOW/WHY these aren't matching
-        # and are instead off by 4hours (EST
-        # vs. UTC?!?!)
-        # end_t: float = row['time']
-        # assert (
-        #     dt.timestamp()
-        #     ==
-        #     end_t
-        # )
-
-        # the gap's LEFT-most bar's CLOSE value
-        # at that time (sample) step.
-        prev_r: pl.DataFrame = wdts.filter(
-            pl.col('index') == iend - 1
-        )
-        # XXX: probably a gap in the (newly sorted or de-duplicated)
-        # dt-df, so we might need to re-index first..
-        dt: pl.Series = row['dt']
-        dt_prev: pl.Series = row['dt_prev']
-        if prev_r.is_empty():
-
-            # XXX, filter out any special ignore cases,
-            # - UNIX-epoch stamped datums
-            # - first row
-            if (
-                dt_prev.dt.epoch()[0] == 0
-                or
-                dt.dt.epoch()[0] == 0
-            ):
-                log.warning('Skipping row with UNIX epoch timestamp ??')
-                continue
-
-            if wdts[0]['index'][0] == iend:  # first row
-                log.warning('Skipping first-row (has no previous obvi) !!')
-                continue
-
-            # XXX, if the previous-row by shm-index is missing,
-            # meaning there is a missing sample (set), get the prior
-            # row by df index and attempt to use it?
-            i_wdts: pl.DataFrame = wdts.with_row_index(name='i')
-            i_row: int = i_wdts.filter(pl.col('index') == iend)['i'][0]
-            prev_row_by_i = wdts[i_row]
-            prev_r: pl.DataFrame = prev_row_by_i
-
-            # debug any missing pre-row
-            if tractor._state.is_debug_mode():
-                await tractor.pause()
-
-        istart: int = prev_r['index'][0]
-        # TODO: implement px-col width measure
-        # and ensure at least as many px-cols
-        # shown per rect as configured by user.
-        # gap_w: float = abs((iend - istart))
-        # if gap_w < 6:
-        #     margin: float = 6
-        #     iend += margin
-        #     istart -= margin
-
-        opn: float = row['open'][0]
-        cls: float = prev_r['close'][0]
-
-        # get gap duration for humanized label
-        gap_dur_s: float = row['s_diff'][0]
-        gap_label: str = humanize_duration(gap_dur_s)
-
-        # XXX: get timestamps for server-side index lookup
-        start_time: float = prev_r['time'][0]
-        end_time: float = row['time'][0]
-
-        # BGM=0.16 is the normal diff from overlap between bars, SO
-        # just go slightly "in" from that "between them".
-        from_idx: int = BGM - .06  # = .10
-        lc: tuple[float, float] = (
-            istart + 1 - from_idx,
-            cls,
-        )
-        ro: tuple[float, float] = (
-            iend + from_idx,
-            opn,
-        )
-
-        diff: float = cls - opn
-        sgn: float = copysign(1, diff)
-        up_gap: bool = sgn == -1
-        down_gap: bool = sgn == 1
-        flat: bool = sgn == 0
-
-        color: str = 'dad_blue'
-        # TODO? mks more sense to have up/down coloring?
-        # color: str = {
-        #     -1: 'lilypad_green',  # up-gap
-        #     1: 'wine',  # down-gap
-        # }[sgn]
-
-        # collect rect spec (no fqme/timeframe, added by batch
-        # API)
-        rect_spec: dict[str, Any] = dict(
-            meth='set_view_pos',
-            start_pos=lc,
-            end_pos=ro,
-            color=color,
-            update_label=False,
-            start_time=start_time,
-            end_time=end_time,
-        )
-        rect_specs.append(rect_spec)
-
-        direction: str = (
-            'down' if down_gap
-            else 'up'
-        )
-
-        # collect arrow spec
-        gap_time: float = row['time'][0]
-        arrow_spec: dict[str, Any] = dict(
-            x=iend,  # fallback if timestamp lookup fails
-            y=cls,
-            time=gap_time,  # for server-side index lookup
-            color=color,
-            alpha=169,
-            pointing=direction,
-            headLen=10,
-            headWidth=2.222,
-            pxMode=True,
-        )
-        arrow_specs.append(arrow_spec)
-
-        # add duration label to RHS of arrow
-        if up_gap:
-            anchor = (0, 0)
-            # ^XXX? i dun get dese dims.. XD
-        elif down_gap:
-            anchor = (0, 1)  # XXX y, x?
-        else:  # no-gap?
-            assert flat
-            anchor = (0, 0)  # up from bottom
-
-        # collect text spec if enabled
-        if show_txt:
-            font, small_font = get_fonts()
-            font_size: int = small_font.px_size - 1
-
-            text_spec: dict[str, Any] = dict(
-                text=gap_label,
-                x=iend + 1,  # fallback if timestamp lookup fails
-                y=cls,
-                time=gap_time,  # server-side index lookup
-                color=color,
-                anchor=anchor,
-                font_size=font_size,
-            )
-            text_specs.append(text_spec)
-
-    # submit all annotations in single batch IPC msg
-    log.info(
-        f'Submitting batch annotations:\n'
-        f'  rects: {len(rect_specs)}\n'
-        f'  arrows: {len(arrow_specs)}\n'
-        f'  texts: {len(text_specs)}\n'
-    )
-    profiler('built all annotation specs')
-
-    result: dict[str, list[int]] = await actl.add_batch(
-        fqme=fqme,
-        timeframe=timeframe,
-        rects=rect_specs,
-        arrows=arrow_specs,
-        texts=text_specs,
-        show_individual_arrows=show_individual_arrows,
-    )
-    profiler('batch `.add_batch()` IPC call complete')
-
-    # build aids dict from batch results
-    for aid in result['rects']:
-        aids[aid] = {'type': 'rect'}
-    for aid in result['arrows']:
-        aids[aid] = {'type': 'arrow'}
-    for aid in result['texts']:
-        aids[aid] = {'type': 'text'}
-
-    log.info(
-        f'Batch submission complete: {len(aids)} annotation(s) '
-        f'created'
-    )
-    profiler('built aids result dict')
-
-    # tell chart to redraw all its graphics view layers
-    await actl.redraw(
-        fqme=fqme,
-        timeframe=timeframe,
-    )
-    profiler('final `.redraw()` after annot creation')
-
-    return aids

piker/tsp/_dedupe_smart.py

@@ -1,206 +0,0 @@
-'''
-Smart OHLCV deduplication with data quality validation.
-
-Handles concurrent write conflicts by keeping the most complete bar
-(highest volume) while detecting data quality anomalies.
-
-'''
-import polars as pl
-
-from ._anal import with_dts
-
-
-def dedupe_ohlcv_smart(
-    src_df: pl.DataFrame,
-    time_col: str = 'time',
-    volume_col: str = 'volume',
-    sort: bool = True,
-
-) -> tuple[
-    pl.DataFrame,  # with dts
-    pl.DataFrame,  # deduped (keeping higher volume bars)
-    int,  # count of dupes removed
-    pl.DataFrame|None,  # valid race conditions
-    pl.DataFrame|None,  # data quality violations
-]:
-    '''
-    Smart OHLCV deduplication keeping most complete bars.
-
-    For duplicate timestamps, keeps bar with highest volume under
-    the assumption that higher volume indicates more complete/final
-    data from backfill vs partial live updates.
-
-    Returns
-    -------
-    Tuple of:
-    - wdts: original dataframe with datetime columns added
-    - deduped: deduplicated frame keeping highest-volume bars
-    - diff: number of duplicate rows removed
-    - valid_races: duplicates meeting expected race condition pattern
-      (volume monotonic, OHLC ranges valid)
-    - data_quality_issues: duplicates violating expected relationships
-      indicating provider data problems
-
-    '''
-    wdts: pl.DataFrame = with_dts(src_df)
-
-    # Find duplicate timestamps
-    dupes: pl.DataFrame = wdts.filter(
-        pl.col(time_col).is_duplicated()
-    )
-
-    if dupes.is_empty():
-        # No duplicates, return as-is
-        return (wdts, wdts, 0, None, None)
-
-    # Analyze duplicate groups for validation
-    dupe_analysis: pl.DataFrame = (
-        dupes
-        .sort([time_col, 'index'])
-        .group_by(time_col, maintain_order=True)
-        .agg([
-            pl.col('index').alias('indices'),
-            pl.col('volume').alias('volumes'),
-            pl.col('high').alias('highs'),
-            pl.col('low').alias('lows'),
-            pl.col('open').alias('opens'),
-            pl.col('close').alias('closes'),
-            pl.col('dt').first().alias('dt'),
-            pl.len().alias('count'),
-        ])
-    )
-
-    # Validate OHLCV monotonicity for each duplicate group
-    def check_ohlcv_validity(row) -> dict[str, bool]:
-        '''
-        Check if duplicate bars follow expected race condition pattern.
-
-        For a valid live-update → backfill race:
-        - volume should be monotonically increasing
-        - high should be monotonically non-decreasing
-        - low should be monotonically non-increasing
-        - open should be identical (fixed at bar start)
-
-        Returns dict of violation flags.
-
-        '''
-        vols: list = row['volumes']
-        highs: list = row['highs']
-        lows: list = row['lows']
-        opens: list = row['opens']
-
-        violations: dict[str, bool] = {
-            'volume_non_monotonic': False,
-            'high_decreased': False,
-            'low_increased': False,
-            'open_mismatch': False,
-            'identical_bars': False,
-        }
-
-        # Check if all bars are identical (pure duplicate)
-        if (
-            len(set(vols)) == 1
-            and len(set(highs)) == 1
-            and len(set(lows)) == 1
-            and len(set(opens)) == 1
-        ):
-            violations['identical_bars'] = True
-            return violations
-
-        # Check volume monotonicity
-        for i in range(1, len(vols)):
-            if vols[i] < vols[i-1]:
-                violations['volume_non_monotonic'] = True
-                break
-
-        # Check high monotonicity (can only increase or stay same)
-        for i in range(1, len(highs)):
-            if highs[i] < highs[i-1]:
-                violations['high_decreased'] = True
-                break
-
-        # Check low monotonicity (can only decrease or stay same)
-        for i in range(1, len(lows)):
-            if lows[i] > lows[i-1]:
-                violations['low_increased'] = True
-                break
-
-        # Check open consistency (should be fixed)
-        if len(set(opens)) > 1:
-            violations['open_mismatch'] = True
-
-        return violations
-
-    # Apply validation
-    dupe_analysis = dupe_analysis.with_columns([
-        pl.struct(['volumes', 'highs', 'lows', 'opens'])
-        .map_elements(
-            check_ohlcv_validity,
-            return_dtype=pl.Struct([
-                pl.Field('volume_non_monotonic', pl.Boolean),
-                pl.Field('high_decreased', pl.Boolean),
-                pl.Field('low_increased', pl.Boolean),
-                pl.Field('open_mismatch', pl.Boolean),
-                pl.Field('identical_bars', pl.Boolean),
-            ])
-        )
-        .alias('validity')
-    ])
-
-    # Unnest validity struct
-    dupe_analysis = dupe_analysis.unnest('validity')
-
-    # Separate valid races from data quality issues
-    valid_races: pl.DataFrame|None = (
-        dupe_analysis
-        .filter(
-            # Valid if no violations OR just identical bars
-            ~pl.col('volume_non_monotonic')
-            & ~pl.col('high_decreased')
-            & ~pl.col('low_increased')
-            & ~pl.col('open_mismatch')
-        )
-    )
-    if valid_races.is_empty():
-        valid_races = None
-
-    data_quality_issues: pl.DataFrame|None = (
-        dupe_analysis
-        .filter(
-            # Issues if any non-identical violation exists
-            (
-                pl.col('volume_non_monotonic')
-                | pl.col('high_decreased')
-                | pl.col('low_increased')
-                | pl.col('open_mismatch')
-            )
-            & ~pl.col('identical_bars')
-        )
-    )
-    if data_quality_issues.is_empty():
-        data_quality_issues = None
-
-    # Deduplicate: keep highest volume bar for each timestamp
-    deduped: pl.DataFrame = (
-        wdts
-        .sort([time_col, volume_col])
-        .unique(
-            subset=[time_col],
-            keep='last',
-            maintain_order=False,
-        )
-    )
-
-    # Re-sort by time or index
-    if sort:
-        deduped = deduped.sort(by=time_col)
-
-    diff: int = wdts.height - deduped.height
-
-    return (
-        wdts,
-        deduped,
-        diff,
-        valid_races,
-        data_quality_issues,
-    )

piker/ui/_annotate.py

@@ -24,11 +24,8 @@ from pyqtgraph import (
     Point,
     functions as fn,
     Color,
-    GraphicsObject,
 )
-from pyqtgraph.Qt import internals
 import numpy as np
-import pyqtgraph as pg
 
 from piker.ui.qt import (
     QtCore,
@@ -38,10 +35,6 @@ from piker.ui.qt import (
     QRectF,
     QGraphicsPathItem,
 )
-from piker.ui._style import hcolor
-from piker.log import get_logger
-
-log = get_logger(__name__)
 
 
 def mk_marker_path(
@@ -111,7 +104,7 @@ def mk_marker_path(
 
 class LevelMarker(QGraphicsPathItem):
     '''
-    An arrow marker path graphic which redraws itself
+    An arrow marker path graphich which redraws itself
     to the specified view coordinate level on each paint cycle.
 
     '''
@@ -258,9 +251,9 @@ def qgo_draw_markers(
 
 ) -> float:
     '''
-    Paint markers in ``pg.GraphicsItem`` style by first removing the
+    Paint markers in ``pg.GraphicsItem`` style by first
-    view transform for the painter, drawing the markers in scene
+    removing the view transform for the painter, drawing the markers
-    coords, then restoring the view coords.
+    in scene coords, then restoring the view coords.
 
     '''
     # paint markers in native coordinate system
@@ -302,449 +295,3 @@ def qgo_draw_markers(
 
     p.setTransform(orig_tr)
     return max(sizes)
-
-
-class GapAnnotations(GraphicsObject):
-    '''
-    Batch-rendered gap annotations using Qt's efficient drawing
-    APIs.
-
-    Instead of creating individual `QGraphicsItem` instances per
-    gap (which is very slow for 1000+ gaps), this class stores all
-    gap rectangles and arrows in numpy-backed arrays and renders
-    them in single batch paint calls.
-
-    Performance: ~1000x faster than individual items for large gap
-    counts.
-
-    Based on patterns from:
-    - `pyqtgraph.BarGraphItem` (batch rect rendering)
-    - `pyqtgraph.ScatterPlotItem` (fragment rendering)
-    - `piker.ui._curve.FlowGraphic` (single path pattern)
-
-    '''
-    def __init__(
-        self,
-        gap_specs: list[dict],
-        array: np.ndarray|None = None,
-        color: str = 'dad_blue',
-        alpha: int = 169,
-        arrow_size: float = 10.0,
-        fqme: str|None = None,
-        timeframe: float|None = None,
-    ) -> None:
-        '''
-        gap_specs: list of dicts with keys:
-            - start_pos: (x, y) tuple for left corner of rect
-            - end_pos: (x, y) tuple for right corner of rect
-            - arrow_x: x position for arrow
-            - arrow_y: y position for arrow
-            - pointing: 'up' or 'down' for arrow direction
-            - start_time: (optional) timestamp for repositioning
-            - end_time: (optional) timestamp for repositioning
-
-        array: optional OHLC numpy array for repositioning on
-               backfill updates (when abs-index changes)
-
-        fqme: symbol name for these gaps (for logging/debugging)
-
-        timeframe: period in seconds that these gaps were
-                   detected on (used to skip reposition when
-                   called with wrong timeframe's array)
-
-        '''
-        super().__init__()
-        self._gap_specs = gap_specs
-        self._array = array
-        self._fqme = fqme
-        self._timeframe = timeframe
-        n_gaps = len(gap_specs)
-
-        # shared pen/brush matching original SelectRect/ArrowItem style
-        base_color = pg.mkColor(hcolor(color))
-
-        # rect pen: base color, fully opaque for outline
-        self._rect_pen = pg.mkPen(base_color, width=1)
-
-        # rect brush: base color with alpha=66 (SelectRect default)
-        rect_fill = pg.mkColor(hcolor(color))
-        rect_fill.setAlpha(66)
-        self._rect_brush = pg.functions.mkBrush(rect_fill)
-
-        # arrow pen: same as rects
-        self._arrow_pen = pg.mkPen(base_color, width=1)
-
-        # arrow brush: base color with user-specified alpha (default 169)
-        arrow_fill = pg.mkColor(hcolor(color))
-        arrow_fill.setAlpha(alpha)
-        self._arrow_brush = pg.functions.mkBrush(arrow_fill)
-
-        # allocate rect array using Qt's efficient storage
-        self._rectarray = internals.PrimitiveArray(
-            QtCore.QRectF,
-            4,
-        )
-        self._rectarray.resize(n_gaps)
-        rect_memory = self._rectarray.ndarray()
-
-        # fill rect array from gap specs
-        for (
-            i,
-            spec,
-        ) in enumerate(gap_specs):
-            (
-                start_x,
-                start_y,
-            ) = spec['start_pos']
-            (
-                end_x,
-                end_y,
-            ) = spec['end_pos']
-
-            # QRectF expects (x, y, width, height)
-            rect_memory[i, 0] = start_x
-            rect_memory[i, 1] = min(start_y, end_y)
-            rect_memory[i, 2] = end_x - start_x
-            rect_memory[i, 3] = abs(end_y - start_y)
-
-        # build single QPainterPath for all arrows
-        self._arrow_path = QtGui.QPainterPath()
-        self._arrow_size = arrow_size
-
-        for spec in gap_specs:
-            arrow_x = spec['arrow_x']
-            arrow_y = spec['arrow_y']
-            pointing = spec['pointing']
-
-            # create arrow polygon
-            if pointing == 'down':
-                # arrow points downward
-                arrow_poly = QtGui.QPolygonF([
-                    QPointF(arrow_x, arrow_y),  # tip
-                    QPointF(
-                        arrow_x - arrow_size/2,
-                        arrow_y - arrow_size,
-                    ),  # left
-                    QPointF(
-                        arrow_x + arrow_size/2,
-                        arrow_y - arrow_size,
-                    ),  # right
-                ])
-            else:  # up
-                # arrow points upward
-                arrow_poly = QtGui.QPolygonF([
-                    QPointF(arrow_x, arrow_y),  # tip
-                    QPointF(
-                        arrow_x - arrow_size/2,
-                        arrow_y + arrow_size,
-                    ),  # left
-                    QPointF(
-                        arrow_x + arrow_size/2,
-                        arrow_y + arrow_size,
-                    ),  # right
-                ])
-
-            self._arrow_path.addPolygon(arrow_poly)
-            self._arrow_path.closeSubpath()
-
-        # cache bounding rect
-        self._br: QRectF|None = None
-
-    def boundingRect(self) -> QRectF:
-        '''
-        Compute bounding rect from rect array and arrow path.
-
-        '''
-        if self._br is not None:
-            return self._br
-
-        # get rect bounds
-        rect_memory = self._rectarray.ndarray()
-        if len(rect_memory) == 0:
-            self._br = QRectF()
-            return self._br
-
-        x_min = rect_memory[:, 0].min()
-        y_min = rect_memory[:, 1].min()
-        x_max = (rect_memory[:, 0] + rect_memory[:, 2]).max()
-        y_max = (rect_memory[:, 1] + rect_memory[:, 3]).max()
-
-        # expand for arrow path
-        arrow_br = self._arrow_path.boundingRect()
-        x_min = min(x_min, arrow_br.left())
-        y_min = min(y_min, arrow_br.top())
-        x_max = max(x_max, arrow_br.right())
-        y_max = max(y_max, arrow_br.bottom())
-
-        self._br = QRectF(
-            x_min,
-            y_min,
-            x_max - x_min,
-            y_max - y_min,
-        )
-        return self._br
-
-    def paint(
-        self,
-        p: QtGui.QPainter,
-        opt: QtWidgets.QStyleOptionGraphicsItem,
-        w: QtWidgets.QWidget,
-    ) -> None:
-        '''
-        Batch render all rects and arrows in minimal paint calls.
-
-        '''
-        # draw all rects in single batch call (data coordinates)
-        p.setPen(self._rect_pen)
-        p.setBrush(self._rect_brush)
-        drawargs = self._rectarray.drawargs()
-        p.drawRects(*drawargs)
-
-        # draw arrows in scene/pixel coordinates so they maintain
-        # size regardless of zoom level
-        orig_tr = p.transform()
-        p.resetTransform()
-
-        # rebuild arrow path in scene coordinates
-        arrow_path_scene = QtGui.QPainterPath()
-
-        # arrow geometry matching pg.ArrowItem defaults
-        # headLen=10, headWidth=2.222
-        # headWidth is the half-width (center to edge distance)
-        head_len = self._arrow_size
-        head_width = head_len * 0.2222  # 2.222 at size=10
-
-        for spec in self._gap_specs:
-            if 'arrow_x' not in spec:
-                continue
-
-            arrow_x = spec['arrow_x']
-            arrow_y = spec['arrow_y']
-            pointing = spec['pointing']
-
-            # transform data coords to scene coords
-            scene_pt = orig_tr.map(QPointF(arrow_x, arrow_y))
-            sx = scene_pt.x()
-            sy = scene_pt.y()
-
-            # create arrow polygon in scene/pixel coords
-            # matching pg.ArrowItem geometry but rotated for up/down
-            if pointing == 'down':
-                # tip points downward (negative y direction)
-                arrow_poly = QtGui.QPolygonF([
-                    QPointF(sx, sy),  # tip
-                    QPointF(
-                        sx - head_width,
-                        sy - head_len,
-                    ),  # left base
-                    QPointF(
-                        sx + head_width,
-                        sy - head_len,
-                    ),  # right base
-                ])
-            else:  # up
-                # tip points upward (positive y direction)
-                arrow_poly = QtGui.QPolygonF([
-                    QPointF(sx, sy),  # tip
-                    QPointF(
-                        sx - head_width,
-                        sy + head_len,
-                    ),  # left base
-                    QPointF(
-                        sx + head_width,
-                        sy + head_len,
-                    ),  # right base
-                ])
-
-            arrow_path_scene.addPolygon(arrow_poly)
-            arrow_path_scene.closeSubpath()
-
-        p.setPen(self._arrow_pen)
-        p.setBrush(self._arrow_brush)
-        p.drawPath(arrow_path_scene)
-
-        # restore original transform
-        p.setTransform(orig_tr)
-
-    def reposition(
-        self,
-        array: np.ndarray|None = None,
-        fqme: str|None = None,
-        timeframe: float|None = None,
-    ) -> None:
-        '''
-        Reposition all annotations based on timestamps.
-
-        Used when viz is updated (eg during backfill) and abs-index
-        range changes - we need to lookup new indices from timestamps.
-
-        '''
-        # skip reposition if timeframe doesn't match
-        # (e.g., 1s gaps being repositioned with 60s array)
-        if (
-            timeframe is not None
-            and
-            self._timeframe is not None
-            and
-            timeframe != self._timeframe
-        ):
-            log.debug(
-                f'Skipping reposition for {self._fqme} gaps:\n'
-                f'  gap timeframe: {self._timeframe}s\n'
-                f'  array timeframe: {timeframe}s\n'
-            )
-            return
-
-        if array is None:
-            array = self._array
-
-        if array is None:
-            log.warning(
-                'GapAnnotations.reposition() called but no array '
-                'provided'
-            )
-            return
-
-        # collect all unique timestamps we need to lookup
-        timestamps: set[float] = set()
-        for spec in self._gap_specs:
-            if spec.get('start_time') is not None:
-                timestamps.add(spec['start_time'])
-            if spec.get('end_time') is not None:
-                timestamps.add(spec['end_time'])
-            if spec.get('time') is not None:
-                timestamps.add(spec['time'])
-
-        # vectorized timestamp -> row lookup using binary search
-        time_to_row: dict[float, dict] = {}
-        if timestamps:
-            import numpy as np
-            time_arr = array['time']
-            ts_array = np.array(list(timestamps))
-
-            search_indices = np.searchsorted(
-                time_arr,
-                ts_array,
-            )
-
-            # vectorized bounds check and exact match verification
-            valid_mask = (
-                (search_indices < len(array))
-                & (time_arr[search_indices] == ts_array)
-            )
-
-            valid_indices = search_indices[valid_mask]
-            valid_timestamps = ts_array[valid_mask]
-            matched_rows = array[valid_indices]
-
-            time_to_row = {
-                float(ts): {
-                    'index': float(row['index']),
-                    'open': float(row['open']),
-                    'close': float(row['close']),
-                }
-                for ts, row in zip(
-                    valid_timestamps,
-                    matched_rows,
-                )
-            }
-
-        # rebuild rect array from gap specs with new indices
-        rect_memory = self._rectarray.ndarray()
-
-        for (
-            i,
-            spec,
-        ) in enumerate(self._gap_specs):
-            start_time = spec.get('start_time')
-            end_time = spec.get('end_time')
-
-            if (
-                start_time is None
-                or end_time is None
-            ):
-                continue
-
-            start_row = time_to_row.get(start_time)
-            end_row = time_to_row.get(end_time)
-
-            if (
-                start_row is None
-                or end_row is None
-            ):
-                log.warning(
-                    f'Timestamp lookup failed for gap[{i}] during '
-                    f'reposition:\n'
-                    f'  fqme: {fqme}\n'
-                    f'  timeframe: {timeframe}s\n'
-                    f'  start_time: {start_time}\n'
-                    f'  end_time: {end_time}\n'
-                    f'  array time range: '
-                    f'{array["time"][0]} -> {array["time"][-1]}\n'
-                )
-                continue
-
-            start_idx = start_row['index']
-            end_idx = end_row['index']
-            start_close = start_row['close']
-            end_open = end_row['open']
-
-            from_idx: float = 0.16 - 0.06
-            start_x = start_idx + 1 - from_idx
-            end_x = end_idx + from_idx
-
-            # update rect in array
-            rect_memory[i, 0] = start_x
-            rect_memory[i, 1] = min(start_close, end_open)
-            rect_memory[i, 2] = end_x - start_x
-            rect_memory[i, 3] = abs(end_open - start_close)
-
-        # rebuild arrow path with new indices
-        self._arrow_path.clear()
-
-        for spec in self._gap_specs:
-            time_val = spec.get('time')
-            if time_val is None:
-                continue
-
-            arrow_row = time_to_row.get(time_val)
-            if arrow_row is None:
-                continue
-
-            arrow_x = arrow_row['index']
-            arrow_y = arrow_row['close']
-            pointing = spec['pointing']
-
-            # create arrow polygon
-            if pointing == 'down':
-                arrow_poly = QtGui.QPolygonF([
-                    QPointF(arrow_x, arrow_y),
-                    QPointF(
-                        arrow_x - self._arrow_size/2,
-                        arrow_y - self._arrow_size,
-                    ),
-                    QPointF(
-                        arrow_x + self._arrow_size/2,
-                        arrow_y - self._arrow_size,
-                    ),
-                ])
-            else:  # up
-                arrow_poly = QtGui.QPolygonF([
-                    QPointF(arrow_x, arrow_y),
-                    QPointF(
-                        arrow_x - self._arrow_size/2,
-                        arrow_y + self._arrow_size,
-                    ),
-                    QPointF(
-                        arrow_x + self._arrow_size/2,
-                        arrow_y + self._arrow_size,
-                    ),
-                ])
-
-            self._arrow_path.addPolygon(arrow_poly)
-            self._arrow_path.closeSubpath()
-
-        # invalidate bounding rect cache
-        self._br = None
-        self.prepareGeometryChange()
-        self.update()

piker/ui/_editors.py

@@ -21,7 +21,6 @@ Higher level annotation editors.
 from __future__ import annotations
 from collections import defaultdict
 from typing import (
-    Literal,
     Sequence,
     TYPE_CHECKING,
 )
@@ -72,18 +71,9 @@ log = get_logger(__name__)
 
 
 class ArrowEditor(Struct):
-    '''
-    Annotate a chart-view with arrows most often used for indicating,
-    - order txns/clears,
-    - positions directions,
-    - general points-of-interest like nooz events.
 
-    '''
     godw: GodWidget = None  # type: ignore # noqa
-    _arrows: dict[
+    _arrows: dict[str, list[pg.ArrowItem]] = {}
-        str,
-        list[pg.ArrowItem]
-    ] = {}
 
     def add(
         self,
@@ -91,19 +81,8 @@ class ArrowEditor(Struct):
         uid: str,
         x: float,
         y: float,
-        color: str|None = None,
+        color: str = 'default',
-        pointing: Literal[
+        pointing: str | None = None,
-            'up',
-            'down',
-            None,
-        ] = None,
-        alpha: int = 255,
-        zval: float = 1e9,
-        headLen: float|None = None,
-        headWidth: float|None = None,
-        tailLen: float|None = None,
-        tailWidth: float|None = None,
-        pxMode: bool = True,
 
     ) -> pg.ArrowItem:
         '''
@@ -119,83 +98,29 @@ class ArrowEditor(Struct):
         # scale arrow sizing to dpi-aware font
         size = _font.font.pixelSize() * 0.8
 
-        # allow caller override of head dimensions
-        if headLen is None:
-            headLen = size
-        if headWidth is None:
-            headWidth = size/2
-        # tail params default to None (no tail)
-        if tailWidth is None:
-            tailWidth = 3
-
-        color = color or 'default'
-        color = QColor(hcolor(color))
-        color.setAlpha(alpha)
-        pen = fn.mkPen(color, width=1)
-        brush = fn.mkBrush(color)
         arrow = pg.ArrowItem(
             angle=angle,
             baseAngle=0,
-            headLen=headLen,
+            headLen=size,
-            headWidth=headWidth,
+            headWidth=size/2,
-            tailLen=tailLen,
+            tailLen=None,
-            tailWidth=tailWidth,
+            pxMode=True,
-            pxMode=pxMode,
-            # coloring
-            pen=pen,
-            brush=brush,
-        )
-        arrow.setZValue(zval)
-        arrow.setPos(x, y)
-        plot.addItem(arrow)  # render to view
 
-        # register for removal
+            # coloring
-        arrow._uid = uid
+            pen=pg.mkPen(hcolor('papas_special')),
-        self._arrows.setdefault(
+            brush=pg.mkBrush(hcolor(color)),
-            uid, []
+        )
-        ).append(arrow)
+        arrow.setPos(x, y)
+        self._arrows.setdefault(uid, []).append(arrow)
+
+        # render to view
+        plot.addItem(arrow)
 
         return arrow
 
-    def remove(
+    def remove(self, arrow) -> bool:
-        self,
-        arrow: pg.ArrowItem,
-    ) -> None:
-        '''
-        Remove a *single arrow* from all chart views to which it was
-        added.
-
-        '''
-        uid: str = arrow._uid
-        arrows: list[pg.ArrowItem] = self._arrows[uid]
-        log.debug(
-            f'Removing arrow from views\n'
-            f'uid: {uid!r}\n'
-            f'{arrow!r}\n'
-        )
         for linked in self.godw.iter_linked():
-            if not (chart := linked.chart):
+            linked.chart.plotItem.removeItem(arrow)
-                continue
-
-            chart.plotItem.removeItem(arrow)
-        try:
-            arrows.remove(arrow)
-        except ValueError:
-            log.warning(
-                f'Arrow was already removed?\n'
-                f'uid: {uid!r}\n'
-                f'{arrow!r}\n'
-            )
-
-    def remove_all(self) -> set[pg.ArrowItem]:
-        '''
-        Remove all arrows added by this editor from all
-        chart-views.
-
-        '''
-        for uid, arrows in self._arrows.items():
-            for arrow in arrows:
-                self.remove(arrow)
 
 
 class LineEditor(Struct):
@@ -286,9 +211,7 @@ class LineEditor(Struct):
             for line in lines:
                 line.show_labels()
                 line.hide_markers()
-                log.debug(
+                log.debug(f'Level active for level: {line.value()}')
-                    f'Line active @ level: {line.value()!r}'
-                )
                 # TODO: other flashy things to indicate the order is active
 
         return lines
@@ -331,11 +254,7 @@ class LineEditor(Struct):
                     if line in hovered:
                         hovered.remove(line)
 
-                    log.debug(
+                    log.debug(f'deleting {line} with oid: {uuid}')
-                        f'Deleting level-line\n'
-                        f'line: {line!r}\n'
-                        f'oid: {uuid!r}\n'
-                    )
                     line.delete()
 
                     # make sure the xhair doesn't get left off
@@ -343,17 +262,10 @@ class LineEditor(Struct):
                     cursor.show_xhair()
 
         else:
-            log.warning(
+            log.warning(f'Could not find line for {line}')
-                f'Could not find line for removal ??\n'
-                f'\n'
-                f'{line!r}\n'
-            )
 
         return lines
 
-    # compat with ArrowEditor
-    remove = remove_line
-
 
 def as_point(
     pair: Sequence[float, float] | QPointF,
@@ -386,7 +298,7 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
     def __init__(
         self,
         viewbox: ViewBox,
-        color: str|None = None,
+        color: str | None = None,
     ) -> None:
         super().__init__(0, 0, 1, 1)
 
@@ -579,11 +491,11 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
         if update_label:
             self.init_label(view_rect)
 
-        log.debug(
+        print(
-            f'SelectRect modify,\n'
+            'SelectRect modify:\n'
             f'QRectF: {view_rect}\n'
-            f'start_pos: {start_pos!r}\n'
+            f'start_pos: {start_pos}\n'
-            f'end_pos: {end_pos!r}\n'
+            f'end_pos: {end_pos}\n'
         )
         self.show()
 
@@ -650,11 +562,8 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
             dmn=dmn,
         ))
 
-        # tracing
+        # print(f'x2, y2: {(x2, y2)}')
-        # log.info(
+        # print(f'xmn, ymn: {(xmn, ymx)}')
-        #     f'x2, y2: {(x2, y2)}\n'
-        #     f'xmn, ymn: {(xmn, ymx)}\n'
-        # )
 
         label_anchor = Point(
             xmx + 2,
@@ -705,6 +614,3 @@ class SelectRect(QtWidgets.QGraphicsRectItem):
 
         ):
             scen.removeItem(self._label_proxy)
-
-    # compat with ArrowEditor
-    remove = delete

piker/ui/_lines.py

@@ -38,6 +38,7 @@ from piker.ui.qt import (
     QtGui,
     QGraphicsPathItem,
     QStyleOptionGraphicsItem,
+    QGraphicsItem,
     QGraphicsScene,
     QWidget,
     QPointF,

piker/ui/_style.py

@@ -61,7 +61,7 @@ class DpiAwareFont:
     ) -> None:
 
         self._font_size_calc_key: str = _font_size_key
-        self._font_size: int|None = None
+        self._font_size: int | None = None
 
         # Read preferred font size from main config file if it exists
         conf, path = config.load('conf', touch_if_dne=True)
@@ -107,22 +107,7 @@ class DpiAwareFont:
 
     @property
     def px_size(self) -> int:
-        size: int = self._qfont.pixelSize()
+        return self._qfont.pixelSize()
-
-        # XXX, when no Qt app has been spawned this will always be
-        # invalid..
-        # SO, just return any conf.toml value.
-        if size == -1:
-            if (conf_size := self._font_size) is None:
-                raise ValueError(
-                    f'No valid `{type(_font).__name__}.px_size` set?\n'
-                    f'\n'
-                    f'-> `ui.font_size` is NOT set in `conf.toml`\n'
-                    f'-> no Qt app is active ??\n'
-                )
-            return conf_size
-
-        return size
 
     def configure_to_dpi(self, screen: QtGui.QScreen | None = None):
         '''
@@ -236,20 +221,6 @@ def _config_fonts_to_screen() -> None:
     _font_small.configure_to_dpi()
 
 
-def get_fonts() -> tuple[
-    DpiAwareFont,
-    DpiAwareFont,
-]:
-    '''
-    Get the singleton font pair (of instances) from which all other
-    UI/UX should be "scaled around".
-
-    See `DpiAwareFont` for (internal) deats.
-
-    '''
-    return _font, _font_small
-
-
 # TODO: re-compute font size when main widget switches screens?
 # https://forum.qt.io/topic/54136/how-do-i-get-the-qscreen-my-widget-is-on-qapplication-desktop-screen-returns-a-qwidget-and-qobject_cast-qscreen-returns-null/3
 

pyproject.toml

@@ -116,6 +116,7 @@ uis = [
 dev = [
   # https://docs.astral.sh/uv/concepts/projects/dependencies/#development-dependencies
   "cython >=3.0.0, <4.0.0",
+
   # nested deps-groups
   # https://docs.astral.sh/uv/concepts/projects/dependencies/#nesting-groups
   {include-group = 'uis'},
@@ -133,10 +134,6 @@ repl = [
     "prompt-toolkit ==3.0.40",
     "pyperclip>=1.9.0",
 
-  # for @claude's `snippets/claude_debug_helper.py` it uses to do
-  # "offline" debug/crash REPL-in alongside a dev.
-  "pexpect>=4.9.0",
-
   # ?TODO, new stuff to consider..
   # "visidata"  # console numerics
   # "xxh"  # for remote `xonsh`-ing
@@ -190,23 +187,14 @@ include = ["piker"]
 
 
 [tool.uv.sources]
+pyqtgraph = { git = "https://github.com/pikers/pyqtgraph.git" }
 tomlkit = { git = "https://github.com/pikers/tomlkit.git", branch ="piker_pin" }
 pyvnc = { git = "https://github.com/regulad/pyvnc.git" }
 
-pyqtgraph = { git = "https://github.com/pyqtgraph/pyqtgraph.git", branch = 'master' }
-# pyqtgraph = { path = '../pyqtgraph', editable = true }
-# ?TODO, resync our fork?
-# pyqtgraph = { git = "https://github.com/pikers/pyqtgraph.git" }
-
-# to get fancy next-cmd/suggestion feats prior to 0.22.2 B)
-# https://github.com/xonsh/xonsh/pull/6037
-# https://github.com/xonsh/xonsh/pull/6048
-xonsh = { git = 'https://github.com/xonsh/xonsh.git', branch = 'main' }
-
 # XXX since, we're like, always hacking new shite all-the-time. Bp
-# tractor = { git = "https://github.com/goodboy/tractor.git", branch ="piker_pin" }
+tractor = { git = "https://github.com/goodboy/tractor.git", branch ="piker_pin" }
 # tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "piker_pin" }
 # tractor = { git = "https://pikers.dev/goodboy/tractor", branch = "main" }
 # ------ goodboy ------
 # hackin dev-envs, usually there's something new he's hackin in..
-tractor = { path = "../tractor", editable = true }
+# tractor = { path = "../tractor", editable = true }

snippets/claude_debug_helper.py

@@ -1,256 +0,0 @@
-#!/usr/bin/env python
-'''
-Programmatic debugging helper for `pdbp` REPL human-like
-interaction but built to allow `claude` to interact with 
-crashes and `tractor.pause()` breakpoints along side a human dev.
-
-Originally written by `clauded` during a backfiller inspection
-session with @goodboy trying to resolve duplicate/gappy ohlcv ts
-issues discovered while testing the new `nativedb` tsdb.
-
-Allows `claude` to run `pdb` commands and capture output in an "offline"
-manner but generating similar output as if it was iteracting with
-the debug REPL.
-
-The use of `pexpect` is heavily based on tractor's REPL UX test
-suite(s), namely various `tests/devx/test_debugger.py` patterns.
-
-'''
-import sys
-import os
-import time
-
-import pexpect
-from pexpect.exceptions import (
-    TIMEOUT,
-    EOF,
-)
-
-
-PROMPT: str = r'\(Pdb\+\)'
-
-
-def expect(
-    child: pexpect.spawn,
-    patt: str,
-    **kwargs,
-) -> None:
-    '''
-    Expect wrapper that prints last console data before failing.
-
-    '''
-    try:
-        child.expect(
-            patt,
-            **kwargs,
-        )
-    except TIMEOUT:
-        before: str = (
-            str(child.before.decode())
-            if isinstance(child.before, bytes)
-            else str(child.before)
-        )
-        print(
-            f'TIMEOUT waiting for pattern: {patt}\n'
-            f'Last seen output:\n{before}'
-        )
-        raise
-
-
-def run_pdb_commands(
-    commands: list[str],
-    initial_cmd: str = 'piker store ldshm xmrusdt.usdtm.perp.binance',
-    timeout: int = 30,
-    print_output: bool = True,
-) -> dict[str, str]:
-    '''
-    Spawn piker process, wait for pdb prompt, execute commands.
-
-    Returns dict mapping command -> output.
-
-    '''
-    results: dict[str, str] = {}
-
-    # Disable colored output for easier parsing
-    os.environ['PYTHON_COLORS'] = '0'
-
-    # Spawn the process
-    if print_output:
-        print(f'Spawning: {initial_cmd}')
-
-    child: pexpect.spawn = pexpect.spawn(
-        initial_cmd,
-        timeout=timeout,
-        encoding='utf-8',
-        echo=False,
-    )
-
-    # Wait for pdb prompt
-    try:
-        expect(child, PROMPT, timeout=timeout)
-        if print_output:
-            print('Reached pdb prompt!')
-
-        # Execute each command
-        for cmd in commands:
-            if print_output:
-                print(f'\n>>> {cmd}')
-
-            child.sendline(cmd)
-            time.sleep(0.1)
-
-            # Wait for next prompt
-            expect(child, PROMPT, timeout=timeout)
-
-            # Capture output (everything before the prompt)
-            output: str = (
-                str(child.before.decode())
-                if isinstance(child.before, bytes)
-                else str(child.before)
-            )
-            results[cmd] = output
-
-            if print_output:
-                print(output)
-
-        # Quit debugger gracefully
-        child.sendline('quit')
-        try:
-            child.expect(EOF, timeout=5)
-        except (TIMEOUT, EOF):
-            pass
-
-    except TIMEOUT as e:
-        print(f'Timeout: {e}')
-        if child.before:
-            before: str = (
-                str(child.before.decode())
-                if isinstance(child.before, bytes)
-                else str(child.before)
-            )
-            print(f'Buffer:\n{before}')
-        results['_error'] = str(e)
-
-    finally:
-        if child.isalive():
-            child.close(force=True)
-
-    return results
-
-
-class InteractivePdbSession:
-    '''
-    Interactive pdb session manager for incremental debugging.
-
-    '''
-    def __init__(
-        self,
-        cmd: str = 'piker store ldshm xmrusdt.usdtm.perp.binance',
-        timeout: int = 30,
-    ):
-        self.cmd: str = cmd
-        self.timeout: int = timeout
-        self.child: pexpect.spawn|None = None
-        self.history: list[tuple[str, str]] = []
-
-    def start(self) -> None:
-        '''
-        Start the piker process and wait for first prompt.
-
-        '''
-        os.environ['PYTHON_COLORS'] = '0'
-
-        print(f'Starting: {self.cmd}')
-        self.child = pexpect.spawn(
-            self.cmd,
-            timeout=self.timeout,
-            encoding='utf-8',
-            echo=False,
-        )
-
-        # Wait for initial prompt
-        expect(self.child, PROMPT, timeout=self.timeout)
-        print('Ready at pdb prompt!')
-
-    def run(
-        self,
-        cmd: str,
-        print_output: bool = True,
-    ) -> str:
-        '''
-        Execute a single pdb command and return output.
-
-        '''
-        if not self.child or not self.child.isalive():
-            raise RuntimeError('Session not started or dead')
-
-        if print_output:
-            print(f'\n>>> {cmd}')
-
-        self.child.sendline(cmd)
-        time.sleep(0.1)
-
-        # Wait for next prompt
-        expect(self.child, PROMPT, timeout=self.timeout)
-
-        output: str = (
-            str(self.child.before.decode())
-            if isinstance(self.child.before, bytes)
-            else str(self.child.before)
-        )
-        self.history.append((cmd, output))
-
-        if print_output:
-            print(output)
-
-        return output
-
-    def quit(self) -> None:
-        '''
-        Exit the debugger and cleanup.
-
-        '''
-        if self.child and self.child.isalive():
-            self.child.sendline('quit')
-            try:
-                self.child.expect(EOF, timeout=5)
-            except (TIMEOUT, EOF):
-                pass
-            self.child.close(force=True)
-
-    def __enter__(self):
-        self.start()
-        return self
-
-    def __exit__(self, *args):
-        self.quit()
-
-
-if __name__ == '__main__':
-    # Example inspection commands
-    inspect_cmds: list[str] = [
-        'locals().keys()',
-        'type(deduped)',
-        'deduped.shape',
-        (
-            'step_gaps.shape '
-            'if "step_gaps" in locals() '
-            'else "N/A"'
-        ),
-        (
-            'venue_gaps.shape '
-            'if "venue_gaps" in locals() '
-            'else "N/A"'
-        ),
-    ]
-
-    # Allow commands from CLI args
-    if len(sys.argv) > 1:
-        inspect_cmds = sys.argv[1:]
-
-    # Interactive session example
-    with InteractivePdbSession() as session:
-        for cmd in inspect_cmds:
-            session.run(cmd)
-
-    print('\n=== Session Complete ===')

uv.lock

@@ -104,15 +104,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/e0/44/827b2a91a5816512fcaf3cc4ebc465ccd5d598c45cefa6703fcf4a79018f/attrs-23.2.0-py3-none-any.whl", hash = "sha256:99b87a485a5820b23b879f04c2305b44b951b502fd64be915879d77a7e8fc6f1", size = 60752, upload-time = "2023-12-31T06:30:30.772Z" },
 ]
 
-[[package]]
-name = "base58"
-version = "2.1.1"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/7f/45/8ae61209bb9015f516102fa559a2914178da1d5868428bd86a1b4421141d/base58-2.1.1.tar.gz", hash = "sha256:c5d0cb3f5b6e81e8e35da5754388ddcc6d0d14b6c6a132cb93d69ed580a7278c", size = 6528, upload-time = "2021-10-30T22:12:17.858Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/4a/45/ec96b29162a402fc4c1c5512d114d7b3787b9d1c2ec241d9568b4816ee23/base58-2.1.1-py3-none-any.whl", hash = "sha256:11a36f4d3ce51dfc1043f3218591ac4eb1ceb172919cebe05b52a5bcc8d245c2", size = 5621, upload-time = "2021-10-30T22:12:16.658Z" },
-]
-
 [[package]]
 name = "bidict"
 version = "0.23.1"
@@ -122,74 +113,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/99/37/e8730c3587a65eb5645d4aba2d27aae48e8003614d6aaf15dda67f702f1f/bidict-0.23.1-py3-none-any.whl", hash = "sha256:5dae8d4d79b552a71cbabc7deb25dfe8ce710b17ff41711e13010ead2abfc3e5", size = 32764, upload-time = "2024-02-18T19:09:04.156Z" },
 ]
 
-[[package]]
-name = "blake3"
-version = "1.0.8"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/75/aa/abcd75e9600987a0bc6cfe9b6b2ff3f0e2cb08c170addc6e76035b5c4cb3/blake3-1.0.8.tar.gz", hash = "sha256:513cc7f0f5a7c035812604c2c852a0c1468311345573de647e310aca4ab165ba", size = 117308, upload-time = "2025-10-14T06:47:48.83Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/ed/a0/b7b6dff04012cfd6e665c09ee446f749bd8ea161b00f730fe1bdecd0f033/blake3-1.0.8-cp312-cp312-macosx_10_12_x86_64.whl", hash = "sha256:d8da4233984d51471bd4e4366feda1d90d781e712e0a504ea54b1f2b3577557b", size = 347983, upload-time = "2025-10-14T06:45:47.214Z" },
-    { url = "https://files.pythonhosted.org/packages/5b/a2/264091cac31d7ae913f1f296abc20b8da578b958ffb86100a7ce80e8bf5c/blake3-1.0.8-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:1257be19f2d381c868a34cc822fc7f12f817ddc49681b6d1a2790bfbda1a9865", size = 325415, upload-time = "2025-10-14T06:45:48.482Z" },
-    { url = "https://files.pythonhosted.org/packages/ee/7d/85a4c0782f613de23d114a7a78fcce270f75b193b3ff3493a0de24ba104a/blake3-1.0.8-cp312-cp312-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:269f255b110840e52b6ce9db02217e39660ebad3e34ddd5bca8b8d378a77e4e1", size = 371296, upload-time = "2025-10-14T06:45:49.674Z" },
-    { url = "https://files.pythonhosted.org/packages/e3/20/488475254976ed93fab57c67aa80d3b40df77f7d9db6528c9274bff53e08/blake3-1.0.8-cp312-cp312-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:66ca28a673025c40db3eba21a9cac52f559f83637efa675b3f6bd8683f0415f3", size = 374516, upload-time = "2025-10-14T06:45:51.23Z" },
-    { url = "https://files.pythonhosted.org/packages/7b/21/2a1c47fedb77fb396512677ec6d46caf42ac6e9a897db77edd0a2a46f7bb/blake3-1.0.8-cp312-cp312-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:bcb04966537777af56c1f399b35525aa70a1225816e121ff95071c33c0f7abca", size = 447911, upload-time = "2025-10-14T06:45:52.637Z" },
-    { url = "https://files.pythonhosted.org/packages/cb/7d/db0626df16029713e7e61b67314c4835e85c296d82bd907c21c6ea271da2/blake3-1.0.8-cp312-cp312-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:e5b5da177d62cc4b7edf0cea08fe4dec960c9ac27f916131efa890a01f747b93", size = 505420, upload-time = "2025-10-14T06:45:54.445Z" },
-    { url = "https://files.pythonhosted.org/packages/5b/55/6e737850c2d58a6d9de8a76dad2ae0f75b852a23eb4ecb07a0b165e6e436/blake3-1.0.8-cp312-cp312-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:38209b10482c97e151681ea3e91cc7141f56adbbf4820a7d701a923124b41e6a", size = 394189, upload-time = "2025-10-14T06:45:55.719Z" },
-    { url = "https://files.pythonhosted.org/packages/5b/94/eafaa5cdddadc0c9c603a6a6d8339433475e1a9f60c8bb9c2eed2d8736b6/blake3-1.0.8-cp312-cp312-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:504d1399b7fb91dfe5c25722d2807990493185faa1917456455480c36867adb5", size = 388001, upload-time = "2025-10-14T06:45:57.067Z" },
-    { url = "https://files.pythonhosted.org/packages/17/81/735fa00d13de7f68b25e1b9cb36ff08c6f165e688d85d8ec2cbfcdedccc5/blake3-1.0.8-cp312-cp312-musllinux_1_1_aarch64.whl", hash = "sha256:c84af132aa09abeadf9a0118c8fb26f4528f3f42c10ef8be0fcf31c478774ec4", size = 550302, upload-time = "2025-10-14T06:45:58.657Z" },
-    { url = "https://files.pythonhosted.org/packages/0e/c6/d1fe8bdea4a6088bd54b5a58bc40aed89a4e784cd796af7722a06f74bae7/blake3-1.0.8-cp312-cp312-musllinux_1_1_x86_64.whl", hash = "sha256:a25db3d36b55f5ed6a86470155cc749fc9c5b91c949b8d14f48658f9d960d9ec", size = 554211, upload-time = "2025-10-14T06:46:00.269Z" },
-    { url = "https://files.pythonhosted.org/packages/55/d1/ca74aa450cbe10e396e061f26f7a043891ffa1485537d6b30d3757e20995/blake3-1.0.8-cp312-cp312-win32.whl", hash = "sha256:e0fee93d5adcd44378b008c147e84f181f23715307a64f7b3db432394bbfce8b", size = 228343, upload-time = "2025-10-14T06:46:01.533Z" },
-    { url = "https://files.pythonhosted.org/packages/4d/42/bbd02647169e3fbed27558555653ac2578c6f17ccacf7d1956c58ef1d214/blake3-1.0.8-cp312-cp312-win_amd64.whl", hash = "sha256:6a6eafc29e4f478d365a87d2f25782a521870c8514bb43734ac85ae9be71caf7", size = 215704, upload-time = "2025-10-14T06:46:02.79Z" },
-    { url = "https://files.pythonhosted.org/packages/55/b8/11de9528c257f7f1633f957ccaff253b706838d22c5d2908e4735798ec01/blake3-1.0.8-cp313-cp313-macosx_10_12_x86_64.whl", hash = "sha256:46dc20976bd6c235959ef0246ec73420d1063c3da2839a9c87ca395cf1fd7943", size = 347771, upload-time = "2025-10-14T06:46:04.248Z" },
-    { url = "https://files.pythonhosted.org/packages/50/26/f7668be55c909678b001ecacff11ad7016cd9b4e9c7cc87b5971d638c5a9/blake3-1.0.8-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:d17eb6382634b3a5bc0c0e0454d5265b0becaeeadb6801ed25150b39a999d0cc", size = 325431, upload-time = "2025-10-14T06:46:06.136Z" },
-    { url = "https://files.pythonhosted.org/packages/77/57/e8a85fa261894bf7ce7af928ff3408aab60287ab8d58b55d13a3f700b619/blake3-1.0.8-cp313-cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:19fc6f2b7edab8acff6895fc6e38c19bd79f4c089e21153020c75dfc7397d52d", size = 370994, upload-time = "2025-10-14T06:46:07.398Z" },
-    { url = "https://files.pythonhosted.org/packages/62/cd/765b76bb48b8b294fea94c9008b0d82b4cfa0fa2f3c6008d840d01a597e4/blake3-1.0.8-cp313-cp313-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:4f54cff7f15d91dc78a63a2dd02a3dccdc932946f271e2adb4130e0b4cf608ba", size = 374372, upload-time = "2025-10-14T06:46:08.698Z" },
-    { url = "https://files.pythonhosted.org/packages/36/7a/32084eadbb28592bb07298f0de316d2da586c62f31500a6b1339a7e7b29b/blake3-1.0.8-cp313-cp313-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e7e12a777f6b798eb8d06f875d6e108e3008bd658d274d8c676dcf98e0f10537", size = 447627, upload-time = "2025-10-14T06:46:10.002Z" },
-    { url = "https://files.pythonhosted.org/packages/a7/f4/3788a1d86e17425eea147e28d7195d7053565fc279236a9fd278c2ec495e/blake3-1.0.8-cp313-cp313-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ddfc59b0176fb31168f08d5dd536e69b1f4f13b5a0f4b0c3be1003efd47f9308", size = 507536, upload-time = "2025-10-14T06:46:11.614Z" },
-    { url = "https://files.pythonhosted.org/packages/fe/01/4639cba48513b94192681b4da472cdec843d3001c5344d7051ee5eaef606/blake3-1.0.8-cp313-cp313-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:a2336d5b2a801a7256da21150348f41610a6c21dae885a3acb1ebbd7333d88d8", size = 394105, upload-time = "2025-10-14T06:46:12.808Z" },
-    { url = "https://files.pythonhosted.org/packages/21/ae/6e55c19c8460fada86cd1306a390a09b0c5a2e2e424f9317d2edacea439f/blake3-1.0.8-cp313-cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:e4072196547484c95a5a09adbb952e9bb501949f03f9e2a85e7249ef85faaba8", size = 386928, upload-time = "2025-10-14T06:46:16.284Z" },
-    { url = "https://files.pythonhosted.org/packages/ee/6c/05b7a5a907df1be53a8f19e7828986fc6b608a44119641ef9c0804fbef15/blake3-1.0.8-cp313-cp313-musllinux_1_1_aarch64.whl", hash = "sha256:0eab3318ec02f8e16fe549244791ace2ada2c259332f0c77ab22cf94dfff7130", size = 550003, upload-time = "2025-10-14T06:46:17.791Z" },
-    { url = "https://files.pythonhosted.org/packages/b4/03/f0ea4adfedc1717623be6460b3710fcb725ca38082c14274369803f727e1/blake3-1.0.8-cp313-cp313-musllinux_1_1_x86_64.whl", hash = "sha256:a33b9a1fb6d1d559a8e0d04b041e99419a6bb771311c774f6ff57ed7119c70ed", size = 553857, upload-time = "2025-10-14T06:46:19.088Z" },
-    { url = "https://files.pythonhosted.org/packages/cc/6f/e5410d2e2a30c8aba8389ffc1c0061356916bf5ecd0a210344e7b69b62ab/blake3-1.0.8-cp313-cp313-win32.whl", hash = "sha256:e171b169cb7ea618e362a4dddb7a4d4c173bbc08b9ba41ea3086dd1265530d4f", size = 228315, upload-time = "2025-10-14T06:46:20.391Z" },
-    { url = "https://files.pythonhosted.org/packages/79/ef/d9c297956dfecd893f29f59e7b22445aba5b47b7f6815d9ba5dcd73fcae6/blake3-1.0.8-cp313-cp313-win_amd64.whl", hash = "sha256:3168c457255b5d2a2fc356ba696996fcaff5d38284f968210d54376312107662", size = 215477, upload-time = "2025-10-14T06:46:21.542Z" },
-    { url = "https://files.pythonhosted.org/packages/20/ba/eaa7723d66dd8ab762a3e85e139bb9c46167b751df6e950ad287adb8fb61/blake3-1.0.8-cp313-cp313t-macosx_10_12_x86_64.whl", hash = "sha256:b4d672c24dc15ec617d212a338a4ca14b449829b6072d09c96c63b6e6b621aed", size = 347289, upload-time = "2025-10-14T06:46:22.772Z" },
-    { url = "https://files.pythonhosted.org/packages/47/b3/6957f6ee27f0d5b8c4efdfda68a1298926a88c099f4dd89c711049d16526/blake3-1.0.8-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:1af0e5a29aa56d4fba904452ae784740997440afd477a15e583c38338e641f41", size = 324444, upload-time = "2025-10-14T06:46:24.729Z" },
-    { url = "https://files.pythonhosted.org/packages/13/da/722cebca11238f3b24d3cefd2361c9c9ea47cfa0ad9288eeb4d1e0b7cf93/blake3-1.0.8-cp313-cp313t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:ef153c5860d5bf1cc71aece69b28097d2a392913eb323d6b52555c875d0439fc", size = 370441, upload-time = "2025-10-14T06:46:26.29Z" },
-    { url = "https://files.pythonhosted.org/packages/2e/d5/2f7440c8e41c0af995bad3a159e042af0f4ed1994710af5b4766ca918f65/blake3-1.0.8-cp313-cp313t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:e8ae3689f0c7bfa6ce6ae45cab110e4c3442125c4c23b28f1f097856de26e4d1", size = 374312, upload-time = "2025-10-14T06:46:27.451Z" },
-    { url = "https://files.pythonhosted.org/packages/a6/6c/fb6a7812e60ce3e110bcbbb11f167caf3e975c589572c41e1271f35f2c41/blake3-1.0.8-cp313-cp313t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:3fb83532f7456ddeb68dae1b36e1f7c52f9cb72852ac01159bbcb1a12b0f8be0", size = 447007, upload-time = "2025-10-14T06:46:29.056Z" },
-    { url = "https://files.pythonhosted.org/packages/13/3b/c99b43fae5047276ea9d944077c190fc1e5f22f57528b9794e21f7adedc6/blake3-1.0.8-cp313-cp313t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:6ae7754c7d96e92a70a52e07c732d594cf9924d780f49fffd3a1e9235e0f5ba7", size = 507323, upload-time = "2025-10-14T06:46:30.661Z" },
-    { url = "https://files.pythonhosted.org/packages/fc/bb/ba90eddd592f8c074a0694cb0a744b6bd76bfe67a14c2b490c8bdfca3119/blake3-1.0.8-cp313-cp313t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:4bacaae75e98dee3b7da6c5ee3b81ee21a3352dd2477d6f1d1dbfd38cdbf158a", size = 393449, upload-time = "2025-10-14T06:46:31.805Z" },
-    { url = "https://files.pythonhosted.org/packages/25/ed/58a2acd0b9e14459cdaef4344db414d4a36e329b9720921b442a454dd443/blake3-1.0.8-cp313-cp313t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:9456c829601d72852d8ba0af8dae0610f7def1d59f5942efde1e2ef93e8a8b57", size = 386844, upload-time = "2025-10-14T06:46:33.195Z" },
-    { url = "https://files.pythonhosted.org/packages/4a/04/fed09845b18d90862100c8e48308261e2f663aab25d3c71a6a0bdda6618b/blake3-1.0.8-cp313-cp313t-musllinux_1_1_aarch64.whl", hash = "sha256:497ef8096ec4ac1ffba9a66152cee3992337cebf8ea434331d8fd9ce5423d227", size = 549550, upload-time = "2025-10-14T06:46:35.23Z" },
-    { url = "https://files.pythonhosted.org/packages/d6/65/1859fddfabc1cc72548c2269d988819aad96d854e25eae00531517925901/blake3-1.0.8-cp313-cp313t-musllinux_1_1_x86_64.whl", hash = "sha256:511133bab85ff60ed143424ce484d08c60894ff7323f685d7a6095f43f0c85c3", size = 553805, upload-time = "2025-10-14T06:46:36.532Z" },
-    { url = "https://files.pythonhosted.org/packages/c1/c7/2969352017f62378e388bb07bb2191bc9a953f818dc1cd6b9dd5c24916e1/blake3-1.0.8-cp313-cp313t-win32.whl", hash = "sha256:9c9fbdacfdeb68f7ca53bb5a7a5a593ec996eaf21155ad5b08d35e6f97e60877", size = 228068, upload-time = "2025-10-14T06:46:37.826Z" },
-    { url = "https://files.pythonhosted.org/packages/d8/fc/923e25ac9cadfff1cd20038bcc0854d0f98061eb6bc78e42c43615f5982d/blake3-1.0.8-cp313-cp313t-win_amd64.whl", hash = "sha256:3cec94ed5676821cf371e9c9d25a41b4f3ebdb5724719b31b2749653b7cc1dfa", size = 215369, upload-time = "2025-10-14T06:46:39.054Z" },
-    { url = "https://files.pythonhosted.org/packages/2e/2a/9f13ea01b03b1b4751a1cc2b6c1ef4b782e19433a59cf35b59cafb2a2696/blake3-1.0.8-cp314-cp314-macosx_10_12_x86_64.whl", hash = "sha256:2c33dac2c6112bc23f961a7ca305c7e34702c8177040eb98d0389d13a347b9e1", size = 347016, upload-time = "2025-10-14T06:46:40.318Z" },
-    { url = "https://files.pythonhosted.org/packages/06/8e/8458c4285fbc5de76414f243e4e0fcab795d71a8b75324e14959aee699da/blake3-1.0.8-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:c445eff665d21c3b3b44f864f849a2225b1164c08654beb23224a02f087b7ff1", size = 324496, upload-time = "2025-10-14T06:46:42.355Z" },
-    { url = "https://files.pythonhosted.org/packages/49/fa/b913eb9cc4af708c03e01e6b88a8bb3a74833ba4ae4b16b87e2829198e06/blake3-1.0.8-cp314-cp314-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:a47939f04b89c5c6ff1e51e883e5efab1ea1bf01a02f4d208d216dddd63d0dd8", size = 370654, upload-time = "2025-10-14T06:46:43.907Z" },
-    { url = "https://files.pythonhosted.org/packages/7f/4f/245e0800c33b99c8f2b570d9a7199b51803694913ee4897f339648502933/blake3-1.0.8-cp314-cp314-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:73e0b4fa25f6e3078526a592fb38fca85ef204fd02eced6731e1cdd9396552d4", size = 374693, upload-time = "2025-10-14T06:46:45.186Z" },
-    { url = "https://files.pythonhosted.org/packages/a2/a6/8cb182c8e482071dbdfcc6ec0048271fd48bcb78782d346119ff54993700/blake3-1.0.8-cp314-cp314-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:4b0543c57eb9d6dac9d4bced63e9f7f7b546886ac04cec8da3c3d9c8f30cbbb7", size = 447673, upload-time = "2025-10-14T06:46:46.358Z" },
-    { url = "https://files.pythonhosted.org/packages/06/b7/1cbbb5574d2a9436d1b15e7eb5b9d82e178adcaca71a97b0fddaca4bfe3a/blake3-1.0.8-cp314-cp314-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:ed972ebd553c0c25363459e9fc71a38c045d8419e365b59acd8cd791eff13981", size = 507233, upload-time = "2025-10-14T06:46:48.109Z" },
-    { url = "https://files.pythonhosted.org/packages/9c/45/b55825d90af353b3e26c653bab278da9d6563afcf66736677f9397e465be/blake3-1.0.8-cp314-cp314-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:3bafdec95dfffa3f6571e529644744e280337df15ddd9728f224ba70c5779b23", size = 393852, upload-time = "2025-10-14T06:46:49.511Z" },
-    { url = "https://files.pythonhosted.org/packages/34/73/9058a1a457dd20491d1b37de53d6876eff125e1520d9b2dd7d0acbc88de2/blake3-1.0.8-cp314-cp314-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:2d78f06f3fb838b34c330e2987090376145cbe5944d8608a0c4779c779618f7b", size = 386442, upload-time = "2025-10-14T06:46:51.205Z" },
-    { url = "https://files.pythonhosted.org/packages/30/6d/561d537ffc17985e276e08bf4513f1c106f1fdbef571e782604dc4e44070/blake3-1.0.8-cp314-cp314-musllinux_1_1_aarch64.whl", hash = "sha256:dd03ff08d1b6e4fdda1cd03826f971ae8966ef6f683a8c68aa27fb21904b5aa9", size = 549929, upload-time = "2025-10-14T06:46:52.494Z" },
-    { url = "https://files.pythonhosted.org/packages/03/2f/dbe20d2c57f1a67c63be4ba310bcebc707b945c902a0bde075d2a8f5cd5c/blake3-1.0.8-cp314-cp314-musllinux_1_1_x86_64.whl", hash = "sha256:4e02a3c499e35bf51fc15b2738aca1a76410804c877bcd914752cac4f71f052a", size = 553750, upload-time = "2025-10-14T06:46:54.194Z" },
-    { url = "https://files.pythonhosted.org/packages/6b/da/c6cb712663c869b2814870c2798e57289c4268c5ac5fb12d467fce244860/blake3-1.0.8-cp314-cp314-win32.whl", hash = "sha256:a585357d5d8774aad9ffc12435de457f9e35cde55e0dc8bc43ab590a6929e59f", size = 228404, upload-time = "2025-10-14T06:46:56.807Z" },
-    { url = "https://files.pythonhosted.org/packages/dc/b6/c7dcd8bc3094bba1c4274e432f9e77a7df703532ca000eaa550bd066b870/blake3-1.0.8-cp314-cp314-win_amd64.whl", hash = "sha256:9ab5998e2abd9754819753bc2f1cf3edf82d95402bff46aeef45ed392a5468bf", size = 215460, upload-time = "2025-10-14T06:46:58.15Z" },
-    { url = "https://files.pythonhosted.org/packages/75/3c/6c8afd856c353176836daa5cc33a7989e8f54569e9d53eb1c53fc8f80c34/blake3-1.0.8-cp314-cp314t-macosx_10_12_x86_64.whl", hash = "sha256:e2df12f295f95a804338bd300e8fad4a6f54fd49bd4d9c5893855a230b5188a8", size = 347482, upload-time = "2025-10-14T06:47:00.189Z" },
-    { url = "https://files.pythonhosted.org/packages/6a/35/92cd5501ce8e1f5cabdc0c3ac62d69fdb13ff0b60b62abbb2b6d0a53a790/blake3-1.0.8-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:63379be58438878eeb76ebe4f0efbeaabf42b79f2cff23b6126b7991588ced67", size = 324376, upload-time = "2025-10-14T06:47:01.413Z" },
-    { url = "https://files.pythonhosted.org/packages/11/33/503b37220a3e2e31917ef13722efd00055af51c5e88ae30974c733d7ece6/blake3-1.0.8-cp314-cp314t-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:88d527c247f9609dc1d45a08fd243e39f0d5300d54c57e048de24d4fa9240ebb", size = 370220, upload-time = "2025-10-14T06:47:02.573Z" },
-    { url = "https://files.pythonhosted.org/packages/3e/df/fe817843adf59516c04d44387bd643b422a3b0400ea95c6ede6a49920737/blake3-1.0.8-cp314-cp314t-manylinux_2_17_armv7l.manylinux2014_armv7l.whl", hash = "sha256:506a47897a11ebe8f3cdeb52f1365d6a2f83959e98ccb0c830f8f73277d4d358", size = 373454, upload-time = "2025-10-14T06:47:03.784Z" },
-    { url = "https://files.pythonhosted.org/packages/d1/4d/90a2a623575373dfc9b683f1bad1bf017feafa5a6d65d94fb09543050740/blake3-1.0.8-cp314-cp314t-manylinux_2_17_i686.manylinux2014_i686.whl", hash = "sha256:e5122a61b3b004bbbd979bdf83a3aaab432da3e2a842d7ddf1c273f2503b4884", size = 447102, upload-time = "2025-10-14T06:47:04.958Z" },
-    { url = "https://files.pythonhosted.org/packages/93/ff/4e8ce314f60115c4c657b1fdbe9225b991da4f5bcc5d1c1f1d151e2f39d6/blake3-1.0.8-cp314-cp314t-manylinux_2_17_ppc64le.manylinux2014_ppc64le.whl", hash = "sha256:0171e85d56dec1219abdae5f49a0ed12cb3f86a454c29160a64fd8a8166bba37", size = 506791, upload-time = "2025-10-14T06:47:06.82Z" },
-    { url = "https://files.pythonhosted.org/packages/44/88/2963a1f18aab52bdcf35379b2b48c34bbc462320c37e76960636b8602c36/blake3-1.0.8-cp314-cp314t-manylinux_2_17_s390x.manylinux2014_s390x.whl", hash = "sha256:003f61e8c41dd9931edddf1cc6a1bb680fb2ac0ad15493ef4a1df9adc59ce9df", size = 393717, upload-time = "2025-10-14T06:47:09.085Z" },
-    { url = "https://files.pythonhosted.org/packages/45/d1/a848ed8e8d4e236b9b16381768c9ae99d92890c24886bb4505aa9c3d2033/blake3-1.0.8-cp314-cp314t-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:d2c3151955efb09ba58cd3e1263521e15e9e3866a40d6bd3556d86fc968e8f95", size = 386150, upload-time = "2025-10-14T06:47:10.363Z" },
-    { url = "https://files.pythonhosted.org/packages/96/09/e3eb5d60f97c01de23d9f434e6e1fc117efb466eaa1f6ddbbbcb62580d6e/blake3-1.0.8-cp314-cp314t-musllinux_1_1_aarch64.whl", hash = "sha256:5eb25bca3cee2e0dd746a214784fb36be6a43640c01c55b6b4e26196e72d076c", size = 549120, upload-time = "2025-10-14T06:47:11.713Z" },
-    { url = "https://files.pythonhosted.org/packages/14/ad/3d9661c710febb8957dd685fdb3e5a861aa0ac918eda3031365ce45789e2/blake3-1.0.8-cp314-cp314t-musllinux_1_1_x86_64.whl", hash = "sha256:ab4e1dea4fa857944944db78e8f20d99ee2e16b2dea5a14f514fb0607753ac83", size = 553264, upload-time = "2025-10-14T06:47:13.317Z" },
-    { url = "https://files.pythonhosted.org/packages/11/55/e332a5b49edf377d0690e95951cca21a00c568f6e37315f9749efee52617/blake3-1.0.8-cp314-cp314t-win32.whl", hash = "sha256:67f1bc11bf59464ef092488c707b13dd4e872db36e25c453dfb6e0c7498df9f1", size = 228116, upload-time = "2025-10-14T06:47:14.516Z" },
-    { url = "https://files.pythonhosted.org/packages/b0/5c/dbd00727a3dd165d7e0e8af40e630cd7e45d77b525a3218afaff8a87358e/blake3-1.0.8-cp314-cp314t-win_amd64.whl", hash = "sha256:421b99cdf1ff2d1bf703bc56c454f4b286fce68454dd8711abbcb5a0df90c19a", size = 215133, upload-time = "2025-10-14T06:47:16.069Z" },
-]
-
 [[package]]
 name = "caio"
 version = "0.9.24"
@@ -442,15 +365,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/76/f2/98fd8d0b514622a789fd2824b59bd6041b799aaeeba14a8d92d52f6654dd/cython-3.2.2-py3-none-any.whl", hash = "sha256:13b99ecb9482aff6a6c12d1ca6feef6940c507af909914b49f568de74fa965fb", size = 1255106, upload-time = "2025-11-30T12:48:18.454Z" },
 ]
 
-[[package]]
-name = "dnspython"
-version = "2.8.0"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/8c/8b/57666417c0f90f08bcafa776861060426765fdb422eb10212086fb811d26/dnspython-2.8.0.tar.gz", hash = "sha256:181d3c6996452cb1189c4046c61599b84a5a86e099562ffde77d26984ff26d0f", size = 368251, upload-time = "2025-09-07T18:58:00.022Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/ba/5a/18ad964b0086c6e62e2e7500f7edc89e3faa45033c71c1893d34eed2b2de/dnspython-2.8.0-py3-none-any.whl", hash = "sha256:01d9bbc4a2d76bf0db7c1f729812ded6d912bd318d3b1cf81d30c0f845dbf3af", size = 331094, upload-time = "2025-09-07T18:57:58.071Z" },
-]
-
 [[package]]
 name = "elastic-transport"
 version = "8.17.1"
@@ -784,94 +698,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/b3/38/89ba8ad64ae25be8de66a6d463314cf1eb366222074cfda9ee839c56a4b4/mdurl-0.1.2-py3-none-any.whl", hash = "sha256:84008a41e51615a49fc9966191ff91509e3c40b939176e643fd50a5c2196b8f8", size = 9979, upload-time = "2022-08-14T12:40:09.779Z" },
 ]
 
-[[package]]
-name = "mmh3"
-version = "5.2.0"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/a7/af/f28c2c2f51f31abb4725f9a64bc7863d5f491f6539bd26aee2a1d21a649e/mmh3-5.2.0.tar.gz", hash = "sha256:1efc8fec8478e9243a78bb993422cf79f8ff85cb4cf6b79647480a31e0d950a8", size = 33582, upload-time = "2025-07-29T07:43:48.49Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/bf/6a/d5aa7edb5c08e0bd24286c7d08341a0446f9a2fbbb97d96a8a6dd81935ee/mmh3-5.2.0-cp312-cp312-macosx_10_13_universal2.whl", hash = "sha256:384eda9361a7bf83a85e09447e1feafe081034af9dd428893701b959230d84be", size = 56141, upload-time = "2025-07-29T07:42:13.456Z" },
-    { url = "https://files.pythonhosted.org/packages/08/49/131d0fae6447bc4a7299ebdb1a6fb9d08c9f8dcf97d75ea93e8152ddf7ab/mmh3-5.2.0-cp312-cp312-macosx_10_13_x86_64.whl", hash = "sha256:2c9da0d568569cc87315cb063486d761e38458b8ad513fedd3dc9263e1b81bcd", size = 40681, upload-time = "2025-07-29T07:42:14.306Z" },
-    { url = "https://files.pythonhosted.org/packages/8f/6f/9221445a6bcc962b7f5ff3ba18ad55bba624bacdc7aa3fc0a518db7da8ec/mmh3-5.2.0-cp312-cp312-macosx_11_0_arm64.whl", hash = "sha256:86d1be5d63232e6eb93c50881aea55ff06eb86d8e08f9b5417c8c9b10db9db96", size = 40062, upload-time = "2025-07-29T07:42:15.08Z" },
-    { url = "https://files.pythonhosted.org/packages/1e/d4/6bb2d0fef81401e0bb4c297d1eb568b767de4ce6fc00890bc14d7b51ecc4/mmh3-5.2.0-cp312-cp312-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:bf7bee43e17e81671c447e9c83499f53d99bf440bc6d9dc26a841e21acfbe094", size = 97333, upload-time = "2025-07-29T07:42:16.436Z" },
-    { url = "https://files.pythonhosted.org/packages/44/e0/ccf0daff8134efbb4fbc10a945ab53302e358c4b016ada9bf97a6bdd50c1/mmh3-5.2.0-cp312-cp312-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:7aa18cdb58983ee660c9c400b46272e14fa253c675ed963d3812487f8ca42037", size = 103310, upload-time = "2025-07-29T07:42:17.796Z" },
-    { url = "https://files.pythonhosted.org/packages/02/63/1965cb08a46533faca0e420e06aff8bbaf9690a6f0ac6ae6e5b2e4544687/mmh3-5.2.0-cp312-cp312-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:ae9d032488fcec32d22be6542d1a836f00247f40f320844dbb361393b5b22773", size = 106178, upload-time = "2025-07-29T07:42:19.281Z" },
-    { url = "https://files.pythonhosted.org/packages/c2/41/c883ad8e2c234013f27f92061200afc11554ea55edd1bcf5e1accd803a85/mmh3-5.2.0-cp312-cp312-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:e1861fb6b1d0453ed7293200139c0a9011eeb1376632e048e3766945b13313c5", size = 113035, upload-time = "2025-07-29T07:42:20.356Z" },
-    { url = "https://files.pythonhosted.org/packages/df/b5/1ccade8b1fa625d634a18bab7bf08a87457e09d5ec8cf83ca07cbea9d400/mmh3-5.2.0-cp312-cp312-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:99bb6a4d809aa4e528ddfe2c85dd5239b78b9dd14be62cca0329db78505e7b50", size = 120784, upload-time = "2025-07-29T07:42:21.377Z" },
-    { url = "https://files.pythonhosted.org/packages/77/1c/919d9171fcbdcdab242e06394464ccf546f7d0f3b31e0d1e3a630398782e/mmh3-5.2.0-cp312-cp312-musllinux_1_2_aarch64.whl", hash = "sha256:1f8d8b627799f4e2fcc7c034fed8f5f24dc7724ff52f69838a3d6d15f1ad4765", size = 99137, upload-time = "2025-07-29T07:42:22.344Z" },
-    { url = "https://files.pythonhosted.org/packages/66/8a/1eebef5bd6633d36281d9fc83cf2e9ba1ba0e1a77dff92aacab83001cee4/mmh3-5.2.0-cp312-cp312-musllinux_1_2_i686.whl", hash = "sha256:b5995088dd7023d2d9f310a0c67de5a2b2e06a570ecfd00f9ff4ab94a67cde43", size = 98664, upload-time = "2025-07-29T07:42:23.269Z" },
-    { url = "https://files.pythonhosted.org/packages/13/41/a5d981563e2ee682b21fb65e29cc0f517a6734a02b581359edd67f9d0360/mmh3-5.2.0-cp312-cp312-musllinux_1_2_ppc64le.whl", hash = "sha256:1a5f4d2e59d6bba8ef01b013c472741835ad961e7c28f50c82b27c57748744a4", size = 106459, upload-time = "2025-07-29T07:42:24.238Z" },
-    { url = "https://files.pythonhosted.org/packages/24/31/342494cd6ab792d81e083680875a2c50fa0c5df475ebf0b67784f13e4647/mmh3-5.2.0-cp312-cp312-musllinux_1_2_s390x.whl", hash = "sha256:fd6e6c3d90660d085f7e73710eab6f5545d4854b81b0135a3526e797009dbda3", size = 110038, upload-time = "2025-07-29T07:42:25.629Z" },
-    { url = "https://files.pythonhosted.org/packages/28/44/efda282170a46bb4f19c3e2b90536513b1d821c414c28469a227ca5a1789/mmh3-5.2.0-cp312-cp312-musllinux_1_2_x86_64.whl", hash = "sha256:c4a2f3d83879e3de2eb8cbf562e71563a8ed15ee9b9c2e77ca5d9f73072ac15c", size = 97545, upload-time = "2025-07-29T07:42:27.04Z" },
-    { url = "https://files.pythonhosted.org/packages/68/8f/534ae319c6e05d714f437e7206f78c17e66daca88164dff70286b0e8ea0c/mmh3-5.2.0-cp312-cp312-win32.whl", hash = "sha256:2421b9d665a0b1ad724ec7332fb5a98d075f50bc51a6ff854f3a1882bd650d49", size = 40805, upload-time = "2025-07-29T07:42:28.032Z" },
-    { url = "https://files.pythonhosted.org/packages/b8/f6/f6abdcfefcedab3c964868048cfe472764ed358c2bf6819a70dd4ed4ed3a/mmh3-5.2.0-cp312-cp312-win_amd64.whl", hash = "sha256:72d80005b7634a3a2220f81fbeb94775ebd12794623bb2e1451701ea732b4aa3", size = 41597, upload-time = "2025-07-29T07:42:28.894Z" },
-    { url = "https://files.pythonhosted.org/packages/15/fd/f7420e8cbce45c259c770cac5718badf907b302d3a99ec587ba5ce030237/mmh3-5.2.0-cp312-cp312-win_arm64.whl", hash = "sha256:3d6bfd9662a20c054bc216f861fa330c2dac7c81e7fb8307b5e32ab5b9b4d2e0", size = 39350, upload-time = "2025-07-29T07:42:29.794Z" },
-    { url = "https://files.pythonhosted.org/packages/d8/fa/27f6ab93995ef6ad9f940e96593c5dd24744d61a7389532b0fec03745607/mmh3-5.2.0-cp313-cp313-android_21_arm64_v8a.whl", hash = "sha256:e79c00eba78f7258e5b354eccd4d7907d60317ced924ea4a5f2e9d83f5453065", size = 40874, upload-time = "2025-07-29T07:42:30.662Z" },
-    { url = "https://files.pythonhosted.org/packages/11/9c/03d13bcb6a03438bc8cac3d2e50f80908d159b31a4367c2e1a7a077ded32/mmh3-5.2.0-cp313-cp313-android_21_x86_64.whl", hash = "sha256:956127e663d05edbeec54df38885d943dfa27406594c411139690485128525de", size = 42012, upload-time = "2025-07-29T07:42:31.539Z" },
-    { url = "https://files.pythonhosted.org/packages/4e/78/0865d9765408a7d504f1789944e678f74e0888b96a766d578cb80b040999/mmh3-5.2.0-cp313-cp313-ios_13_0_arm64_iphoneos.whl", hash = "sha256:c3dca4cb5b946ee91b3d6bb700d137b1cd85c20827f89fdf9c16258253489044", size = 39197, upload-time = "2025-07-29T07:42:32.374Z" },
-    { url = "https://files.pythonhosted.org/packages/3e/12/76c3207bd186f98b908b6706c2317abb73756d23a4e68ea2bc94825b9015/mmh3-5.2.0-cp313-cp313-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:e651e17bfde5840e9e4174b01e9e080ce49277b70d424308b36a7969d0d1af73", size = 39840, upload-time = "2025-07-29T07:42:33.227Z" },
-    { url = "https://files.pythonhosted.org/packages/5d/0d/574b6cce5555c9f2b31ea189ad44986755eb14e8862db28c8b834b8b64dc/mmh3-5.2.0-cp313-cp313-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:9f64bf06f4bf623325fda3a6d02d36cd69199b9ace99b04bb2d7fd9f89688504", size = 40644, upload-time = "2025-07-29T07:42:34.099Z" },
-    { url = "https://files.pythonhosted.org/packages/52/82/3731f8640b79c46707f53ed72034a58baad400be908c87b0088f1f89f986/mmh3-5.2.0-cp313-cp313-macosx_10_13_universal2.whl", hash = "sha256:ddc63328889bcaee77b743309e5c7d2d52cee0d7d577837c91b6e7cc9e755e0b", size = 56153, upload-time = "2025-07-29T07:42:35.031Z" },
-    { url = "https://files.pythonhosted.org/packages/4f/34/e02dca1d4727fd9fdeaff9e2ad6983e1552804ce1d92cc796e5b052159bb/mmh3-5.2.0-cp313-cp313-macosx_10_13_x86_64.whl", hash = "sha256:bb0fdc451fb6d86d81ab8f23d881b8d6e37fc373a2deae1c02d27002d2ad7a05", size = 40684, upload-time = "2025-07-29T07:42:35.914Z" },
-    { url = "https://files.pythonhosted.org/packages/8f/36/3dee40767356e104967e6ed6d102ba47b0b1ce2a89432239b95a94de1b89/mmh3-5.2.0-cp313-cp313-macosx_11_0_arm64.whl", hash = "sha256:b29044e1ffdb84fe164d0a7ea05c7316afea93c00f8ed9449cf357c36fc4f814", size = 40057, upload-time = "2025-07-29T07:42:36.755Z" },
-    { url = "https://files.pythonhosted.org/packages/31/58/228c402fccf76eb39a0a01b8fc470fecf21965584e66453b477050ee0e99/mmh3-5.2.0-cp313-cp313-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:58981d6ea9646dbbf9e59a30890cbf9f610df0e4a57dbfe09215116fd90b0093", size = 97344, upload-time = "2025-07-29T07:42:37.675Z" },
-    { url = "https://files.pythonhosted.org/packages/34/82/fc5ce89006389a6426ef28e326fc065b0fbaaed230373b62d14c889f47ea/mmh3-5.2.0-cp313-cp313-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:7e5634565367b6d98dc4aa2983703526ef556b3688ba3065edb4b9b90ede1c54", size = 103325, upload-time = "2025-07-29T07:42:38.591Z" },
-    { url = "https://files.pythonhosted.org/packages/09/8c/261e85777c6aee1ebd53f2f17e210e7481d5b0846cd0b4a5c45f1e3761b8/mmh3-5.2.0-cp313-cp313-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b0271ac12415afd3171ab9a3c7cbfc71dee2c68760a7dc9d05bf8ed6ddfa3a7a", size = 106240, upload-time = "2025-07-29T07:42:39.563Z" },
-    { url = "https://files.pythonhosted.org/packages/70/73/2f76b3ad8a3d431824e9934403df36c0ddacc7831acf82114bce3c4309c8/mmh3-5.2.0-cp313-cp313-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:45b590e31bc552c6f8e2150ff1ad0c28dd151e9f87589e7eaf508fbdd8e8e908", size = 113060, upload-time = "2025-07-29T07:42:40.585Z" },
-    { url = "https://files.pythonhosted.org/packages/9f/b9/7ea61a34e90e50a79a9d87aa1c0b8139a7eaf4125782b34b7d7383472633/mmh3-5.2.0-cp313-cp313-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:bdde97310d59604f2a9119322f61b31546748499a21b44f6715e8ced9308a6c5", size = 120781, upload-time = "2025-07-29T07:42:41.618Z" },
-    { url = "https://files.pythonhosted.org/packages/0f/5b/ae1a717db98c7894a37aeedbd94b3f99e6472a836488f36b6849d003485b/mmh3-5.2.0-cp313-cp313-musllinux_1_2_aarch64.whl", hash = "sha256:fc9c5f280438cf1c1a8f9abb87dc8ce9630a964120cfb5dd50d1e7ce79690c7a", size = 99174, upload-time = "2025-07-29T07:42:42.587Z" },
-    { url = "https://files.pythonhosted.org/packages/e3/de/000cce1d799fceebb6d4487ae29175dd8e81b48e314cba7b4da90bcf55d7/mmh3-5.2.0-cp313-cp313-musllinux_1_2_i686.whl", hash = "sha256:c903e71fd8debb35ad2a4184c1316b3cb22f64ce517b4e6747f25b0a34e41266", size = 98734, upload-time = "2025-07-29T07:42:43.996Z" },
-    { url = "https://files.pythonhosted.org/packages/79/19/0dc364391a792b72fbb22becfdeacc5add85cc043cd16986e82152141883/mmh3-5.2.0-cp313-cp313-musllinux_1_2_ppc64le.whl", hash = "sha256:eed4bba7ff8a0d37106ba931ab03bdd3915fbb025bcf4e1f0aa02bc8114960c5", size = 106493, upload-time = "2025-07-29T07:42:45.07Z" },
-    { url = "https://files.pythonhosted.org/packages/3c/b1/bc8c28e4d6e807bbb051fefe78e1156d7f104b89948742ad310612ce240d/mmh3-5.2.0-cp313-cp313-musllinux_1_2_s390x.whl", hash = "sha256:1fdb36b940e9261aff0b5177c5b74a36936b902f473180f6c15bde26143681a9", size = 110089, upload-time = "2025-07-29T07:42:46.122Z" },
-    { url = "https://files.pythonhosted.org/packages/3b/a2/d20f3f5c95e9c511806686c70d0a15479cc3941c5f322061697af1c1ff70/mmh3-5.2.0-cp313-cp313-musllinux_1_2_x86_64.whl", hash = "sha256:7303aab41e97adcf010a09efd8f1403e719e59b7705d5e3cfed3dd7571589290", size = 97571, upload-time = "2025-07-29T07:42:47.18Z" },
-    { url = "https://files.pythonhosted.org/packages/7b/23/665296fce4f33488deec39a750ffd245cfc07aafb0e3ef37835f91775d14/mmh3-5.2.0-cp313-cp313-win32.whl", hash = "sha256:03e08c6ebaf666ec1e3d6ea657a2d363bb01effd1a9acfe41f9197decaef0051", size = 40806, upload-time = "2025-07-29T07:42:48.166Z" },
-    { url = "https://files.pythonhosted.org/packages/59/b0/92e7103f3b20646e255b699e2d0327ce53a3f250e44367a99dc8be0b7c7a/mmh3-5.2.0-cp313-cp313-win_amd64.whl", hash = "sha256:7fddccd4113e7b736706e17a239a696332360cbaddf25ae75b57ba1acce65081", size = 41600, upload-time = "2025-07-29T07:42:49.371Z" },
-    { url = "https://files.pythonhosted.org/packages/99/22/0b2bd679a84574647de538c5b07ccaa435dbccc37815067fe15b90fe8dad/mmh3-5.2.0-cp313-cp313-win_arm64.whl", hash = "sha256:fa0c966ee727aad5406d516375593c5f058c766b21236ab8985693934bb5085b", size = 39349, upload-time = "2025-07-29T07:42:50.268Z" },
-    { url = "https://files.pythonhosted.org/packages/f7/ca/a20db059a8a47048aaf550da14a145b56e9c7386fb8280d3ce2962dcebf7/mmh3-5.2.0-cp314-cp314-ios_13_0_arm64_iphoneos.whl", hash = "sha256:e5015f0bb6eb50008bed2d4b1ce0f2a294698a926111e4bb202c0987b4f89078", size = 39209, upload-time = "2025-07-29T07:42:51.559Z" },
-    { url = "https://files.pythonhosted.org/packages/98/dd/e5094799d55c7482d814b979a0fd608027d0af1b274bfb4c3ea3e950bfd5/mmh3-5.2.0-cp314-cp314-ios_13_0_arm64_iphonesimulator.whl", hash = "sha256:e0f3ed828d709f5b82d8bfe14f8856120718ec4bd44a5b26102c3030a1e12501", size = 39843, upload-time = "2025-07-29T07:42:52.536Z" },
-    { url = "https://files.pythonhosted.org/packages/f4/6b/7844d7f832c85400e7cc89a1348e4e1fdd38c5a38415bb5726bbb8fcdb6c/mmh3-5.2.0-cp314-cp314-ios_13_0_x86_64_iphonesimulator.whl", hash = "sha256:f35727c5118aba95f0397e18a1a5b8405425581bfe53e821f0fb444cbdc2bc9b", size = 40648, upload-time = "2025-07-29T07:42:53.392Z" },
-    { url = "https://files.pythonhosted.org/packages/1f/bf/71f791f48a21ff3190ba5225807cbe4f7223360e96862c376e6e3fb7efa7/mmh3-5.2.0-cp314-cp314-macosx_10_13_universal2.whl", hash = "sha256:3bc244802ccab5220008cb712ca1508cb6a12f0eb64ad62997156410579a1770", size = 56164, upload-time = "2025-07-29T07:42:54.267Z" },
-    { url = "https://files.pythonhosted.org/packages/70/1f/f87e3d34d83032b4f3f0f528c6d95a98290fcacf019da61343a49dccfd51/mmh3-5.2.0-cp314-cp314-macosx_10_13_x86_64.whl", hash = "sha256:ff3d50dc3fe8a98059f99b445dfb62792b5d006c5e0b8f03c6de2813b8376110", size = 40692, upload-time = "2025-07-29T07:42:55.234Z" },
-    { url = "https://files.pythonhosted.org/packages/a6/e2/db849eaed07117086f3452feca8c839d30d38b830ac59fe1ce65af8be5ad/mmh3-5.2.0-cp314-cp314-macosx_11_0_arm64.whl", hash = "sha256:37a358cc881fe796e099c1db6ce07ff757f088827b4e8467ac52b7a7ffdca647", size = 40068, upload-time = "2025-07-29T07:42:56.158Z" },
-    { url = "https://files.pythonhosted.org/packages/df/6b/209af927207af77425b044e32f77f49105a0b05d82ff88af6971d8da4e19/mmh3-5.2.0-cp314-cp314-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:b9a87025121d1c448f24f27ff53a5fe7b6ef980574b4a4f11acaabe702420d63", size = 97367, upload-time = "2025-07-29T07:42:57.037Z" },
-    { url = "https://files.pythonhosted.org/packages/ca/e0/78adf4104c425606a9ce33fb351f790c76a6c2314969c4a517d1ffc92196/mmh3-5.2.0-cp314-cp314-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:1ba55d6ca32eeef8b2625e1e4bfc3b3db52bc63014bd7e5df8cc11bf2b036b12", size = 103306, upload-time = "2025-07-29T07:42:58.522Z" },
-    { url = "https://files.pythonhosted.org/packages/a3/79/c2b89f91b962658b890104745b1b6c9ce38d50a889f000b469b91eeb1b9e/mmh3-5.2.0-cp314-cp314-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:c9ff37ba9f15637e424c2ab57a1a590c52897c845b768e4e0a4958084ec87f22", size = 106312, upload-time = "2025-07-29T07:42:59.552Z" },
-    { url = "https://files.pythonhosted.org/packages/4b/14/659d4095528b1a209be90934778c5ffe312177d51e365ddcbca2cac2ec7c/mmh3-5.2.0-cp314-cp314-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:a094319ec0db52a04af9fdc391b4d39a1bc72bc8424b47c4411afb05413a44b5", size = 113135, upload-time = "2025-07-29T07:43:00.745Z" },
-    { url = "https://files.pythonhosted.org/packages/8d/6f/cd7734a779389a8a467b5c89a48ff476d6f2576e78216a37551a97e9e42a/mmh3-5.2.0-cp314-cp314-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:c5584061fd3da584659b13587f26c6cad25a096246a481636d64375d0c1f6c07", size = 120775, upload-time = "2025-07-29T07:43:02.124Z" },
-    { url = "https://files.pythonhosted.org/packages/1d/ca/8256e3b96944408940de3f9291d7e38a283b5761fe9614d4808fcf27bd62/mmh3-5.2.0-cp314-cp314-musllinux_1_2_aarch64.whl", hash = "sha256:ecbfc0437ddfdced5e7822d1ce4855c9c64f46819d0fdc4482c53f56c707b935", size = 99178, upload-time = "2025-07-29T07:43:03.182Z" },
-    { url = "https://files.pythonhosted.org/packages/8a/32/39e2b3cf06b6e2eb042c984dab8680841ac2a0d3ca6e0bea30db1f27b565/mmh3-5.2.0-cp314-cp314-musllinux_1_2_i686.whl", hash = "sha256:7b986d506a8e8ea345791897ba5d8ba0d9d8820cd4fc3e52dbe6de19388de2e7", size = 98738, upload-time = "2025-07-29T07:43:04.207Z" },
-    { url = "https://files.pythonhosted.org/packages/61/d3/7bbc8e0e8cf65ebbe1b893ffa0467b7ecd1bd07c3bbf6c9db4308ada22ec/mmh3-5.2.0-cp314-cp314-musllinux_1_2_ppc64le.whl", hash = "sha256:38d899a156549da8ef6a9f1d6f7ef231228d29f8f69bce2ee12f5fba6d6fd7c5", size = 106510, upload-time = "2025-07-29T07:43:05.656Z" },
-    { url = "https://files.pythonhosted.org/packages/10/99/b97e53724b52374e2f3859046f0eb2425192da356cb19784d64bc17bb1cf/mmh3-5.2.0-cp314-cp314-musllinux_1_2_s390x.whl", hash = "sha256:d86651fa45799530885ba4dab3d21144486ed15285e8784181a0ab37a4552384", size = 110053, upload-time = "2025-07-29T07:43:07.204Z" },
-    { url = "https://files.pythonhosted.org/packages/ac/62/3688c7d975ed195155671df68788c83fed6f7909b6ec4951724c6860cb97/mmh3-5.2.0-cp314-cp314-musllinux_1_2_x86_64.whl", hash = "sha256:c463d7c1c4cfc9d751efeaadd936bbba07b5b0ed81a012b3a9f5a12f0872bd6e", size = 97546, upload-time = "2025-07-29T07:43:08.226Z" },
-    { url = "https://files.pythonhosted.org/packages/ca/3b/c6153250f03f71a8b7634cded82939546cdfba02e32f124ff51d52c6f991/mmh3-5.2.0-cp314-cp314-win32.whl", hash = "sha256:bb4fe46bdc6104fbc28db7a6bacb115ee6368ff993366bbd8a2a7f0076e6f0c0", size = 41422, upload-time = "2025-07-29T07:43:09.216Z" },
-    { url = "https://files.pythonhosted.org/packages/74/01/a27d98bab083a435c4c07e9d1d720d4c8a578bf4c270bae373760b1022be/mmh3-5.2.0-cp314-cp314-win_amd64.whl", hash = "sha256:7c7f0b342fd06044bedd0b6e72177ddc0076f54fd89ee239447f8b271d919d9b", size = 42135, upload-time = "2025-07-29T07:43:10.183Z" },
-    { url = "https://files.pythonhosted.org/packages/cb/c9/dbba5507e95429b8b380e2ba091eff5c20a70a59560934dff0ad8392b8c8/mmh3-5.2.0-cp314-cp314-win_arm64.whl", hash = "sha256:3193752fc05ea72366c2b63ff24b9a190f422e32d75fdeae71087c08fff26115", size = 39879, upload-time = "2025-07-29T07:43:11.106Z" },
-    { url = "https://files.pythonhosted.org/packages/b5/d1/c8c0ef839c17258b9de41b84f663574fabcf8ac2007b7416575e0f65ff6e/mmh3-5.2.0-cp314-cp314t-macosx_10_13_universal2.whl", hash = "sha256:69fc339d7202bea69ef9bd7c39bfdf9fdabc8e6822a01eba62fb43233c1b3932", size = 57696, upload-time = "2025-07-29T07:43:11.989Z" },
-    { url = "https://files.pythonhosted.org/packages/2f/55/95e2b9ff201e89f9fe37036037ab61a6c941942b25cdb7b6a9df9b931993/mmh3-5.2.0-cp314-cp314t-macosx_10_13_x86_64.whl", hash = "sha256:12da42c0a55c9d86ab566395324213c319c73ecb0c239fad4726324212b9441c", size = 41421, upload-time = "2025-07-29T07:43:13.269Z" },
-    { url = "https://files.pythonhosted.org/packages/77/79/9be23ad0b7001a4b22752e7693be232428ecc0a35068a4ff5c2f14ef8b20/mmh3-5.2.0-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:f7f9034c7cf05ddfaac8d7a2e63a3c97a840d4615d0a0e65ba8bdf6f8576e3be", size = 40853, upload-time = "2025-07-29T07:43:14.888Z" },
-    { url = "https://files.pythonhosted.org/packages/ac/1b/96b32058eda1c1dee8264900c37c359a7325c1f11f5ff14fd2be8e24eff9/mmh3-5.2.0-cp314-cp314t-manylinux1_i686.manylinux_2_28_i686.manylinux_2_5_i686.whl", hash = "sha256:11730eeb16dfcf9674fdea9bb6b8e6dd9b40813b7eb839bc35113649eef38aeb", size = 109694, upload-time = "2025-07-29T07:43:15.816Z" },
-    { url = "https://files.pythonhosted.org/packages/8d/6f/a2ae44cd7dad697b6dea48390cbc977b1e5ca58fda09628cbcb2275af064/mmh3-5.2.0-cp314-cp314t-manylinux1_x86_64.manylinux_2_28_x86_64.manylinux_2_5_x86_64.whl", hash = "sha256:932a6eec1d2e2c3c9e630d10f7128d80e70e2d47fe6b8c7ea5e1afbd98733e65", size = 117438, upload-time = "2025-07-29T07:43:16.865Z" },
-    { url = "https://files.pythonhosted.org/packages/a0/08/bfb75451c83f05224a28afeaf3950c7b793c0b71440d571f8e819cfb149a/mmh3-5.2.0-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:3ca975c51c5028947bbcfc24966517aac06a01d6c921e30f7c5383c195f87991", size = 120409, upload-time = "2025-07-29T07:43:18.207Z" },
-    { url = "https://files.pythonhosted.org/packages/9f/ea/8b118b69b2ff8df568f742387d1a159bc654a0f78741b31437dd047ea28e/mmh3-5.2.0-cp314-cp314t-manylinux2014_ppc64le.manylinux_2_17_ppc64le.manylinux_2_28_ppc64le.whl", hash = "sha256:5b0b58215befe0f0e120b828f7645e97719bbba9f23b69e268ed0ac7adde8645", size = 125909, upload-time = "2025-07-29T07:43:19.39Z" },
-    { url = "https://files.pythonhosted.org/packages/3e/11/168cc0b6a30650032e351a3b89b8a47382da541993a03af91e1ba2501234/mmh3-5.2.0-cp314-cp314t-manylinux2014_s390x.manylinux_2_17_s390x.manylinux_2_28_s390x.whl", hash = "sha256:29c2b9ce61886809d0492a274a5a53047742dea0f703f9c4d5d223c3ea6377d3", size = 135331, upload-time = "2025-07-29T07:43:20.435Z" },
-    { url = "https://files.pythonhosted.org/packages/31/05/e3a9849b1c18a7934c64e831492c99e67daebe84a8c2f2c39a7096a830e3/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_aarch64.whl", hash = "sha256:a367d4741ac0103f8198c82f429bccb9359f543ca542b06a51f4f0332e8de279", size = 110085, upload-time = "2025-07-29T07:43:21.92Z" },
-    { url = "https://files.pythonhosted.org/packages/d9/d5/a96bcc306e3404601418b2a9a370baec92af84204528ba659fdfe34c242f/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_i686.whl", hash = "sha256:5a5dba98e514fb26241868f6eb90a7f7ca0e039aed779342965ce24ea32ba513", size = 111195, upload-time = "2025-07-29T07:43:23.066Z" },
-    { url = "https://files.pythonhosted.org/packages/af/29/0fd49801fec5bff37198684e0849b58e0dab3a2a68382a357cfffb0fafc3/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_ppc64le.whl", hash = "sha256:941603bfd75a46023807511c1ac2f1b0f39cccc393c15039969806063b27e6db", size = 116919, upload-time = "2025-07-29T07:43:24.178Z" },
-    { url = "https://files.pythonhosted.org/packages/2d/04/4f3c32b0a2ed762edca45d8b46568fc3668e34f00fb1e0a3b5451ec1281c/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_s390x.whl", hash = "sha256:132dd943451a7c7546978863d2f5a64977928410782e1a87d583cb60eb89e667", size = 123160, upload-time = "2025-07-29T07:43:25.26Z" },
-    { url = "https://files.pythonhosted.org/packages/91/76/3d29eaa38821730633d6a240d36fa8ad2807e9dfd432c12e1a472ed211eb/mmh3-5.2.0-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:f698733a8a494466432d611a8f0d1e026f5286dee051beea4b3c3146817e35d5", size = 110206, upload-time = "2025-07-29T07:43:26.699Z" },
-    { url = "https://files.pythonhosted.org/packages/44/1c/ccf35892684d3a408202e296e56843743e0b4fb1629e59432ea88cdb3909/mmh3-5.2.0-cp314-cp314t-win32.whl", hash = "sha256:6d541038b3fc360ec538fc116de87462627944765a6750308118f8b509a8eec7", size = 41970, upload-time = "2025-07-29T07:43:27.666Z" },
-    { url = "https://files.pythonhosted.org/packages/75/b2/b9e4f1e5adb5e21eb104588fcee2cd1eaa8308255173481427d5ecc4284e/mmh3-5.2.0-cp314-cp314t-win_amd64.whl", hash = "sha256:e912b19cf2378f2967d0c08e86ff4c6c360129887f678e27e4dde970d21b3f4d", size = 43063, upload-time = "2025-07-29T07:43:28.582Z" },
-    { url = "https://files.pythonhosted.org/packages/6a/fc/0e61d9a4e29c8679356795a40e48f647b4aad58d71bfc969f0f8f56fb912/mmh3-5.2.0-cp314-cp314t-win_arm64.whl", hash = "sha256:e7884931fe5e788163e7b3c511614130c2c59feffdc21112290a194487efb2e9", size = 40455, upload-time = "2025-07-29T07:43:29.563Z" },
-]
-
-[[package]]
-name = "morphys"
-version = "1.0"
-source = { registry = "https://pypi.org/simple" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/f9/4f/cb781d0ac5d079adabc77dc4f0bc99fc81c390029bd33c6e70552139e762/morphys-1.0-py2.py3-none-any.whl", hash = "sha256:76d6dbaa4d65f597e59d332c81da786d83e4669387b9b2a750cfec74e7beec20", size = 5618, upload-time = "2017-01-10T20:08:56.872Z" },
-]
-
 [[package]]
 name = "msgspec"
 version = "0.19.0"
@@ -894,29 +720,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/23/d8/f15b40611c2d5753d1abb0ca0da0c75348daf1252220e5dda2867bd81062/msgspec-0.19.0-cp313-cp313-win_amd64.whl", hash = "sha256:317050bc0f7739cb30d257ff09152ca309bf5a369854bbf1e57dffc310c1f20f", size = 187432, upload-time = "2024-12-27T17:40:16.256Z" },
 ]
 
-[[package]]
-name = "multiaddr"
-version = "0.1.1"
-source = { registry = "https://pypi.org/simple" }
-dependencies = [
-    { name = "base58" },
-    { name = "dnspython" },
-    { name = "idna" },
-    { name = "netaddr" },
-    { name = "psutil" },
-    { name = "py-cid" },
-    { name = "py-multibase" },
-    { name = "py-multicodec" },
-    { name = "py-multihash" },
-    { name = "trio" },
-    { name = "trio-typing" },
-    { name = "varint" },
-]
-sdist = { url = "https://files.pythonhosted.org/packages/cf/5c/6d27f2b04c54e7c85b4a05760ac7dfaa7c68214b917e0d4a5043c01cf231/multiaddr-0.1.1.tar.gz", hash = "sha256:04da0afd2097625569073776526eb9733db9d9713286bada44632a9d7275b9bb", size = 54186, upload-time = "2025-12-07T17:19:07.996Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/07/ad/bd8a1748953a8f7a8167ec7d02eeefbed469595089d75e3fcb53047e7e20/multiaddr-0.1.1-py3-none-any.whl", hash = "sha256:d95333effddbd372009dbfce4d2ec922dd633697b6cc89a5af90ae082c4e68d4", size = 38374, upload-time = "2025-12-07T17:19:05.849Z" },
-]
-
 [[package]]
 name = "multidict"
 version = "6.7.0"
@@ -1034,15 +837,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/a0/c4/c2971a3ba4c6103a3d10c4b0f24f461ddc027f0f09763220cf35ca1401b3/nest_asyncio-1.6.0-py3-none-any.whl", hash = "sha256:87af6efd6b5e897c81050477ef65c62e2b2f35d51703cae01aff2905b1852e1c", size = 5195, upload-time = "2024-01-21T14:25:17.223Z" },
 ]
 
-[[package]]
-name = "netaddr"
-version = "1.3.0"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/54/90/188b2a69654f27b221fba92fda7217778208532c962509e959a9cee5229d/netaddr-1.3.0.tar.gz", hash = "sha256:5c3c3d9895b551b763779ba7db7a03487dc1f8e3b385af819af341ae9ef6e48a", size = 2260504, upload-time = "2024-05-28T21:30:37.743Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/12/cc/f4fe2c7ce68b92cbf5b2d379ca366e1edae38cccaad00f69f529b460c3ef/netaddr-1.3.0-py3-none-any.whl", hash = "sha256:c2c6a8ebe5554ce33b7d5b3a306b71bbb373e000bbbf2350dd5213cc56e3dbbe", size = 2262023, upload-time = "2024-05-28T21:30:34.191Z" },
-]
-
 [[package]]
 name = "numba"
 version = "0.62.1"
@@ -1206,18 +1000,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/6e/23/e98758924d1b3aac11a626268eabf7f3cf177e7837c28d47bf84c64532d0/pendulum-3.1.0-py3-none-any.whl", hash = "sha256:f9178c2a8e291758ade1e8dd6371b1d26d08371b4c7730a6e9a3ef8b16ebae0f", size = 111799, upload-time = "2025-04-19T14:02:34.739Z" },
 ]
 
-[[package]]
-name = "pexpect"
-version = "4.9.0"
-source = { registry = "https://pypi.org/simple" }
-dependencies = [
-    { name = "ptyprocess" },
-]
-sdist = { url = "https://files.pythonhosted.org/packages/42/92/cc564bf6381ff43ce1f4d06852fc19a2f11d180f23dc32d9588bee2f149d/pexpect-4.9.0.tar.gz", hash = "sha256:ee7d41123f3c9911050ea2c2dac107568dc43b2d3b0c7557a33212c398ead30f", size = 166450, upload-time = "2023-11-25T09:07:26.339Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/9e/c3/059298687310d527a58bb01f3b1965787ee3b40dce76752eda8b44e9a2c5/pexpect-4.9.0-py2.py3-none-any.whl", hash = "sha256:7236d1e080e4936be2dc3e326cec0af72acf9212a7e1d060210e70a47e253523", size = 63772, upload-time = "2023-11-25T06:56:14.81Z" },
-]
-
 [[package]]
 name = "piker"
 version = "0.1.0a0.dev0"
@@ -1265,7 +1047,6 @@ dev = [
     { name = "greenback" },
     { name = "i3ipc" },
     { name = "pdbp" },
-    { name = "pexpect" },
     { name = "prompt-toolkit" },
     { name = "pyperclip" },
     { name = "pyqt6" },
@@ -1281,7 +1062,6 @@ lint = [
 repl = [
     { name = "greenback" },
     { name = "pdbp" },
-    { name = "pexpect" },
     { name = "prompt-toolkit" },
     { name = "pyperclip" },
     { name = "xonsh" },
@@ -1319,7 +1099,7 @@ requires-dist = [
     { name = "tomli", specifier = ">=2.0.1,<3.0.0" },
     { name = "tomli-w", specifier = ">=1.0.0,<2.0.0" },
     { name = "tomlkit", git = "https://github.com/pikers/tomlkit.git?branch=piker_pin" },
-    { name = "tractor", editable = "../tractor" },
+    { name = "tractor", git = "https://github.com/goodboy/tractor.git?branch=piker_pin" },
     { name = "trio", specifier = ">=0.27" },
     { name = "trio-typing", specifier = ">=0.10.0" },
     { name = "trio-util", specifier = ">=0.7.0,<0.8.0" },
@@ -1336,29 +1116,27 @@ dev = [
     { name = "greenback", specifier = ">=1.1.1,<2.0.0" },
     { name = "i3ipc", specifier = ">=2.2.1" },
     { name = "pdbp", specifier = ">=1.8.2,<2.0.0" },
-    { name = "pexpect", specifier = ">=4.9.0" },
     { name = "prompt-toolkit", specifier = "==3.0.40" },
     { name = "pyperclip", specifier = ">=1.9.0" },
     { name = "pyqt6", specifier = ">=6.7.0,<7.0.0" },
-    { name = "pyqtgraph", git = "https://github.com/pyqtgraph/pyqtgraph.git?branch=master" },
+    { name = "pyqtgraph", git = "https://github.com/pikers/pyqtgraph.git" },
     { name = "pytest" },
     { name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" },
     { name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" },
-    { name = "xonsh", git = "https://github.com/xonsh/xonsh.git?branch=main" },
+    { name = "xonsh" },
 ]
 lint = [{ name = "ruff", specifier = ">=0.9.6" }]
 repl = [
     { name = "greenback", specifier = ">=1.1.1,<2.0.0" },
     { name = "pdbp", specifier = ">=1.8.2,<2.0.0" },
-    { name = "pexpect", specifier = ">=4.9.0" },
     { name = "prompt-toolkit", specifier = "==3.0.40" },
     { name = "pyperclip", specifier = ">=1.9.0" },
-    { name = "xonsh", git = "https://github.com/xonsh/xonsh.git?branch=main" },
+    { name = "xonsh" },
 ]
 testing = [{ name = "pytest" }]
 uis = [
     { name = "pyqt6", specifier = ">=6.7.0,<7.0.0" },
-    { name = "pyqtgraph", git = "https://github.com/pyqtgraph/pyqtgraph.git?branch=master" },
+    { name = "pyqtgraph", git = "https://github.com/pikers/pyqtgraph.git" },
     { name = "qdarkstyle", specifier = ">=3.0.2,<4.0.0" },
     { name = "rapidfuzz", specifier = ">=3.2.0,<4.0.0" },
 ]
@@ -1519,101 +1297,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/5b/5a/bc7b4a4ef808fa59a816c17b20c4bef6884daebbdf627ff2a161da67da19/propcache-0.4.1-py3-none-any.whl", hash = "sha256:af2a6052aeb6cf17d3e46ee169099044fd8224cbaf75c76a2ef596e8163e2237", size = 13305, upload-time = "2025-10-08T19:49:00.792Z" },
 ]
 
-[[package]]
-name = "psutil"
-version = "7.2.2"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/aa/c6/d1ddf4abb55e93cebc4f2ed8b5d6dbad109ecb8d63748dd2b20ab5e57ebe/psutil-7.2.2.tar.gz", hash = "sha256:0746f5f8d406af344fd547f1c8daa5f5c33dbc293bb8d6a16d80b4bb88f59372", size = 493740, upload-time = "2026-01-28T18:14:54.428Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/51/08/510cbdb69c25a96f4ae523f733cdc963ae654904e8db864c07585ef99875/psutil-7.2.2-cp313-cp313t-macosx_10_13_x86_64.whl", hash = "sha256:2edccc433cbfa046b980b0df0171cd25bcaeb3a68fe9022db0979e7aa74a826b", size = 130595, upload-time = "2026-01-28T18:14:57.293Z" },
-    { url = "https://files.pythonhosted.org/packages/d6/f5/97baea3fe7a5a9af7436301f85490905379b1c6f2dd51fe3ecf24b4c5fbf/psutil-7.2.2-cp313-cp313t-macosx_11_0_arm64.whl", hash = "sha256:e78c8603dcd9a04c7364f1a3e670cea95d51ee865e4efb3556a3a63adef958ea", size = 131082, upload-time = "2026-01-28T18:14:59.732Z" },
-    { url = "https://files.pythonhosted.org/packages/37/d6/246513fbf9fa174af531f28412297dd05241d97a75911ac8febefa1a53c6/psutil-7.2.2-cp313-cp313t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1a571f2330c966c62aeda00dd24620425d4b0cc86881c89861fbc04549e5dc63", size = 181476, upload-time = "2026-01-28T18:15:01.884Z" },
-    { url = "https://files.pythonhosted.org/packages/b8/b5/9182c9af3836cca61696dabe4fd1304e17bc56cb62f17439e1154f225dd3/psutil-7.2.2-cp313-cp313t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:917e891983ca3c1887b4ef36447b1e0873e70c933afc831c6b6da078ba474312", size = 184062, upload-time = "2026-01-28T18:15:04.436Z" },
-    { url = "https://files.pythonhosted.org/packages/16/ba/0756dca669f5a9300d0cbcbfae9a4c30e446dfc7440ffe43ded5724bfd93/psutil-7.2.2-cp313-cp313t-win_amd64.whl", hash = "sha256:ab486563df44c17f5173621c7b198955bd6b613fb87c71c161f827d3fb149a9b", size = 139893, upload-time = "2026-01-28T18:15:06.378Z" },
-    { url = "https://files.pythonhosted.org/packages/1c/61/8fa0e26f33623b49949346de05ec1ddaad02ed8ba64af45f40a147dbfa97/psutil-7.2.2-cp313-cp313t-win_arm64.whl", hash = "sha256:ae0aefdd8796a7737eccea863f80f81e468a1e4cf14d926bd9b6f5f2d5f90ca9", size = 135589, upload-time = "2026-01-28T18:15:08.03Z" },
-    { url = "https://files.pythonhosted.org/packages/81/69/ef179ab5ca24f32acc1dac0c247fd6a13b501fd5534dbae0e05a1c48b66d/psutil-7.2.2-cp314-cp314t-macosx_10_15_x86_64.whl", hash = "sha256:eed63d3b4d62449571547b60578c5b2c4bcccc5387148db46e0c2313dad0ee00", size = 130664, upload-time = "2026-01-28T18:15:09.469Z" },
-    { url = "https://files.pythonhosted.org/packages/7b/64/665248b557a236d3fa9efc378d60d95ef56dd0a490c2cd37dafc7660d4a9/psutil-7.2.2-cp314-cp314t-macosx_11_0_arm64.whl", hash = "sha256:7b6d09433a10592ce39b13d7be5a54fbac1d1228ed29abc880fb23df7cb694c9", size = 131087, upload-time = "2026-01-28T18:15:11.724Z" },
-    { url = "https://files.pythonhosted.org/packages/d5/2e/e6782744700d6759ebce3043dcfa661fb61e2fb752b91cdeae9af12c2178/psutil-7.2.2-cp314-cp314t-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:1fa4ecf83bcdf6e6c8f4449aff98eefb5d0604bf88cb883d7da3d8d2d909546a", size = 182383, upload-time = "2026-01-28T18:15:13.445Z" },
-    { url = "https://files.pythonhosted.org/packages/57/49/0a41cefd10cb7505cdc04dab3eacf24c0c2cb158a998b8c7b1d27ee2c1f5/psutil-7.2.2-cp314-cp314t-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:e452c464a02e7dc7822a05d25db4cde564444a67e58539a00f929c51eddda0cf", size = 185210, upload-time = "2026-01-28T18:15:16.002Z" },
-    { url = "https://files.pythonhosted.org/packages/dd/2c/ff9bfb544f283ba5f83ba725a3c5fec6d6b10b8f27ac1dc641c473dc390d/psutil-7.2.2-cp314-cp314t-win_amd64.whl", hash = "sha256:c7663d4e37f13e884d13994247449e9f8f574bc4655d509c3b95e9ec9e2b9dc1", size = 141228, upload-time = "2026-01-28T18:15:18.385Z" },
-    { url = "https://files.pythonhosted.org/packages/f2/fc/f8d9c31db14fcec13748d373e668bc3bed94d9077dbc17fb0eebc073233c/psutil-7.2.2-cp314-cp314t-win_arm64.whl", hash = "sha256:11fe5a4f613759764e79c65cf11ebdf26e33d6dd34336f8a337aa2996d71c841", size = 136284, upload-time = "2026-01-28T18:15:19.912Z" },
-    { url = "https://files.pythonhosted.org/packages/e7/36/5ee6e05c9bd427237b11b3937ad82bb8ad2752d72c6969314590dd0c2f6e/psutil-7.2.2-cp36-abi3-macosx_10_9_x86_64.whl", hash = "sha256:ed0cace939114f62738d808fdcecd4c869222507e266e574799e9c0faa17d486", size = 129090, upload-time = "2026-01-28T18:15:22.168Z" },
-    { url = "https://files.pythonhosted.org/packages/80/c4/f5af4c1ca8c1eeb2e92ccca14ce8effdeec651d5ab6053c589b074eda6e1/psutil-7.2.2-cp36-abi3-macosx_11_0_arm64.whl", hash = "sha256:1a7b04c10f32cc88ab39cbf606e117fd74721c831c98a27dc04578deb0c16979", size = 129859, upload-time = "2026-01-28T18:15:23.795Z" },
-    { url = "https://files.pythonhosted.org/packages/b5/70/5d8df3b09e25bce090399cf48e452d25c935ab72dad19406c77f4e828045/psutil-7.2.2-cp36-abi3-manylinux2010_x86_64.manylinux_2_12_x86_64.manylinux_2_28_x86_64.whl", hash = "sha256:076a2d2f923fd4821644f5ba89f059523da90dc9014e85f8e45a5774ca5bc6f9", size = 155560, upload-time = "2026-01-28T18:15:25.976Z" },
-    { url = "https://files.pythonhosted.org/packages/63/65/37648c0c158dc222aba51c089eb3bdfa238e621674dc42d48706e639204f/psutil-7.2.2-cp36-abi3-manylinux2014_aarch64.manylinux_2_17_aarch64.manylinux_2_28_aarch64.whl", hash = "sha256:b0726cecd84f9474419d67252add4ac0cd9811b04d61123054b9fb6f57df6e9e", size = 156997, upload-time = "2026-01-28T18:15:27.794Z" },
-    { url = "https://files.pythonhosted.org/packages/8e/13/125093eadae863ce03c6ffdbae9929430d116a246ef69866dad94da3bfbc/psutil-7.2.2-cp36-abi3-musllinux_1_2_aarch64.whl", hash = "sha256:fd04ef36b4a6d599bbdb225dd1d3f51e00105f6d48a28f006da7f9822f2606d8", size = 148972, upload-time = "2026-01-28T18:15:29.342Z" },
-    { url = "https://files.pythonhosted.org/packages/04/78/0acd37ca84ce3ddffaa92ef0f571e073faa6d8ff1f0559ab1272188ea2be/psutil-7.2.2-cp36-abi3-musllinux_1_2_x86_64.whl", hash = "sha256:b58fabe35e80b264a4e3bb23e6b96f9e45a3df7fb7eed419ac0e5947c61e47cc", size = 148266, upload-time = "2026-01-28T18:15:31.597Z" },
-    { url = "https://files.pythonhosted.org/packages/b4/90/e2159492b5426be0c1fef7acba807a03511f97c5f86b3caeda6ad92351a7/psutil-7.2.2-cp37-abi3-win_amd64.whl", hash = "sha256:eb7e81434c8d223ec4a219b5fc1c47d0417b12be7ea866e24fb5ad6e84b3d988", size = 137737, upload-time = "2026-01-28T18:15:33.849Z" },
-    { url = "https://files.pythonhosted.org/packages/8c/c7/7bb2e321574b10df20cbde462a94e2b71d05f9bbda251ef27d104668306a/psutil-7.2.2-cp37-abi3-win_arm64.whl", hash = "sha256:8c233660f575a5a89e6d4cb65d9f938126312bca76d8fe087b947b3a1aaac9ee", size = 134617, upload-time = "2026-01-28T18:15:36.514Z" },
-]
-
-[[package]]
-name = "ptyprocess"
-version = "0.7.0"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/20/e5/16ff212c1e452235a90aeb09066144d0c5a6a8c0834397e03f5224495c4e/ptyprocess-0.7.0.tar.gz", hash = "sha256:5c5d0a3b48ceee0b48485e0c26037c0acd7d29765ca3fbb5cb3831d347423220", size = 70762, upload-time = "2020-12-28T15:15:30.155Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/22/a6/858897256d0deac81a172289110f31629fc4cee19b6f01283303e18c8db3/ptyprocess-0.7.0-py2.py3-none-any.whl", hash = "sha256:4b41f3967fce3af57cc7e94b888626c18bf37a083e3651ca8feeb66d492fef35", size = 13993, upload-time = "2020-12-28T15:15:28.35Z" },
-]
-
-[[package]]
-name = "py-cid"
-version = "0.4.0"
-source = { registry = "https://pypi.org/simple" }
-dependencies = [
-    { name = "morphys" },
-    { name = "py-multibase" },
-    { name = "py-multicodec" },
-    { name = "py-multihash" },
-]
-sdist = { url = "https://files.pythonhosted.org/packages/e7/09/c0ca25eac91c62f6f22f5ac6accd0bfa957e77adfdffd0eccc0700f2ea07/py_cid-0.4.0.tar.gz", hash = "sha256:7c15d6a83f59c3a4c7fbff793f1d4cbfc831e90355fd0e2c5cfe927c21733cc3", size = 25970, upload-time = "2025-12-19T16:55:01.057Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/80/39/d5c1828e79526002f1bf87b9daba01c7db445960daf341e1dd84a5ff0469/py_cid-0.4.0-py3-none-any.whl", hash = "sha256:6a3183a3088b219dbf3cb37eec7d47a644be3f3ebabdf38347c2e9312621d6cc", size = 8833, upload-time = "2025-12-19T16:54:59.233Z" },
-]
-
-[[package]]
-name = "py-multibase"
-version = "2.0.0"
-source = { registry = "https://pypi.org/simple" }
-dependencies = [
-    { name = "morphys" },
-    { name = "python-baseconv" },
-    { name = "six" },
-]
-sdist = { url = "https://files.pythonhosted.org/packages/bc/52/5ed393ab49df7e3b03995d3c4e53bae1e8c2ca40909cf25a41b346c09a38/py_multibase-2.0.0.tar.gz", hash = "sha256:58c1a264195fa1ae29ea707c6fc8196446f4bdb92e0f9a0f131e0f280b238839", size = 26857, upload-time = "2025-12-18T02:24:49.132Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/36/c7/38035079d9978b32b962f996f1cccaa166ecfe38723ab4349ab32166c037/py_multibase-2.0.0-py3-none-any.whl", hash = "sha256:b29ce489b556134e73998a11712c406b70950812955df64084754e0774e40900", size = 10608, upload-time = "2025-12-18T02:24:47.827Z" },
-]
-
-[[package]]
-name = "py-multicodec"
-version = "1.0.0"
-source = { registry = "https://pypi.org/simple" }
-dependencies = [
-    { name = "varint" },
-]
-sdist = { url = "https://files.pythonhosted.org/packages/5e/26/ef24db0fbfec080b72c5ac4a1000da3a4d696a1e31862c695d683097a1b5/py_multicodec-1.0.0.tar.gz", hash = "sha256:78e4e3e47b6288cf635c3ca987152e6cb5510bdcdab307e7690c76ec3d5bbfeb", size = 44668, upload-time = "2025-12-18T20:41:37.976Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/76/da/768d07490faeae88ac361184164be9c262fececc3c6241b5fc471be4f659/py_multicodec-1.0.0-py3-none-any.whl", hash = "sha256:ae2e687bac8fdf54e3f5b3feded36b61a304d5e3c3af9438f7481f543ec15b8d", size = 26200, upload-time = "2025-12-18T20:41:37.055Z" },
-]
-
-[[package]]
-name = "py-multihash"
-version = "3.0.0"
-source = { registry = "https://pypi.org/simple" }
-dependencies = [
-    { name = "base58" },
-    { name = "blake3" },
-    { name = "mmh3" },
-    { name = "morphys" },
-    { name = "six" },
-    { name = "varint" },
-]
-sdist = { url = "https://files.pythonhosted.org/packages/11/3d/ed68b0eccd0654f7f3c163d9b3d428f903e5e3e884ab1f0d0a16ba6a4f11/py_multihash-3.0.0.tar.gz", hash = "sha256:2e848941de5ef0533ca26b81940e2ffcf7b4322a3f803e8c97f4f0eca8767aa7", size = 41630, upload-time = "2025-12-17T19:30:00.596Z" }
-wheels = [
-    { url = "https://files.pythonhosted.org/packages/24/e2/d65606db8369916fb5a9b4fe14df7e6072970d919300f3fb1c989a1d8e7d/py_multihash-3.0.0-py3-none-any.whl", hash = "sha256:3863ec1313b4eac1e5169137c143d40bf77456e57388f839441deba089f87326", size = 21215, upload-time = "2025-12-17T19:29:59.322Z" },
-]
-
 [[package]]
 name = "pyarrow"
 version = "22.0.0"
@@ -1802,10 +1485,9 @@ wheels = [
 
 [[package]]
 name = "pyqtgraph"
-version = "0.15.0.dev0"
+version = "0.12.3"
-source = { git = "https://github.com/pyqtgraph/pyqtgraph.git?branch=master#d588dd3ec30915e61c8496a0fe1db21fc25e4da5" }
+source = { git = "https://github.com/pikers/pyqtgraph.git#373f9561ea8ec4fef9b4e8bdcdd4bbf372dd6512" }
 dependencies = [
-    { name = "colorama" },
     { name = "numpy" },
 ]
 
@@ -1834,12 +1516,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/3b/ab/b3226f0bd7cdcf710fbede2b3548584366da3b19b5021e74f5bde2a8fa3f/pytest-9.0.2-py3-none-any.whl", hash = "sha256:711ffd45bf766d5264d487b917733b453d917afd2b0ad65223959f59089f875b", size = 374801, upload-time = "2025-12-06T21:30:49.154Z" },
 ]
 
-[[package]]
-name = "python-baseconv"
-version = "1.2.2"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/33/d0/9297d7d8dd74767b4d5560d834b30b2fff17d39987c23ed8656f476e0d9b/python-baseconv-1.2.2.tar.gz", hash = "sha256:0539f8bd0464013b05ad62e0a1673f0ac9086c76b43ebf9f833053527cd9931b", size = 4929, upload-time = "2019-04-04T19:28:57.17Z" }
-
 [[package]]
 name = "python-dateutil"
 version = "2.9.0.post0"
@@ -2167,13 +1843,12 @@ source = { git = "https://github.com/pikers/tomlkit.git?branch=piker_pin#8e0239a
 [[package]]
 name = "tractor"
 version = "0.1.0a6.dev0"
-source = { editable = "../tractor" }
+source = { git = "https://github.com/goodboy/tractor.git?branch=piker_pin#e232d9dd06f41b8dca997f0647f2083d27cc34f2" }
 dependencies = [
     { name = "bidict" },
     { name = "cffi" },
     { name = "colorlog" },
     { name = "msgspec" },
-    { name = "multiaddr" },
     { name = "pdbp" },
     { name = "platformdirs" },
     { name = "tricycle" },
@@ -2181,49 +1856,6 @@ dependencies = [
     { name = "wrapt" },
 ]
 
-[package.metadata]
-requires-dist = [
-    { name = "bidict", specifier = ">=0.23.1" },
-    { name = "cffi", specifier = ">=1.17.1" },
-    { name = "colorlog", specifier = ">=6.8.2,<7" },
-    { name = "msgspec", specifier = ">=0.19.0" },
-    { name = "multiaddr", specifier = ">=0.1.1" },
-    { name = "pdbp", specifier = ">=1.8.2,<2" },
-    { name = "platformdirs", specifier = ">=4.4.0" },
-    { name = "tricycle", specifier = ">=0.4.1,<0.5" },
-    { name = "trio", specifier = ">0.27" },
-    { name = "wrapt", specifier = ">=1.16.0,<2" },
-]
-
-[package.metadata.requires-dev]
-dev = [
-    { name = "greenback", specifier = ">=1.2.1,<2" },
-    { name = "pexpect", specifier = ">=4.9.0,<5" },
-    { name = "prompt-toolkit", specifier = ">=3.0.50" },
-    { name = "psutil", specifier = ">=7.0.0" },
-    { name = "pyperclip", specifier = ">=1.9.0" },
-    { name = "pytest", specifier = ">=8.3.5" },
-    { name = "stackscope", specifier = ">=0.2.2,<0.3" },
-    { name = "typing-extensions", specifier = ">=4.14.1" },
-    { name = "xonsh", specifier = ">=0.22.1" },
-]
-devx = [
-    { name = "greenback", specifier = ">=1.2.1,<2" },
-    { name = "stackscope", specifier = ">=0.2.2,<0.3" },
-    { name = "typing-extensions", specifier = ">=4.14.1" },
-]
-lint = [{ name = "ruff", specifier = ">=0.9.6" }]
-repl = [
-    { name = "prompt-toolkit", specifier = ">=3.0.50" },
-    { name = "psutil", specifier = ">=7.0.0" },
-    { name = "pyperclip", specifier = ">=1.9.0" },
-    { name = "xonsh", specifier = ">=0.22.1" },
-]
-testing = [
-    { name = "pexpect", specifier = ">=4.9.0,<5" },
-    { name = "pytest", specifier = ">=8.3.5" },
-]
-
 [[package]]
 name = "tricycle"
 version = "0.4.1"
@@ -2371,12 +2003,6 @@ wheels = [
     { url = "https://files.pythonhosted.org/packages/e4/16/c1fd27e9549f3c4baf1dc9c20c456cd2f822dbf8de9f463824b0c0357e06/uvloop-0.22.1-cp314-cp314t-musllinux_1_2_x86_64.whl", hash = "sha256:6cde23eeda1a25c75b2e07d39970f3374105d5eafbaab2a4482be82f272d5a5e", size = 4296730, upload-time = "2025-10-16T22:17:00.744Z" },
 ]
 
-[[package]]
-name = "varint"
-version = "1.0.2"
-source = { registry = "https://pypi.org/simple" }
-sdist = { url = "https://files.pythonhosted.org/packages/a8/fe/1ea0ba0896dfa47186692655b86db3214c4b7c9e0e76c7b1dc257d101ab1/varint-1.0.2.tar.gz", hash = "sha256:a6ecc02377ac5ee9d65a6a8ad45c9ff1dac8ccee19400a5950fb51d594214ca5", size = 1886, upload-time = "2016-02-24T20:42:38.5Z" }
-
 [[package]]
 name = "wcwidth"
 version = "0.2.14"
@@ -2469,8 +2095,14 @@ wheels = [
 
 [[package]]
 name = "xonsh"
-version = "0.22.1"
+version = "0.20.0"
-source = { git = "https://github.com/xonsh/xonsh.git?branch=main#336658ff0919f8d7bb96d581136d37d470a8fe99" }
+source = { registry = "https://pypi.org/simple" }
+sdist = { url = "https://files.pythonhosted.org/packages/56/af/7e2ba3885da44cbe03c7ff46f90ea917ba10d91dc74d68604001ea28055f/xonsh-0.20.0.tar.gz", hash = "sha256:d44a50ee9f288ff96bd0456f0a38988ef6d4985637140ea793beeef5ec5d2d38", size = 811907, upload-time = "2025-11-24T07:50:50.847Z" }
+wheels = [
+    { url = "https://files.pythonhosted.org/packages/e8/db/1c5c057c0b2a89b8919477726558685720ae0849ea1a98a3803e93550824/xonsh-0.20.0-py311-none-any.whl", hash = "sha256:65d27ba31d558f79010d6c652751449fd3ed4df1f1eda78040a6427fa0a0f03e", size = 646312, upload-time = "2025-11-24T07:50:49.488Z" },
+    { url = "https://files.pythonhosted.org/packages/d2/a2/d6f7534f31489a4b8b54bd2a2496248f86f7c21a6a6ce9bfdcdd389fe4e7/xonsh-0.20.0-py312-none-any.whl", hash = "sha256:3148900e67b9c2796bef6f2eda003b0a64d4c6f50a0db23324f786d9e1af9353", size = 646323, upload-time = "2025-11-24T07:50:43.028Z" },
+    { url = "https://files.pythonhosted.org/packages/bd/48/bcb1e4d329c3d522bc29b066b0b6ee86938ec392376a29c36fac0ad1c586/xonsh-0.20.0-py313-none-any.whl", hash = "sha256:c83daaf6eb2960180fc5a507459dbdf6c0d6d63e1733c43f4e43db77255c7278", size = 646830, upload-time = "2025-11-24T07:50:45.078Z" },
+]
 
 [[package]]
 name = "yapic-json"